diff -uNr linux-2.2.16.SuSE/Documentation/Configure.help linux.compile/Documentation/Configure.help --- linux-2.2.16.SuSE/Documentation/Configure.help Mon Jul 17 22:36:26 2000 +++ linux.compile/Documentation/Configure.help Wed Jul 19 01:22:10 2000 @@ -2159,6 +2159,17 @@ CONFIG_FB_S3TRIO If you have a S3 Trio say Y. Say N for S3 Virge. +nVidia Riva support (EXPERIMENTAL) +CONFIG_FB_RIVA + This driver supports graphics boards with the nVidia Riva (aka TNTx) + chips. + Say Y if you have such a graphics board. + + The driver is also available as a module ( = code which can be + inserted and removed from the running kernel whenever you want). The + module will be called rivafb.o. If you want to compile it as a + module, say M here and read Documentation/modules.txt. + ATI Mach64 display support CONFIG_FB_ATY This driver supports graphics boards with the ATI Mach64 chips. @@ -2219,11 +2230,11 @@ Matrox unified accelerated driver CONFIG_FB_MATROX - Say Y here if you have Matrox Millennium, Matrox Millennium II, + Say Y here if you have a Matrox Millennium, Matrox Millennium II, Matrox Mystique, Matrox Mystique 220, Matrox Productiva G100, Matrox - Mystique G200, Matrox Millennium G200 or Matrox Marvel G200 video - card in your box. At this time, support for the G100, Mystique G200 - and Marvel G200 is untested. + Mystique G200, Matrox Millennium G200, Matrox Marvel G200 video or + Matrox G400 card in your box. At this time, support for the G100, + Mystique G200 and Marvel G200 is untested. This driver is also available as a module ( = code which can be inserted and removed from the running kernel whenever you want). @@ -2252,7 +2263,7 @@ packed pixel and 32 bpp packed pixel. You can also use font widths different from 8. -Matrox G100/G200 support +Matrox G100/G200/G400 support CONFIG_FB_MATROX_G100 Say Y here if you have a Matrox Productiva G100, Matrox Mystique G200, Matrox Marvel G200 or Matrox Millennium G200 video card. If @@ -2260,19 +2271,68 @@ bpp packed pixel, 16 bpp packed pixel, 24 bpp packed pixel and 32 bpp packed pixel. You can also use font widths different from 8. + If you need support for G400 secondary head, you must first say Y to + "I2C support" and "I2C bit-banging support" in the character devices + section, and then to "Matrox I2C support" and "G400 second head + support" here in the framebuffer section. + +Matrox I2C support +CONFIG_FB_MATROX_I2C + This drivers creates I2C buses which are needed for accessing the + DDC (I2C) bus present on all Matroxes, an I2C bus which + interconnects Matrox optional devices, like MGA-TVO on G200 and + G400, and the secondary head DDC bus, present on G400 only. + + You can say Y or M here if you want to experiment with monitor + detection code. You must say Y or M here if you want to use either + second head of G400 or MGA-TVO on G200 or G400. + + If you compile it as module, it will create a module named + i2c-matroxfb.o. + +Matrox G400 second head support +CONFIG_FB_MATROX_MAVEN + Say Y or M here if you want to use a secondary head (meaning two + monitors in parallel) on G400 or MGA-TVO add-on on G200. Secondary + head is not compatible with accelerated XFree 3.3.x SVGA servers - + secondary head output is blanked while you are in X. With XFree + 3.9.17 preview you can use both heads if you use SVGA over fbdev or + the fbdev driver on first head and the fbdev driver on second head. + + If you compile it as module, two modules are created, + matroxfb_crtc2.o and matroxfb_maven.o. Matroxfb_maven is needed for + both G200 and G400, matroxfb_crtc2 is needed only by G400. You must + also load i2c-matroxfb to get it to run. + + The driver starts in monitor mode and you must use the matroxset + tool (available at ftp://platan.vc.cvut.cz/pub/linux/matrox-latest) + to switch it to PAL or NTSC or to swap primary and secondary head + outputs. Secondary head driver also always start in 640x480 + resolution, you must use fbset to change it. + + Also do not forget that second head supports only 16 and 32 bpp + packed pixels, so it is a good idea to compile them into the kernel + too. You can use only some font widths, as the driver uses generic + painting procedures (the secondary head does not use acceleration + engine). + + There is no need for enabling 'Matrox multihead support' if you have + only one Matrox card in the box. + Matrox unified driver multihead support CONFIG_FB_MATROX_MULTIHEAD Say Y here if you have more than one (supported) Matrox device in - your computer and you want to use all of them. If you have only one - device, you should say N because the driver compiled with Y is - larger and a bit slower, especially on ia32 (ix86). + your computer and you want to use all of them for different monitors + ("multihead"). If you have only one device, you should say N because + the driver compiled with Y is larger and a bit slower, especially on + ia32 (ix86). If you said M to "Matrox unified accelerated driver" and N here, you - will still be able to use several Matrox devices simultaneously. - This is slightly faster but uses 40 KB of kernel memory per Matrox - card. You do this by inserting several instances of the module - matroxfb.o into the kernel with insmod, supplying the parameter - "dev=N" where N is 0, 1, etc. for the different Matrox devices. + will still be able to use several Matrox devices simultaneously: + insert several instances of the module matroxfb.o into the kernel + with insmod, supplying the parameter "dev=N" where N is 0, 1, etc. + for the different Matrox devices. This method is slightly faster but + uses 40 KB of kernel memory per Matrox card. MDA text console (dual-headed) CONFIG_MDA_CONSOLE diff -uNr linux-2.2.16.SuSE/Documentation/fb/matroxfb.txt linux.compile/Documentation/fb/matroxfb.txt --- linux-2.2.16.SuSE/Documentation/fb/matroxfb.txt Thu Apr 29 20:53:41 1999 +++ linux.compile/Documentation/fb/matroxfb.txt Wed Jul 19 01:22:10 2000 @@ -105,7 +105,7 @@ Configuration ============= -You can pass kernel command line options to vesafb with +You can pass kernel command line options to matroxfb with `video=matrox:option1,option2:value2,option3' (multiple options should be separated by comma, values are separated from options by `:'). Accepted options: @@ -178,7 +178,7 @@ nofastfont - disables fastfont feature. It is default. fastfont:X - enables fastfont feature. X specifies size of memory reserved for font data, it must be >= (fontwidth*fontheight*chars_in_font)/8. - It is faster on Gx00 series, but slower on older cards. + It may be faster on some Gx00 cards, but slower on other cards. grayscale - enable grayscale summing. It works in PSEUDOCOLOR modes (text, 4bpp, 8bpp). In DIRECTCOLOR modes it is limited to characters displayed through putc/putcs. Direct accesses to framebuffer @@ -191,6 +191,10 @@ limitations which do not allow this. But this option is incompatible with some (if not all yet released) versions of XF86_FBDev. +dfp - enables digital flat panel interface. This option is incompatible with + secondary (TV) output - if DFP is active, TV output must be + inactive and vice versa. DFP always uses same timming as primary + (monitor) output. vesa:X - selects startup videomode. X is number from 0 to 0x1FF, see table above for detailed explanation. Default is 640x480x8bpp if driver has 8bpp support. Otherwise first available of 640x350x4bpp, @@ -276,16 +280,16 @@ + color keying is not supported + feature connector of Mystique and Gx00 is set to VGA mode (it is disabled by BIOS) - + DCC (monitor detection) protocol is not implemented + + DDC (monitor detection) is supported through dualhead driver + some check for input values are not so strict how it should be (you can specify vslen=4000 and so on). + maybe more... And following features: + 4bpp is available only on Millennium I and Millennium II. It is hardware limitation. - + current fbset is not able to set 15bpp videomode: you must specify - depth==16 and green.length==5. fbset does not allow you to set - green.length. + + selection between 1:5:5:5 and 5:6:5 16bpp videomode is done by -rgba + option of fbset: "fbset -depth 16 -rgba 5,5,5" selects 1:5:5:5, anything + else selects 5:6:5 mode. + text mode uses 6 bit VGA palette instead of 8 bit (one of 262144 colors instead of one of 16M colors). It is due to hardware limitation of Millennium I/II and SVGALib compatibility. @@ -329,6 +333,27 @@ 8x16 Millennium I G200 TEXT 3.29 1.50 + + +Dualhead G400 +============= +Driver supports dualhead G400 with some limitations: + + secondary head shares videomemory with primary head. It is not problem + if you have 32MB of videoram, but if you have only 16MB, you may have + to think twice before choosing videomode (for example twice 1880x1440x32bpp + is not possible). + + due to hardware limitation, secondary head can use only 16 and 32bpp + videomodes. + + secondary head is not accelerated. There were bad problems with accelerated + XFree when secondary head used to use acceleration. + + secondary head always powerups in 640x480@60-32 videomode. You have to use + fbset to change this mode. + + secondary head always powerups in monitor mode. You have to use matroxset + to change it to TV mode. Also, you must select at least 525 lines for + NTSC output and 625 lines for PAL output. + + kernel is not fully multihead ready. So some things are impossible to do. + + if you compiled it as module, you must insert i2c-matroxfb, matroxfb_maven + and matroxfb_crtc2 into kernel. * Yes, it is slower than Millennium I. diff -uNr linux-2.2.16.SuSE/drivers/pci/oldproc.c linux.compile/drivers/pci/oldproc.c --- linux-2.2.16.SuSE/drivers/pci/oldproc.c Mon Jul 17 22:36:14 2000 +++ linux.compile/drivers/pci/oldproc.c Wed Jul 19 01:22:10 2000 @@ -155,6 +155,7 @@ DEVICE( MATROX, MATROX_MIL_2_AGP,"Millennium II AGP"), DEVICE( MATROX, MATROX_G200_PCI,"Matrox G200 PCI"), DEVICE( MATROX, MATROX_G200_AGP,"Matrox G200 AGP"), + DEVICE( MATROX, MATROX_G400, "Matrox G400"), DEVICE( MATROX, MATROX_MGA_IMP, "MGA Impression"), DEVICE( MATROX, MATROX_G100_MM, "Matrox G100 multi monitor"), DEVICE( MATROX, MATROX_G100_AGP,"Matrox G100 AGP"), @@ -346,6 +347,14 @@ DEVICE( CERN, CERN_SPSB_PCI, "STAR/RD24 SCI-PCI (PMC)"), DEVICE( CERN, CERN_HIPPI_DST, "HIPPI destination"), DEVICE( CERN, CERN_HIPPI_SRC, "HIPPI source"), + DEVICE( NVIDIA, NVIDIA_TNT, "nVidia Riva TnT 128 (NV4)"), + DEVICE( NVIDIA, NVIDIA_TNT2, "nVidia Riva TnT2 (NV5)"), + DEVICE( NVIDIA, NVIDIA_UTNT2, "nVidia Riva TnT2 Ultra (NV5)"), + DEVICE( NVIDIA, NVIDIA_VTNT2, "nVidia Vanta (NV6)"), + DEVICE( NVIDIA, NVIDIA_UVTNT2, "nVidia Vanta TnT2 (NV6)"), + DEVICE( NVIDIA, NVIDIA_ITNT2, "nVidia Riva TnT2"), + DEVICE( NVIDIA, NVIDIA_GEFORCE, "nVidia GeForce 256"), + DEVICE( NVIDIA, NVIDIA_GEFORCED,"nVidia GeForce 256 DDR"), DEVICE( IMS, IMS_8849, "8849"), DEVICE( TEKRAM2, TEKRAM2_690c, "DC690c"), DEVICE( TUNDRA, TUNDRA_CA91C042,"CA91C042 Universe"), diff -uNr linux-2.2.16.SuSE/drivers/video/Config.in linux.compile/drivers/video/Config.in --- linux-2.2.16.SuSE/drivers/video/Config.in Mon Jul 17 22:36:02 2000 +++ linux.compile/drivers/video/Config.in Wed Jul 19 01:22:10 2000 @@ -85,14 +85,23 @@ fi if [ "$CONFIG_EXPERIMENTAL" = "y" ]; then if [ "$CONFIG_PCI" != "n" ]; then - tristate 'Matrox acceleration' CONFIG_FB_MATROX - if [ "$CONFIG_FB_MATROX" != "n" ]; then - bool ' Millennium I/II support' CONFIG_FB_MATROX_MILLENIUM - bool ' Mystique support' CONFIG_FB_MATROX_MYSTIQUE - bool ' G100/G200 support' CONFIG_FB_MATROX_G100 - bool ' Multihead support' CONFIG_FB_MATROX_MULTIHEAD + tristate ' Matrox fbdev (accelerated)' CONFIG_FB_MATROX + if [ "$CONFIG_FB_MATROX" != "n" ]; then + bool ' Millennium I/II support' CONFIG_FB_MATROX_MILLENIUM + bool ' Mystique support' CONFIG_FB_MATROX_MYSTIQUE + bool ' G100/G200/G400 support' CONFIG_FB_MATROX_G100 + if [ "$CONFIG_I2C" != "n" ]; then + dep_tristate ' Matrox I2C support' CONFIG_FB_MATROX_I2C $CONFIG_FB_MATROX $CONFIG_I2C_ALGOBIT + if [ "$CONFIG_FB_MATROX_G100" = "y" ]; then + dep_tristate ' G400 second head support' CONFIG_FB_MATROX_MAVEN $CONFIG_FB_MATROX_I2C + fi + fi + bool ' Multihead support' CONFIG_FB_MATROX_MULTIHEAD fi bool 'ATI Rage128 display support' CONFIG_FB_ATY128 + if [ "$CONFIG_PCI" = "y" ]; then + tristate ' nVidia Riva support (EXPERIMENTAL)' CONFIG_FB_RIVA + fi fi fi if [ "$ARCH" = "sparc" -o "$ARCH" = "sparc64" ]; then diff -uNr linux-2.2.16.SuSE/drivers/video/Makefile linux.compile/drivers/video/Makefile --- linux-2.2.16.SuSE/drivers/video/Makefile Mon Jul 17 22:36:02 2000 +++ linux.compile/drivers/video/Makefile Thu Jul 20 00:37:56 2000 @@ -15,6 +15,12 @@ LX_OBJS := MX_OBJS := MOD_LIST_NAME := VIDEO_MODULES +MOD_TO_LIST := + +SUB_DIRS := +MOD_SUB_DIRS := $(SUB_DIRS) +MOD_IN_SUB_DIRS := +ALL_SUB_DIRS := $(SUB_DIRS) matrox riva CONFIG_FBGEN_BUILTIN := CONFIG_FBGEN_MODULE := @@ -186,6 +192,34 @@ endif endif +ifeq ($(CONFIG_FB_MATROX),y) +SUB_DIRS += matrox +MOD_IN_SUB_DIRS += matrox +L_OBJS += matrox/matrox.o +else + ifeq ($(CONFIG_FB_MATROX),m) + MOD_IN_SUB_DIRS += matrox + MOD_TO_LIST += matrox.o + endif +endif + +ifeq ($(CONFIG_FB_MATROX_I2C),m) +MOD_TO_LIST += i2c-matroxfb.o +endif +ifeq ($(CONFIG_FB_MATROX_MAVEN),m) +MOD_TO_LIST += matroxfb_maven.o matroxfb_crtc2.o +endif + +ifeq ($(CONFIG_FB_RIVA),y) +SUB_DIRS += riva +L_OBJS += riva/rivafb.o +else + ifeq ($(CONFIG_FB_RIVA),m) + MOD_IN_SUB_DIRS += riva + MOD_TO_LIST += rivafb.o + endif +endif + ifeq ($(CONFIG_FB_S3TRIO),y) L_OBJS += S3triofb.o else @@ -347,14 +381,6 @@ else ifdef CONFIG_FBGEN_MODULE MX_OBJS += fbgen.o - endif -endif - -ifeq ($(CONFIG_FB_MATROX),y) -L_OBJS += matroxfb.o -else - ifeq ($(CONFIG_FB_MATROX),m) - M_OBJS += matroxfb.o endif endif diff -uNr linux-2.2.16.SuSE/drivers/video/fbmem.c linux.compile/drivers/video/fbmem.c --- linux-2.2.16.SuSE/drivers/video/fbmem.c Mon Jul 17 22:36:02 2000 +++ linux.compile/drivers/video/fbmem.c Thu Jul 20 02:54:31 2000 @@ -88,6 +88,8 @@ extern void vga16fb_setup(char *options, int *ints); extern void matroxfb_init(void); extern void matroxfb_setup(char* options, int *ints); +extern void rivafb_init_22(void); +extern void rivafb_setup(char* options, int *ints); extern void hpfb_init(void); extern void hpfb_setup(char *options, int *ints); extern void sbusfb_init(void); @@ -180,6 +182,9 @@ #ifdef CONFIG_FB_MATROX { "matrox", matroxfb_init, matroxfb_setup }, #endif +#ifdef CONFIG_FB_RIVA + { "riva", rivafb_init_22, rivafb_setup }, +#endif #ifdef CONFIG_FB_HP300 { "hpfb", hpfb_init, hpfb_setup }, #endif @@ -338,9 +343,10 @@ if (newidx != con2fb_map[unit]) { oldfb = registered_fb[oldidx]; newfb = registered_fb[newidx]; - if (newfb->fbops->fb_open(newfb,0)) + if (newfb->fbops->fb_open && newfb->fbops->fb_open(newfb,0)) return; - oldfb->fbops->fb_release(oldfb,0); + if (oldfb->fbops->fb_release) + oldfb->fbops->fb_release(oldfb,0); conp = fb_display[unit].conp; fontdata = fb_display[unit].fontdata; fontwidth = fb_display[unit]._fontwidth; @@ -595,7 +601,9 @@ #endif /* CONFIG_KMOD */ if (!(info = registered_fb[fbidx])) return -ENODEV; - return info->fbops->fb_open(info,1); + if (info->fbops->fb_open) + return info->fbops->fb_open(info,1); + else return 0; } static int @@ -604,7 +612,8 @@ int fbidx = GET_FB_IDX(inode->i_rdev); struct fb_info *info = registered_fb[fbidx]; - info->fbops->fb_release(info,1); + if (info->fbops->fb_release) + info->fbops->fb_release(info,1); return 0; } @@ -644,7 +653,8 @@ */ for (j = 0; j < MAX_NR_CONSOLES; j++) if (con2fb_map[j] == i) - fb_info->fbops->fb_open(fb_info,0); + if (fb_info->fbops->fb_open) + fb_info->fbops->fb_open(fb_info,0); fb_ever_opened[i] = 1; } diff -uNr linux-2.2.16.SuSE/drivers/video/matrox/Makefile linux.compile/drivers/video/matrox/Makefile --- linux-2.2.16.SuSE/drivers/video/matrox/Makefile Thu Jan 1 01:00:00 1970 +++ linux.compile/drivers/video/matrox/Makefile Wed Jul 19 01:22:10 2000 @@ -0,0 +1,47 @@ +# Makefile for the Linux video drivers. +# 5 Aug 1999, James Simmons, +# Rewritten to use lists instead of if-statements. +# Rewritten to use if-statements for 2.2 kernel again (garloff@suse.de) + +SUB_DIRS := + +O_TARGET := matrox.o +O_OBJS := +M_OBJS := +MX_OBJS := +MIX_OBJS := + +#MOD_LIST_NAME := MATROX_MODULES + +ifeq ($(CONFIG_FB_MATROX),y) +OX_OBJS := matroxfb_base.o +O_OBJS := matroxfb_DAC1064.o matroxfb_Ti3026.o matroxfb_accel.o matroxfb_misc.o +else + ifeq ($(CONFIG_FB_MATROX),m) + OX_OBJS := matroxfb_base.o + O_OBJS := matroxfb_DAC1064.o matroxfb_Ti3026.o matroxfb_accel.o matroxfb_misc.o + M_OBJS += matrox.o + endif +endif + +ifeq ($(CONFIG_FB_MATROX_I2C),y) +OX_OBJS += i2c-matroxfb.o +else + ifeq ($(CONFIG_FB_MATROX_I2C),m) + MX_OBJS += i2c-matroxfb.o + endif +endif + +ifeq ($(CONFIG_FB_MATROX_MAVEN),y) +OX_OBJS += matroxfb_maven.o matroxfb_crtc2.o +else + ifeq ($(CONFIG_FB_MATROX_MAVEN),m) + MX_OBJS += matroxfb_maven.o matroxfb_crtc2.o + endif +endif + +# Now include make rules +include $(TOPDIR)/Rules.make + +clean: + rm -f core *.o *.a *.s diff -uNr linux-2.2.16.SuSE/drivers/video/matrox/i2c-matroxfb.c linux.compile/drivers/video/matrox/i2c-matroxfb.c --- linux-2.2.16.SuSE/drivers/video/matrox/i2c-matroxfb.c Thu Jan 1 01:00:00 1970 +++ linux.compile/drivers/video/matrox/i2c-matroxfb.c Wed Jul 19 01:22:10 2000 @@ -0,0 +1,352 @@ +#include "matroxfb_base.h" +#include "matroxfb_maven.h" +#include +#include +#include + +/* MGA-TVO I2C for G200, G400 */ +#define MAT_CLK 0x20 +#define MAT_DATA 0x10 +/* primary head DDC for Mystique(?), G100, G200, G400 */ +#define DDC1_CLK 0x08 +#define DDC1_DATA 0x02 +/* primary head DDC for Millennium, Millennium II */ +#define DDC1B_CLK 0x10 +#define DDC1B_DATA 0x04 +/* secondary head DDC for G400 */ +#define DDC2_CLK 0x04 +#define DDC2_DATA 0x01 + +/******************************************************/ + +static int matroxfb_read_gpio(struct matrox_fb_info* minfo) { + unsigned long flags; + int v; + + matroxfb_DAC_lock_irqsave(flags); + v = matroxfb_DAC_in(PMINFO DAC_XGENIODATA); + matroxfb_DAC_unlock_irqrestore(flags); + return v; +} + +static inline void matroxfb_set_gpio(struct matrox_fb_info* minfo, int mask, int val) { + unsigned long flags; + int v; + + matroxfb_DAC_lock_irqsave(flags); + v = (matroxfb_DAC_in(PMINFO DAC_XGENIOCTRL) & mask) | val; + matroxfb_DAC_out(PMINFO DAC_XGENIOCTRL, v); + /* We must reset GENIODATA very often... XFree plays with this register */ + matroxfb_DAC_out(PMINFO DAC_XGENIODATA, 0x00); + matroxfb_DAC_unlock_irqrestore(flags); +} + +/* software I2C functions */ +static void matroxfb_i2c_set(struct matrox_fb_info* minfo, int mask, int state) { + if (state) + state = 0; + else + state = mask; + matroxfb_set_gpio(minfo, ~mask, state); +} + +static void matroxfb_maven_setsda(void* data, int state) { + matroxfb_i2c_set(data, MAT_DATA, state); +} + +static void matroxfb_maven_setscl(void* data, int state) { + matroxfb_i2c_set(data, MAT_CLK, state); +} + +static int matroxfb_maven_getsda(void* data) { + return (matroxfb_read_gpio(data) & MAT_DATA) ? 1 : 0; +} + +static int matroxfb_maven_getscl(void* data) { + return (matroxfb_read_gpio(data) & MAT_CLK) ? 1 : 0; +} + +static void matroxfb_ddc1_setsda(void* data, int state) { + matroxfb_i2c_set(data, DDC1_DATA, state); +} + +static void matroxfb_ddc1_setscl(void* data, int state) { + matroxfb_i2c_set(data, DDC1_CLK, state); +} + +static int matroxfb_ddc1_getsda(void* data) { + return (matroxfb_read_gpio(data) & DDC1_DATA) ? 1 : 0; +} + +static int matroxfb_ddc1_getscl(void* data) { + return (matroxfb_read_gpio(data) & DDC1_CLK) ? 1 : 0; +} + +static void matroxfb_ddc1b_setsda(void* data, int state) { + matroxfb_i2c_set(data, DDC1B_DATA, state); +} + +static void matroxfb_ddc1b_setscl(void* data, int state) { + matroxfb_i2c_set(data, DDC1B_CLK, state); +} + +static int matroxfb_ddc1b_getsda(void* data) { + return (matroxfb_read_gpio(data) & DDC1B_DATA) ? 1 : 0; +} + +static int matroxfb_ddc1b_getscl(void* data) { + return (matroxfb_read_gpio(data) & DDC1B_CLK) ? 1 : 0; +} + +static void matroxfb_ddc2_setsda(void* data, int state) { + matroxfb_i2c_set(data, DDC2_DATA, state); +} + +static void matroxfb_ddc2_setscl(void* data, int state) { + matroxfb_i2c_set(data, DDC2_CLK, state); +} + +static int matroxfb_ddc2_getsda(void* data) { + return (matroxfb_read_gpio(data) & DDC2_DATA) ? 1 : 0; +} + +static int matroxfb_ddc2_getscl(void* data) { + return (matroxfb_read_gpio(data) & DDC2_CLK) ? 1 : 0; +} + +static void matroxfb_dh_inc_use(struct i2c_adapter* dummy) { + MOD_INC_USE_COUNT; +} + +static void matroxfb_dh_dec_use(struct i2c_adapter* dummy) { + MOD_DEC_USE_COUNT; +} + +static struct i2c_adapter matroxmaven_i2c_adapter_template = +{ + "", + I2C_HW_B_G400, + + NULL, + NULL, + + matroxfb_dh_inc_use, + matroxfb_dh_dec_use, + NULL, + NULL, + NULL, +}; + +static struct i2c_algo_bit_data matroxmaven_i2c_algo_template = +{ + NULL, + matroxfb_maven_setsda, + matroxfb_maven_setscl, + matroxfb_maven_getsda, + matroxfb_maven_getscl, + 10, 10, 100, +}; + +static struct i2c_adapter matrox_ddc1_adapter_template = +{ + "", + I2C_HW_B_G400, /* DDC */ + + NULL, + NULL, + + matroxfb_dh_inc_use, + matroxfb_dh_dec_use, + NULL, + NULL, + NULL, +}; + +static struct i2c_algo_bit_data matrox_ddc1_algo_template = +{ + NULL, + matroxfb_ddc1_setsda, + matroxfb_ddc1_setscl, + matroxfb_ddc1_getsda, + matroxfb_ddc1_getscl, + 10, 10, 100, +}; + +static struct i2c_algo_bit_data matrox_ddc1b_algo_template = +{ + NULL, + matroxfb_ddc1b_setsda, + matroxfb_ddc1b_setscl, + matroxfb_ddc1b_getsda, + matroxfb_ddc1b_getscl, + 10, 10, 100, +}; + +static struct i2c_adapter matrox_ddc2_adapter_template = +{ + "", + I2C_HW_B_G400, /* DDC */ + + NULL, + NULL, + + matroxfb_dh_inc_use, /* should increment matroxfb_maven usage too, this DDC is coupled with maven_client */ + matroxfb_dh_dec_use, /* should decrement matroxfb_maven usage too */ + NULL, + NULL, + NULL, +}; + +static struct i2c_algo_bit_data matrox_ddc2_algo_template = +{ + NULL, + matroxfb_ddc2_setsda, + matroxfb_ddc2_setscl, + matroxfb_ddc2_getsda, + matroxfb_ddc2_getscl, + 10, 10, 100, +}; + +static int i2c_bus_reg(struct i2c_bit_adapter* b, struct matrox_fb_info* minfo) { + int err; + + b->adapter.data = minfo; + b->adapter.algo_data = &b->bac; + b->bac.data = minfo; + err = i2c_bit_add_bus(&b->adapter); + b->initialized = !err; + return err; +} + +static void i2c_bit_bus_del(struct i2c_bit_adapter* b) { + if (b->initialized) { + i2c_bit_del_bus(&b->adapter); + b->initialized = 0; + } +} + +static inline int i2c_maven_init(struct matroxfb_dh_maven_info* minfo2) { + struct i2c_bit_adapter *b = &minfo2->maven; + + b->adapter = matroxmaven_i2c_adapter_template; + b->bac = matroxmaven_i2c_algo_template; + sprintf(b->adapter.name, "MAVEN:fb%u on i2c-matroxfb", GET_FB_IDX(minfo2->primary_dev->fbcon.node)); + return i2c_bus_reg(b, minfo2->primary_dev); +} + +static inline void i2c_maven_done(struct matroxfb_dh_maven_info* minfo2) { + i2c_bit_bus_del(&minfo2->maven); +} + +static inline int i2c_ddc1_init(struct matroxfb_dh_maven_info* minfo2) { + struct i2c_bit_adapter *b = &minfo2->ddc1; + + b->adapter = matrox_ddc1_adapter_template; + b->bac = matrox_ddc1_algo_template; + sprintf(b->adapter.name, "DDC:fb%u #0 on i2c-matroxfb", GET_FB_IDX(minfo2->primary_dev->fbcon.node)); + return i2c_bus_reg(b, minfo2->primary_dev); +} + +static inline int i2c_ddc1b_init(struct matroxfb_dh_maven_info* minfo2) { + struct i2c_bit_adapter *b = &minfo2->ddc1; + + b->adapter = matrox_ddc1_adapter_template; + b->bac = matrox_ddc1b_algo_template; + sprintf(b->adapter.name, "DDC:fb%u #0 on i2c-matroxfb", GET_FB_IDX(minfo2->primary_dev->fbcon.node)); + return i2c_bus_reg(b, minfo2->primary_dev); +} + +static inline void i2c_ddc1_done(struct matroxfb_dh_maven_info* minfo2) { + i2c_bit_bus_del(&minfo2->ddc1); +} + +static inline int i2c_ddc2_init(struct matroxfb_dh_maven_info* minfo2) { + struct i2c_bit_adapter *b = &minfo2->ddc2; + + b->adapter = matrox_ddc2_adapter_template; + b->bac = matrox_ddc2_algo_template; + sprintf(b->adapter.name, "DDC:fb%u #1 on i2c-matroxfb", GET_FB_IDX(minfo2->primary_dev->fbcon.node)); + return i2c_bus_reg(b, minfo2->primary_dev); +} + +static inline void i2c_ddc2_done(struct matroxfb_dh_maven_info* minfo2) { + i2c_bit_bus_del(&minfo2->ddc2); +} + +static void* i2c_matroxfb_probe(struct matrox_fb_info* minfo) { + int err; + unsigned long flags; + struct matroxfb_dh_maven_info* m2info; + + m2info = (struct matroxfb_dh_maven_info*)kmalloc(sizeof(*m2info), GFP_KERNEL); + if (!m2info) + return NULL; + + matroxfb_DAC_lock_irqsave(flags); + matroxfb_DAC_out(PMINFO DAC_XGENIODATA, 0x00); + matroxfb_DAC_out(PMINFO DAC_XGENIOCTRL, 0xFF); + matroxfb_DAC_unlock_irqrestore(flags); + + memset(m2info, 0, sizeof(*m2info)); + m2info->maven.minfo = m2info; + m2info->ddc1.minfo = m2info; + m2info->ddc2.minfo = m2info; + m2info->primary_dev = minfo; + + if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGA2064W || + ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGA2164W || + ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGA2164W_AGP) + err = i2c_ddc1b_init(m2info); + else + err = i2c_ddc1_init(m2info); + if (err) + goto fail_ddc1; + if (ACCESS_FBINFO(devflags.maven_capable)) { + err = i2c_ddc2_init(m2info); + if (err) + printk(KERN_INFO "i2c-matroxfb: Could not register secondary output i2c bus. Continuing anyway.\n"); + err = i2c_maven_init(m2info); + if (err) + printk(KERN_INFO "i2c-matroxfb: Could not register Maven i2c bus. Continuing anyway.\n"); + } + return m2info; +fail_ddc1:; + kfree(m2info); + printk(KERN_ERR "i2c-matroxfb: Could not register primary adapter DDC bus.\n"); + return NULL; +} + +static void i2c_matroxfb_remove(struct matrox_fb_info* minfo, void* data) { + struct matroxfb_dh_maven_info* m2info = data; + + i2c_maven_done(m2info); + i2c_ddc2_done(m2info); + i2c_ddc1_done(m2info); + kfree(m2info); +} + +static struct matroxfb_driver i2c_matroxfb = { + LIST_HEAD_INIT(i2c_matroxfb.node), + "i2c-matroxfb", + i2c_matroxfb_probe, + i2c_matroxfb_remove, +}; + +int __init i2c_matroxfb_init(void) { + if (matroxfb_register_driver(&i2c_matroxfb)) { + printk(KERN_ERR "i2c-matroxfb: failed to register driver\n"); + return -ENXIO; + } + return 0; +} + +static void __exit i2c_matroxfb_exit(void) { + matroxfb_unregister_driver(&i2c_matroxfb); +} + +MODULE_AUTHOR("(c) 1999 Petr Vandrovec "); +MODULE_DESCRIPTION("Support module providing I2C buses present on Matrox videocards"); + +module_init(i2c_matroxfb_init); +module_exit(i2c_matroxfb_exit); +/* no __setup required */ diff -uNr linux-2.2.16.SuSE/drivers/video/matrox/matroxfb_DAC1064.c linux.compile/drivers/video/matrox/matroxfb_DAC1064.c --- linux-2.2.16.SuSE/drivers/video/matrox/matroxfb_DAC1064.c Thu Jan 1 01:00:00 1970 +++ linux.compile/drivers/video/matrox/matroxfb_DAC1064.c Wed Jul 19 01:22:10 2000 @@ -0,0 +1,921 @@ +/* + * + * Hardware accelerated Matrox Millennium I, II, Mystique, G100, G200 and G400 + * + * (c) 1998,1999,2000 Petr Vandrovec + * + * Version: 1.21 1999/01/09 + * + * MTRR stuff: 1998 Tom Rini + * + * Contributors: "menion?" + * Betatesting, fixes, ideas + * + * "Kurt Garloff" + * Betatesting, fixes, ideas, videomodes, videomode timings + * + * "Tom Rini" + * MTRR stuff, PPC cleanups, betatesting, fixes, ideas + * + * "Bibek Sahu" + * Access device through readb|w|l and write b|w|l + * Extensive debugging stuff + * + * "Daniel Haun" + * Testing, hardware cursor fixes + * + * "Scott Wood" + * Fixes + * + * "Gerd Knorr" + * Betatesting + * + * "Kelly French" + * "Fernando Herrera" + * Betatesting, bug reporting + * + * "Pablo Bianucci" + * Fixes, ideas, betatesting + * + * "Inaky Perez Gonzalez" + * Fixes, enhandcements, ideas, betatesting + * + * "Ryuichi Oikawa" + * PPC betatesting, PPC support, backward compatibility + * + * "Paul Womar" + * "Owen Waller" + * PPC betatesting + * + * "Thomas Pornin" + * Alpha betatesting + * + * "Pieter van Leuven" + * "Ulf Jaenicke-Roessler" + * G100 testing + * + * "H. Peter Arvin" + * Ideas + * + * "Cort Dougan" + * CHRP fixes and PReP cleanup + * + * "Mark Vojkovich" + * G400 support + * + * (following author is not in any relation with this code, but his code + * is included in this driver) + * + * Based on framebuffer driver for VBE 2.0 compliant graphic boards + * (c) 1998 Gerd Knorr + * + * (following author is not in any relation with this code, but his ideas + * were used when writting this driver) + * + * FreeVBE/AF (Matrox), "Shawn Hargreaves" + * + */ + +/* make checkconfig does not walk through include tree :-( */ +#include + +#include "matroxfb_DAC1064.h" +#include "matroxfb_misc.h" +#include "matroxfb_accel.h" +#include + +#ifdef NEED_DAC1064 +#define outDAC1064 matroxfb_DAC_out +#define inDAC1064 matroxfb_DAC_in + +#define DAC1064_OPT_SCLK_PCI 0x00 +#define DAC1064_OPT_SCLK_PLL 0x01 +#define DAC1064_OPT_SCLK_EXT 0x02 +#define DAC1064_OPT_SCLK_MASK 0x03 +#define DAC1064_OPT_GDIV1 0x04 /* maybe it is GDIV2 on G100 ?! */ +#define DAC1064_OPT_GDIV3 0x00 +#define DAC1064_OPT_MDIV1 0x08 +#define DAC1064_OPT_MDIV2 0x00 +#define DAC1064_OPT_RESERVED 0x10 + +static void matroxfb_DAC1064_flashcursor(unsigned long ptr) { +#define minfo ((struct matrox_fb_info*)ptr) + matroxfb_DAC_lock(); + outDAC1064(PMINFO M1064_XCURCTRL, inDAC1064(PMINFO M1064_XCURCTRL) ^ M1064_XCURCTRL_DIS ^ M1064_XCURCTRL_XGA); + ACCESS_FBINFO(cursor.timer.expires) = jiffies + HZ/2; + add_timer(&ACCESS_FBINFO(cursor.timer)); + matroxfb_DAC_unlock(); +#undef minfo +} + +static void matroxfb_DAC1064_createcursor(WPMINFO struct display* p) { + vaddr_t cursorbase; + u_int32_t xline; + unsigned int i; + unsigned int h, to; + CRITFLAGS + + if (ACCESS_FBINFO(currcon_display) != p) + return; + + matroxfb_createcursorshape(PMINFO p, p->var.vmode); + + xline = (~0) << (32 - ACCESS_FBINFO(cursor.w)); + cursorbase = ACCESS_FBINFO(video.vbase); + h = ACCESS_FBINFO(features.DAC1064.cursorimage); + + CRITBEGIN + +#ifdef __BIG_ENDIAN + WaitTillIdle(); + mga_outl(M_OPMODE, M_OPMODE_32BPP); +#endif + to = ACCESS_FBINFO(cursor.u); + for (i = 0; i < to; i++) { + mga_writel(cursorbase, h, 0); + mga_writel(cursorbase, h+4, 0); + mga_writel(cursorbase, h+8, ~0); + mga_writel(cursorbase, h+12, ~0); + h += 16; + } + to = ACCESS_FBINFO(cursor.d); + for (; i < to; i++) { + mga_writel(cursorbase, h, 0); + mga_writel(cursorbase, h+4, xline); + mga_writel(cursorbase, h+8, ~0); + mga_writel(cursorbase, h+12, ~0); + h += 16; + } + for (; i < 64; i++) { + mga_writel(cursorbase, h, 0); + mga_writel(cursorbase, h+4, 0); + mga_writel(cursorbase, h+8, ~0); + mga_writel(cursorbase, h+12, ~0); + h += 16; + } +#ifdef __BIG_ENDIAN + mga_outl(M_OPMODE, ACCESS_FBINFO(accel.m_opmode)); +#endif + + CRITEND +} + +static void matroxfb_DAC1064_cursor(struct display* p, int mode, int x, int y) { + unsigned long flags; + MINFO_FROM_DISP(p); + + if (ACCESS_FBINFO(currcon_display) != p) + return; + + if (mode == CM_ERASE) { + if (ACCESS_FBINFO(cursor.state) != CM_ERASE) { + del_timer_sync(&ACCESS_FBINFO(cursor.timer)); + matroxfb_DAC_lock_irqsave(flags); + ACCESS_FBINFO(cursor.state) = CM_ERASE; + outDAC1064(PMINFO M1064_XCURCTRL, M1064_XCURCTRL_DIS); + matroxfb_DAC_unlock_irqrestore(flags); + } + return; + } + if ((p->conp->vc_cursor_type & CUR_HWMASK) != ACCESS_FBINFO(cursor.type)) + matroxfb_DAC1064_createcursor(PMINFO p); + x *= fontwidth(p); + y *= fontheight(p); + y -= p->var.yoffset; + if (p->var.vmode & FB_VMODE_DOUBLE) + y *= 2; + del_timer_sync(&ACCESS_FBINFO(cursor.timer)); + matroxfb_DAC_lock_irqsave(flags); + if ((x != ACCESS_FBINFO(cursor.x)) || (y != ACCESS_FBINFO(cursor.y)) || ACCESS_FBINFO(cursor.redraw)) { + ACCESS_FBINFO(cursor.redraw) = 0; + ACCESS_FBINFO(cursor.x) = x; + ACCESS_FBINFO(cursor.y) = y; + x += 64; + y += 64; + outDAC1064(PMINFO M1064_XCURCTRL, M1064_XCURCTRL_DIS); + mga_outb(M_RAMDAC_BASE+M1064_CURPOSXL, x); + mga_outb(M_RAMDAC_BASE+M1064_CURPOSXH, x >> 8); + mga_outb(M_RAMDAC_BASE+M1064_CURPOSYL, y); + mga_outb(M_RAMDAC_BASE+M1064_CURPOSYH, y >> 8); + } + ACCESS_FBINFO(cursor.state) = CM_DRAW; + if (ACCESS_FBINFO(devflags.blink)) + mod_timer(&ACCESS_FBINFO(cursor.timer), jiffies + HZ/2); + outDAC1064(PMINFO M1064_XCURCTRL, M1064_XCURCTRL_XGA); + matroxfb_DAC_unlock_irqrestore(flags); +} + +static int matroxfb_DAC1064_setfont(struct display* p, int width, int height) { + if (p && p->conp) + matroxfb_DAC1064_createcursor(PMXINFO(p) p); + return 0; +} + +static int DAC1064_selhwcursor(WPMINFO struct display* p) { + ACCESS_FBINFO(dispsw.cursor) = matroxfb_DAC1064_cursor; + ACCESS_FBINFO(dispsw.set_font) = matroxfb_DAC1064_setfont; + return 0; +} + +static void DAC1064_calcclock(CPMINFO unsigned int freq, unsigned int fmax, unsigned int* in, unsigned int* feed, unsigned int* post) { + unsigned int fvco; + unsigned int p; + + DBG("DAC1064_calcclock") + + fvco = PLL_calcclock(PMINFO freq, fmax, in, feed, &p); + p = (1 << p) - 1; + if (fvco <= 100000) + ; + else if (fvco <= 140000) + p |= 0x08; + else if (fvco <= 180000) + p |= 0x10; + else + p |= 0x18; + *post = p; +} + +/* they must be in POS order */ +static const unsigned char MGA1064_DAC_regs[] = { + M1064_XCURADDL, M1064_XCURADDH, M1064_XCURCTRL, + M1064_XCURCOL0RED, M1064_XCURCOL0GREEN, M1064_XCURCOL0BLUE, + M1064_XCURCOL1RED, M1064_XCURCOL1GREEN, M1064_XCURCOL1BLUE, + M1064_XCURCOL2RED, M1064_XCURCOL2GREEN, M1064_XCURCOL2BLUE, + DAC1064_XVREFCTRL, M1064_XMULCTRL, M1064_XPIXCLKCTRL, M1064_XGENCTRL, + M1064_XMISCCTRL, + M1064_XGENIOCTRL, M1064_XGENIODATA, M1064_XZOOMCTRL, M1064_XSENSETEST, + M1064_XCRCBITSEL, + M1064_XCOLKEYMASKL, M1064_XCOLKEYMASKH, M1064_XCOLKEYL, M1064_XCOLKEYH }; + +static const unsigned char MGA1064_DAC[] = { + 0x00, 0x00, M1064_XCURCTRL_DIS, + 0x00, 0x00, 0x00, /* black */ + 0xFF, 0xFF, 0xFF, /* white */ + 0xFF, 0x00, 0x00, /* red */ + 0x00, 0, + M1064_XPIXCLKCTRL_PLL_UP | M1064_XPIXCLKCTRL_EN | M1064_XPIXCLKCTRL_SRC_PLL, + M1064_XGENCTRL_VS_0 | M1064_XGENCTRL_ALPHA_DIS | M1064_XGENCTRL_BLACK_0IRE | M1064_XGENCTRL_NO_SYNC_ON_GREEN, + M1064_XMISCCTRL_DAC_8BIT, + 0x00, 0x00, M1064_XZOOMCTRL_1, M1064_XSENSETEST_BCOMP | M1064_XSENSETEST_GCOMP | M1064_XSENSETEST_RCOMP | M1064_XSENSETEST_PDOWN, + 0x00, + 0x00, 0x00, 0xFF, 0xFF}; + +static void DAC1064_setpclk(CPMINFO struct matrox_hw_state* hw, unsigned long fout) { + unsigned int m, n, p; + + DBG("DAC1064_setpclk") + + DAC1064_calcclock(PMINFO fout, ACCESS_FBINFO(max_pixel_clock), &m, &n, &p); + hw->DACclk[0] = m; + hw->DACclk[1] = n; + hw->DACclk[2] = p; +} + +static void DAC1064_setmclk(CPMINFO struct matrox_hw_state* hw, int oscinfo, unsigned long fmem){ + u_int32_t mx; + + DBG("DAC1064_setmclk") + + if (ACCESS_FBINFO(devflags.noinit)) { + /* read MCLK and give up... */ + hw->DACclk[3] = inDAC1064(PMINFO DAC1064_XSYSPLLM); + hw->DACclk[4] = inDAC1064(PMINFO DAC1064_XSYSPLLN); + hw->DACclk[5] = inDAC1064(PMINFO DAC1064_XSYSPLLP); + return; + } + mx = hw->MXoptionReg | 0x00000004; + pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, mx); + mx &= ~0x000000BB; + if (oscinfo & DAC1064_OPT_GDIV1) + mx |= 0x00000008; + if (oscinfo & DAC1064_OPT_MDIV1) + mx |= 0x00000010; + if (oscinfo & DAC1064_OPT_RESERVED) + mx |= 0x00000080; + if ((oscinfo & DAC1064_OPT_SCLK_MASK) == DAC1064_OPT_SCLK_PLL) { + /* select PCI clock until we have setup oscilator... */ + int clk; + unsigned int m, n, p; + + /* powerup system PLL, select PCI clock */ + mx |= 0x00000020; + pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, mx); + mx &= ~0x00000004; + pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, mx); + + /* !!! you must not access device if MCLK is not running !!! + Doing so cause immediate PCI lockup :-( Maybe they should + generate ABORT or I/O (parity...) error and Linux should + recover from this... (kill driver/process). But world is not + perfect... */ + /* (bit 2 of PCI_OPTION_REG must be 0... and bits 0,1 must not + select PLL... because of PLL can be stopped at this time) */ + DAC1064_calcclock(PMINFO fmem, ACCESS_FBINFO(max_pixel_clock), &m, &n, &p); + outDAC1064(PMINFO DAC1064_XSYSPLLM, hw->DACclk[3] = m); + outDAC1064(PMINFO DAC1064_XSYSPLLN, hw->DACclk[4] = n); + outDAC1064(PMINFO DAC1064_XSYSPLLP, hw->DACclk[5] = p); + for (clk = 65536; clk; --clk) { + if (inDAC1064(PMINFO DAC1064_XSYSPLLSTAT) & 0x40) + break; + } + if (!clk) + printk(KERN_ERR "matroxfb: aiee, SYSPLL not locked\n"); + /* select PLL */ + mx |= 0x00000005; + } else { + /* select specified system clock source */ + mx |= oscinfo & DAC1064_OPT_SCLK_MASK; + } + pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, mx); + mx &= ~0x00000004; + pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, mx); + hw->MXoptionReg = mx; +} + +void DAC1064_global_init(CPMINFO struct matrox_hw_state* hw) { + hw->DACreg[POS1064_XMISCCTRL] &= M1064_XMISCCTRL_DAC_WIDTHMASK; + hw->DACreg[POS1064_XMISCCTRL] |= M1064_XMISCCTRL_LUT_EN; + hw->DACreg[POS1064_XPIXCLKCTRL] = M1064_XPIXCLKCTRL_PLL_UP | M1064_XPIXCLKCTRL_EN | M1064_XPIXCLKCTRL_SRC_PLL; +#if defined(CONFIG_FB_MATROX_MAVEN) || defined(CONFIG_FB_MATROX_MAVEN_MODULE) + if (ACCESS_FBINFO(output.ph) & MATROXFB_OUTPUT_CONN_SECONDARY) { + hw->DACreg[POS1064_XPIXCLKCTRL] = M1064_XPIXCLKCTRL_PLL_UP | M1064_XPIXCLKCTRL_EN | M1064_XPIXCLKCTRL_SRC_EXT; + hw->DACreg[POS1064_XMISCCTRL] |= GX00_XMISCCTRL_MFC_MAFC | G400_XMISCCTRL_VDO_MAFC12; + } else if (ACCESS_FBINFO(output.sh) & MATROXFB_OUTPUT_CONN_SECONDARY) { + hw->DACreg[POS1064_XMISCCTRL] |= GX00_XMISCCTRL_MFC_MAFC | G400_XMISCCTRL_VDO_C2_MAFC12; + } else +#endif + if (ACCESS_FBINFO(output.ph) & MATROXFB_OUTPUT_CONN_DFP) + hw->DACreg[POS1064_XMISCCTRL] |= GX00_XMISCCTRL_MFC_PANELLINK | G400_XMISCCTRL_VDO_MAFC12; + else + hw->DACreg[POS1064_XMISCCTRL] |= GX00_XMISCCTRL_MFC_DIS; + + if ((ACCESS_FBINFO(output.ph) | ACCESS_FBINFO(output.sh)) & MATROXFB_OUTPUT_CONN_PRIMARY) + hw->DACreg[POS1064_XMISCCTRL] |= M1064_XMISCCTRL_DAC_EN; +} + +void DAC1064_global_restore(CPMINFO const struct matrox_hw_state* hw) { + outDAC1064(PMINFO M1064_XPIXCLKCTRL, hw->DACreg[POS1064_XPIXCLKCTRL]); + outDAC1064(PMINFO M1064_XMISCCTRL, hw->DACreg[POS1064_XMISCCTRL]); + if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG400) { + outDAC1064(PMINFO 0x20, 0x04); + outDAC1064(PMINFO 0x1F, 0x00); + } +} + +static int DAC1064_init_1(CPMINFO struct matrox_hw_state* hw, struct my_timming* m, struct display *p) { + DBG("DAC1064_init_1") + + memcpy(hw->DACreg, MGA1064_DAC, sizeof(MGA1064_DAC_regs)); + if (p->type == FB_TYPE_TEXT) { + hw->DACreg[POS1064_XMISCCTRL] = M1064_XMISCCTRL_DAC_6BIT; + hw->DACreg[POS1064_XMULCTRL] = M1064_XMULCTRL_DEPTH_8BPP + | M1064_XMULCTRL_GRAPHICS_PALETIZED; + } else { + switch (p->var.bits_per_pixel) { + /* case 4: not supported by MGA1064 DAC */ + case 8: + hw->DACreg[POS1064_XMULCTRL] = M1064_XMULCTRL_DEPTH_8BPP | M1064_XMULCTRL_GRAPHICS_PALETIZED; + break; + case 16: + if (p->var.green.length == 5) + hw->DACreg[POS1064_XMULCTRL] = M1064_XMULCTRL_DEPTH_15BPP_1BPP | M1064_XMULCTRL_GRAPHICS_PALETIZED; + else + hw->DACreg[POS1064_XMULCTRL] = M1064_XMULCTRL_DEPTH_16BPP | M1064_XMULCTRL_GRAPHICS_PALETIZED; + break; + case 24: + hw->DACreg[POS1064_XMULCTRL] = M1064_XMULCTRL_DEPTH_24BPP | M1064_XMULCTRL_GRAPHICS_PALETIZED; + break; + case 32: + hw->DACreg[POS1064_XMULCTRL] = M1064_XMULCTRL_DEPTH_32BPP | M1064_XMULCTRL_GRAPHICS_PALETIZED; + break; + default: + return 1; /* unsupported depth */ + } + } + + DAC1064_global_init(PMINFO hw); + hw->DACreg[POS1064_XVREFCTRL] = ACCESS_FBINFO(features.DAC1064.xvrefctrl); + hw->DACreg[POS1064_XGENCTRL] &= ~M1064_XGENCTRL_SYNC_ON_GREEN_MASK; + hw->DACreg[POS1064_XGENCTRL] |= (m->sync & FB_SYNC_ON_GREEN)?M1064_XGENCTRL_SYNC_ON_GREEN:M1064_XGENCTRL_NO_SYNC_ON_GREEN; + hw->DACreg[POS1064_XCURADDL] = ACCESS_FBINFO(features.DAC1064.cursorimage) >> 10; + hw->DACreg[POS1064_XCURADDH] = ACCESS_FBINFO(features.DAC1064.cursorimage) >> 18; + return 0; +} + +static int DAC1064_init_2(CPMINFO struct matrox_hw_state* hw, struct my_timming* m, struct display* p) { + + DBG("DAC1064_init_2") + + if (p->var.bits_per_pixel > 16) { /* 256 entries */ + int i; + + for (i = 0; i < 256; i++) { + hw->DACpal[i * 3 + 0] = i; + hw->DACpal[i * 3 + 1] = i; + hw->DACpal[i * 3 + 2] = i; + } + } else if (p->var.bits_per_pixel > 8) { + if (p->var.green.length == 5) { /* 0..31, 128..159 */ + int i; + + for (i = 0; i < 32; i++) { + /* with p15 == 0 */ + hw->DACpal[i * 3 + 0] = i << 3; + hw->DACpal[i * 3 + 1] = i << 3; + hw->DACpal[i * 3 + 2] = i << 3; + /* with p15 == 1 */ + hw->DACpal[(i + 128) * 3 + 0] = i << 3; + hw->DACpal[(i + 128) * 3 + 1] = i << 3; + hw->DACpal[(i + 128) * 3 + 2] = i << 3; + } + } else { + int i; + + for (i = 0; i < 64; i++) { /* 0..63 */ + hw->DACpal[i * 3 + 0] = i << 3; + hw->DACpal[i * 3 + 1] = i << 2; + hw->DACpal[i * 3 + 2] = i << 3; + } + } + } else { + memset(hw->DACpal, 0, 768); + } + return 0; +} + +static void DAC1064_restore_1(WPMINFO const struct matrox_hw_state* hw, const struct matrox_hw_state* oldhw) { + CRITFLAGS + + DBG("DAC1064_restore_1") + + CRITBEGIN + + outDAC1064(PMINFO DAC1064_XSYSPLLM, hw->DACclk[3]); + outDAC1064(PMINFO DAC1064_XSYSPLLN, hw->DACclk[4]); + outDAC1064(PMINFO DAC1064_XSYSPLLP, hw->DACclk[5]); + if (!oldhw || memcmp(hw->DACreg, oldhw->DACreg, sizeof(MGA1064_DAC_regs))) { + unsigned int i; + + for (i = 0; i < sizeof(MGA1064_DAC_regs); i++) { + if ((i != POS1064_XPIXCLKCTRL) && (i != POS1064_XMISCCTRL)) + outDAC1064(PMINFO MGA1064_DAC_regs[i], hw->DACreg[i]); + } + } + + DAC1064_global_restore(PMINFO hw); + + CRITEND +}; + +static void DAC1064_restore_2(WPMINFO const struct matrox_hw_state* hw, const struct matrox_hw_state* oldhw, struct display* p) { +#ifdef DEBUG + unsigned int i; +#endif + + DBG("DAC1064_restore_2") + + matrox_init_putc(PMINFO p, matroxfb_DAC1064_createcursor); +#ifdef DEBUG + dprintk(KERN_DEBUG "DAC1064regs "); + for (i = 0; i < sizeof(MGA1064_DAC_regs); i++) { + dprintk("R%02X=%02X ", MGA1064_DAC_regs[i], hw->DACreg[i]); + if ((i & 0x7) == 0x7) dprintk("\n" KERN_DEBUG "continuing... "); + } + dprintk("\n" KERN_DEBUG "DAC1064clk "); + for (i = 0; i < 6; i++) + dprintk("C%02X=%02X ", i, hw->DACclk[i]); + dprintk("\n"); +#endif +} + +static int m1064_compute(void* outdev, struct my_timming* m, struct matrox_hw_state* hw) { +#define minfo ((struct matrox_fb_info*)outdev) + DAC1064_setpclk(PMINFO hw, m->pixclock); +#undef minfo + return 0; +} + +static int m1064_program(void* outdev, const struct matrox_hw_state* hw) { +#define minfo ((struct matrox_fb_info*)outdev) + int i; + int tmout; + CRITFLAGS + + CRITBEGIN + + for (i = 0; i < 3; i++) + outDAC1064(PMINFO M1064_XPIXPLLCM + i, hw->DACclk[i]); + for (tmout = 500000; tmout; tmout--) { + if (inDAC1064(PMINFO M1064_XPIXPLLSTAT) & 0x40) + break; + udelay(10); + }; + + CRITEND + + if (!tmout) + printk(KERN_ERR "matroxfb: Pixel PLL not locked after 5 secs\n"); + +#undef minfo + return 0; +} + +static int m1064_start(void* outdev) { + /* nothing */ + return 0; +} + +static void m1064_incuse(void* outdev) { + /* nothing yet; MODULE_INC_USE in future... */ +} + +static void m1064_decuse(void* outdev) { + /* nothing yet; MODULE_DEC_USE in future... */ +} + +static int m1064_setmode(void* outdev, u_int32_t mode) { + if (mode != MATROXFB_OUTPUT_MODE_MONITOR) + return -EINVAL; + return 0; +} + +static struct matrox_altout m1064 = { + m1064_compute, + m1064_program, + m1064_start, + m1064_incuse, + m1064_decuse, + m1064_setmode +}; + +#endif /* NEED_DAC1064 */ + +#ifdef CONFIG_FB_MATROX_MYSTIQUE +static int MGA1064_init(CPMINFO struct matrox_hw_state* hw, struct my_timming* m, struct display* p) { + + DBG("MGA1064_init") + + if (DAC1064_init_1(PMINFO hw, m, p)) return 1; + if (matroxfb_vgaHWinit(PMINFO hw, m, p)) return 1; + + hw->MiscOutReg = 0xCB; + if (m->sync & FB_SYNC_HOR_HIGH_ACT) + hw->MiscOutReg &= ~0x40; + if (m->sync & FB_SYNC_VERT_HIGH_ACT) + hw->MiscOutReg &= ~0x80; + if (m->sync & FB_SYNC_COMP_HIGH_ACT) /* should be only FB_SYNC_COMP */ + hw->CRTCEXT[3] |= 0x40; + + if (DAC1064_init_2(PMINFO hw, m, p)) return 1; + return 0; +} +#endif + +#ifdef CONFIG_FB_MATROX_G100 +static int MGAG100_init(CPMINFO struct matrox_hw_state* hw, struct my_timming* m, struct display* p) { + + DBG("MGAG100_init") + + if (DAC1064_init_1(PMINFO hw, m, p)) return 1; + hw->MXoptionReg &= ~0x2000; + if (matroxfb_vgaHWinit(PMINFO hw, m, p)) return 1; + + hw->MiscOutReg = 0xEF; + if (m->sync & FB_SYNC_HOR_HIGH_ACT) + hw->MiscOutReg &= ~0x40; + if (m->sync & FB_SYNC_VERT_HIGH_ACT) + hw->MiscOutReg &= ~0x80; + if (m->sync & FB_SYNC_COMP_HIGH_ACT) /* should be only FB_SYNC_COMP */ + hw->CRTCEXT[3] |= 0x40; + + if (DAC1064_init_2(PMINFO hw, m, p)) return 1; + return 0; +} +#endif /* G100 */ + +#ifdef CONFIG_FB_MATROX_MYSTIQUE +static void MGA1064_ramdac_init(WPMINFO struct matrox_hw_state* hw){ + + DBG("MGA1064_ramdac_init"); + + /* ACCESS_FBINFO(features.DAC1064.vco_freq_min) = 120000; */ + ACCESS_FBINFO(features.pll.vco_freq_min) = 62000; + ACCESS_FBINFO(features.pll.ref_freq) = 14318; + ACCESS_FBINFO(features.pll.feed_div_min) = 100; + ACCESS_FBINFO(features.pll.feed_div_max) = 127; + ACCESS_FBINFO(features.pll.in_div_min) = 1; + ACCESS_FBINFO(features.pll.in_div_max) = 31; + ACCESS_FBINFO(features.pll.post_shift_max) = 3; + ACCESS_FBINFO(features.DAC1064.xvrefctrl) = DAC1064_XVREFCTRL_EXTERNAL; + /* maybe cmdline MCLK= ?, doc says gclk=44MHz, mclk=66MHz... it was 55/83 with old values */ + DAC1064_setmclk(PMINFO hw, DAC1064_OPT_MDIV2 | DAC1064_OPT_GDIV3 | DAC1064_OPT_SCLK_PLL, 133333); +} +#endif + +#ifdef CONFIG_FB_MATROX_G100 +/* BIOS environ */ +static int x7AF4 = 0x10; /* flags, maybe 0x10 = SDRAM, 0x00 = SGRAM??? */ + /* G100 wants 0x10, G200 SGRAM does not care... */ +#if 0 +static int def50 = 0; /* reg50, & 0x0F, & 0x3000 (only 0x0000, 0x1000, 0x2000 (0x3000 disallowed and treated as 0) */ +#endif + +static void MGAG100_progPixClock(CPMINFO int flags, int m, int n, int p){ + int reg; + int selClk; + int clk; + + DBG("MGAG100_progPixClock") + + outDAC1064(PMINFO M1064_XPIXCLKCTRL, inDAC1064(PMINFO M1064_XPIXCLKCTRL) | M1064_XPIXCLKCTRL_DIS | + M1064_XPIXCLKCTRL_PLL_UP); + switch (flags & 3) { + case 0: reg = M1064_XPIXPLLAM; break; + case 1: reg = M1064_XPIXPLLBM; break; + default: reg = M1064_XPIXPLLCM; break; + } + outDAC1064(PMINFO reg++, m); + outDAC1064(PMINFO reg++, n); + outDAC1064(PMINFO reg, p); + selClk = mga_inb(M_MISC_REG_READ) & ~0xC; + /* there should be flags & 0x03 & case 0/1/else */ + /* and we should first select source and after that we should wait for PLL */ + /* and we are waiting for PLL with oscilator disabled... Is it right? */ + switch (flags & 0x03) { + case 0x00: break; + case 0x01: selClk |= 4; break; + default: selClk |= 0x0C; break; + } + mga_outb(M_MISC_REG, selClk); + for (clk = 500000; clk; clk--) { + if (inDAC1064(PMINFO M1064_XPIXPLLSTAT) & 0x40) + break; + udelay(10); + }; + if (!clk) + printk(KERN_ERR "matroxfb: Pixel PLL%c not locked after usual time\n", (reg-M1064_XPIXPLLAM-2)/4 + 'A'); + selClk = inDAC1064(PMINFO M1064_XPIXCLKCTRL) & ~M1064_XPIXCLKCTRL_SRC_MASK; + switch (flags & 0x0C) { + case 0x00: selClk |= M1064_XPIXCLKCTRL_SRC_PCI; break; + case 0x04: selClk |= M1064_XPIXCLKCTRL_SRC_PLL; break; + default: selClk |= M1064_XPIXCLKCTRL_SRC_EXT; break; + } + outDAC1064(PMINFO M1064_XPIXCLKCTRL, selClk); + outDAC1064(PMINFO M1064_XPIXCLKCTRL, inDAC1064(PMINFO M1064_XPIXCLKCTRL) & ~M1064_XPIXCLKCTRL_DIS); +} + +static void MGAG100_setPixClock(CPMINFO int flags, int freq){ + unsigned int m, n, p; + + DBG("MGAG100_setPixClock") + + DAC1064_calcclock(PMINFO freq, ACCESS_FBINFO(max_pixel_clock), &m, &n, &p); + MGAG100_progPixClock(PMINFO flags, m, n, p); +} +#endif + +#ifdef CONFIG_FB_MATROX_MYSTIQUE +static int MGA1064_preinit(WPMINFO struct matrox_hw_state* hw){ + static const int vxres_mystique[] = { 512, 640, 768, 800, 832, 960, + 1024, 1152, 1280, 1600, 1664, 1920, + 2048, 0}; + DBG("MGA1064_preinit") + + /* ACCESS_FBINFO(capable.cfb4) = 0; ... preinitialized by 0 */ + ACCESS_FBINFO(capable.text) = 1; + ACCESS_FBINFO(capable.vxres) = vxres_mystique; + ACCESS_FBINFO(features.accel.has_cacheflush) = 1; + ACCESS_FBINFO(cursor.timer.function) = matroxfb_DAC1064_flashcursor; + + ACCESS_FBINFO(primout) = &m1064; + + if (ACCESS_FBINFO(devflags.noinit)) + return 0; /* do not modify settings */ + hw->MXoptionReg &= 0xC0000100; + hw->MXoptionReg |= 0x00094E20; + if (ACCESS_FBINFO(devflags.novga)) + hw->MXoptionReg &= ~0x00000100; + if (ACCESS_FBINFO(devflags.nobios)) + hw->MXoptionReg &= ~0x40000000; + if (ACCESS_FBINFO(devflags.nopciretry)) + hw->MXoptionReg |= 0x20000000; + pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg); + mga_setr(M_SEQ_INDEX, 0x01, 0x20); + mga_outl(M_CTLWTST, 0x00000000); + udelay(200); + mga_outl(M_MACCESS, 0x00008000); + udelay(100); + mga_outl(M_MACCESS, 0x0000C000); + return 0; +} + +static void MGA1064_reset(WPMINFO struct matrox_hw_state* hw){ + + DBG("MGA1064_reset"); + + ACCESS_FBINFO(features.DAC1064.cursorimage) = ACCESS_FBINFO(video.len_usable) - 1024; + if (ACCESS_FBINFO(devflags.hwcursor)) + ACCESS_FBINFO(video.len_usable) -= 1024; + matroxfb_fastfont_init(MINFO); + MGA1064_ramdac_init(PMINFO hw); +} +#endif + +#ifdef CONFIG_FB_MATROX_G100 +static int MGAG100_preinit(WPMINFO struct matrox_hw_state* hw){ + static const int vxres_g100[] = { 512, 640, 768, 800, 832, 960, + 1024, 1152, 1280, 1600, 1664, 1920, + 2048, 0}; + u_int32_t reg50; +#if 0 + u_int32_t q; +#endif + + DBG("MGAG100_preinit") + + /* there are some instabilities if in_div > 19 && vco < 61000 */ + ACCESS_FBINFO(features.pll.vco_freq_min) = 62000; + ACCESS_FBINFO(features.pll.ref_freq) = 27000; + ACCESS_FBINFO(features.pll.feed_div_min) = 7; + ACCESS_FBINFO(features.pll.feed_div_max) = 127; + ACCESS_FBINFO(features.pll.in_div_min) = 1; + ACCESS_FBINFO(features.pll.in_div_max) = 31; + ACCESS_FBINFO(features.pll.post_shift_max) = 3; + ACCESS_FBINFO(features.DAC1064.xvrefctrl) = DAC1064_XVREFCTRL_G100_DEFAULT; + /* ACCESS_FBINFO(capable.cfb4) = 0; ... preinitialized by 0 */ + ACCESS_FBINFO(capable.text) = 1; + ACCESS_FBINFO(capable.vxres) = vxres_g100; + ACCESS_FBINFO(features.accel.has_cacheflush) = 1; + ACCESS_FBINFO(cursor.timer.function) = matroxfb_DAC1064_flashcursor; + ACCESS_FBINFO(capable.plnwt) = ACCESS_FBINFO(devflags.accelerator) != FB_ACCEL_MATROX_MGAG100; + + ACCESS_FBINFO(primout) = &m1064; + + if (ACCESS_FBINFO(devflags.noinit)) + return 0; + hw->MXoptionReg &= 0xC0000100; + hw->MXoptionReg |= 0x00078020; + if (ACCESS_FBINFO(devflags.novga)) + hw->MXoptionReg &= ~0x00000100; + if (ACCESS_FBINFO(devflags.nobios)) + hw->MXoptionReg &= ~0x40000000; + if (ACCESS_FBINFO(devflags.nopciretry)) + hw->MXoptionReg |= 0x20000000; + pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg); + pci_read_config_dword(ACCESS_FBINFO(pcidev), 0x50, ®50); + reg50 &= ~0x3000; + pci_write_config_dword(ACCESS_FBINFO(pcidev), 0x50, reg50); + + DAC1064_setmclk(PMINFO hw, DAC1064_OPT_MDIV2 | DAC1064_OPT_GDIV3 | DAC1064_OPT_SCLK_PCI, 133333); + + if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG100) { + hw->MXoptionReg |= 0x1080; + pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg); + mga_outl(M_CTLWTST, 0x00000300); + /* mga_outl(M_CTLWTST, 0x03258A31); */ + udelay(100); + mga_outb(0x1C05, 0x00); + mga_outb(0x1C05, 0x80); + udelay(100); + mga_outb(0x1C05, 0x40); + mga_outb(0x1C05, 0xC0); + udelay(100); + reg50 &= ~0xFF; + reg50 |= 0x07; + pci_write_config_dword(ACCESS_FBINFO(pcidev), 0x50, reg50); + /* it should help with G100 */ + mga_outb(M_GRAPHICS_INDEX, 6); + mga_outb(M_GRAPHICS_DATA, (mga_inb(M_GRAPHICS_DATA) & 3) | 4); + mga_setr(M_EXTVGA_INDEX, 0x03, 0x81); + mga_setr(M_EXTVGA_INDEX, 0x04, 0x00); + mga_writeb(ACCESS_FBINFO(video.vbase), 0x0000, 0xAA); + mga_writeb(ACCESS_FBINFO(video.vbase), 0x0800, 0x55); + mga_writeb(ACCESS_FBINFO(video.vbase), 0x4000, 0x55); +#if 0 + if (mga_readb(ACCESS_FBINFO(video.vbase), 0x0000) != 0xAA) { + hw->MXoptionReg &= ~0x1000; + } +#endif + } else { + hw->MXoptionReg |= 0x00000C00; + if (ACCESS_FBINFO(devflags.sgram)) + hw->MXoptionReg |= 0x4000; + mga_outl(M_CTLWTST, 0x042450A1); + mga_outb(0x1E47, 0x00); + mga_outb(0x1E46, 0x00); + udelay(10); + mga_outb(0x1C05, 0x00); + mga_outb(0x1C05, 0x80); + udelay(100); + mga_outw(0x1E44, 0x0108); + } + hw->MXoptionReg = (hw->MXoptionReg & ~0x1F8000) | 0x78000; + pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg); + return 0; +} + +static void MGAG100_reset(WPMINFO struct matrox_hw_state* hw){ + u_int8_t b; + + DBG("MGAG100_reset") + + ACCESS_FBINFO(features.DAC1064.cursorimage) = ACCESS_FBINFO(video.len_usable) - 1024; + if (ACCESS_FBINFO(devflags.hwcursor)) + ACCESS_FBINFO(video.len_usable) -= 1024; + matroxfb_fastfont_init(MINFO); + + { +#ifdef G100_BROKEN_IBM_82351 + u_int32_t d; + + find 1014/22 (IBM/82351); /* if found and bridging Matrox, do some strange stuff */ + pci_read_config_byte(ibm, PCI_SECONDARY_BUS, &b); + if (b == ACCESS_FBINFO(pcidev)->bus->number) { + pci_write_config_byte(ibm, PCI_COMMAND+1, 0); /* disable back-to-back & SERR */ + pci_write_config_byte(ibm, 0x41, 0xF4); /* ??? */ + pci_write_config_byte(ibm, PCI_IO_BASE, 0xF0); /* ??? */ + pci_write_config_byte(ibm, PCI_IO_LIMIT, 0x00); /* ??? */ + } +#endif + if (!ACCESS_FBINFO(devflags.noinit)) { + if (x7AF4 & 8) { + hw->MXoptionReg |= 0x40; + pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg); + } + mga_setr(M_EXTVGA_INDEX, 0x06, 0x50); + } + } + DAC1064_setmclk(PMINFO hw, DAC1064_OPT_RESERVED | DAC1064_OPT_MDIV2 | DAC1064_OPT_GDIV1 | DAC1064_OPT_SCLK_PLL, 133333); + if (ACCESS_FBINFO(devflags.noinit)) + return; + MGAG100_setPixClock(PMINFO 4, 25175); + MGAG100_setPixClock(PMINFO 5, 28322); + if (x7AF4 & 0x10) { + b = inDAC1064(PMINFO M1064_XGENIODATA) & ~1; + outDAC1064(PMINFO M1064_XGENIODATA, b); + b = inDAC1064(PMINFO M1064_XGENIOCTRL) | 1; + outDAC1064(PMINFO M1064_XGENIOCTRL, b); + } +} +#endif + +#ifdef CONFIG_FB_MATROX_MYSTIQUE +static void MGA1064_restore(WPMINFO struct matrox_hw_state* hw, struct matrox_hw_state* oldhw, struct display* p) { + int i; + CRITFLAGS + + DBG("MGA1064_restore") + + CRITBEGIN + + pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg); + mga_outb(M_IEN, 0x00); + mga_outb(M_CACHEFLUSH, 0x00); + + CRITEND + + DAC1064_restore_1(PMINFO hw, oldhw); + matroxfb_vgaHWrestore(PMINFO hw, oldhw); + for (i = 0; i < 6; i++) + mga_setr(M_EXTVGA_INDEX, i, hw->CRTCEXT[i]); + DAC1064_restore_2(PMINFO hw, oldhw, p); +} +#endif + +#ifdef CONFIG_FB_MATROX_G100 +static void MGAG100_restore(WPMINFO struct matrox_hw_state* hw, struct matrox_hw_state* oldhw, struct display* p) { + int i; + CRITFLAGS + + DBG("MGAG100_restore") + + CRITBEGIN + + pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg); + CRITEND + + DAC1064_restore_1(PMINFO hw, oldhw); + matroxfb_vgaHWrestore(PMINFO hw, oldhw); +#ifdef CONFIG_FB_MATROX_32MB + if (ACCESS_FBINFO(devflags.support32MB)) + mga_setr(M_EXTVGA_INDEX, 8, hw->CRTCEXT[8]); +#endif + for (i = 0; i < 6; i++) + mga_setr(M_EXTVGA_INDEX, i, hw->CRTCEXT[i]); + DAC1064_restore_2(PMINFO hw, oldhw, p); +} +#endif + +#ifdef CONFIG_FB_MATROX_MYSTIQUE +struct matrox_switch matrox_mystique = { + MGA1064_preinit, MGA1064_reset, MGA1064_init, MGA1064_restore, DAC1064_selhwcursor +}; +#endif + +#ifdef CONFIG_FB_MATROX_G100 +struct matrox_switch matrox_G100 = { + MGAG100_preinit, MGAG100_reset, MGAG100_init, MGAG100_restore, DAC1064_selhwcursor +}; +#endif + diff -uNr linux-2.2.16.SuSE/drivers/video/matrox/matroxfb_DAC1064.h linux.compile/drivers/video/matrox/matroxfb_DAC1064.h --- linux-2.2.16.SuSE/drivers/video/matrox/matroxfb_DAC1064.h Thu Jan 1 01:00:00 1970 +++ linux.compile/drivers/video/matrox/matroxfb_DAC1064.h Wed Jul 19 02:15:07 2000 @@ -0,0 +1,147 @@ +#ifndef __MATROXFB_DAC1064_H__ +#define __MATROXFB_DAC1064_H__ + +/* make checkconfig does not walk through include tree */ +#include + +#include "matroxfb_base.h" + +#ifdef CONFIG_FB_MATROX_MYSTIQUE +extern struct matrox_switch matrox_mystique; +#endif +#ifdef CONFIG_FB_MATROX_G100 +extern struct matrox_switch matrox_G100; +#endif +#ifdef NEED_DAC1064 +void DAC1064_global_init(CPMINFO struct matrox_hw_state*); +void DAC1064_global_restore(CPMINFO const struct matrox_hw_state*); +#endif + +#define M1064_INDEX 0x00 +#define M1064_PALWRADD 0x00 +#define M1064_PALDATA 0x01 +#define M1064_PIXRDMSK 0x02 +#define M1064_PALRDADD 0x03 +#define M1064_X_DATAREG 0x0A +#define M1064_CURPOSXL 0x0C /* can be accessed as DWORD */ +#define M1064_CURPOSXH 0x0D +#define M1064_CURPOSYL 0x0E +#define M1064_CURPOSYH 0x0F + +#define M1064_XCURADDL 0x04 +#define M1064_XCURADDH 0x05 +#define M1064_XCURCTRL 0x06 +#define M1064_XCURCTRL_DIS 0x00 /* transparent, transparent, transparent, transparent */ +#define M1064_XCURCTRL_3COLOR 0x01 /* transparent, 0, 1, 2 */ +#define M1064_XCURCTRL_XGA 0x02 /* 0, 1, transparent, complement */ +#define M1064_XCURCTRL_XWIN 0x03 /* transparent, transparent, 0, 1 */ +#define M1064_XCURCOL0RED 0x08 +#define M1064_XCURCOL0GREEN 0x09 +#define M1064_XCURCOL0BLUE 0x0A +#define M1064_XCURCOL1RED 0x0C +#define M1064_XCURCOL1GREEN 0x0D +#define M1064_XCURCOL1BLUE 0x0E +#define M1064_XCURCOL2RED 0x10 +#define M1064_XCURCOL2GREEN 0x11 +#define M1064_XCURCOL2BLUE 0x12 +#define DAC1064_XVREFCTRL 0x18 +#define DAC1064_XVREFCTRL_INTERNAL 0x3F +#define DAC1064_XVREFCTRL_EXTERNAL 0x00 +#define DAC1064_XVREFCTRL_G100_DEFAULT 0x03 +#define M1064_XMULCTRL 0x19 +#define M1064_XMULCTRL_DEPTH_8BPP 0x00 /* 8 bpp paletized */ +#define M1064_XMULCTRL_DEPTH_15BPP_1BPP 0x01 /* 15 bpp paletized + 1 bpp overlay */ +#define M1064_XMULCTRL_DEPTH_16BPP 0x02 /* 16 bpp paletized */ +#define M1064_XMULCTRL_DEPTH_24BPP 0x03 /* 24 bpp paletized */ +#define M1064_XMULCTRL_DEPTH_24BPP_8BPP 0x04 /* 24 bpp direct + 8 bpp overlay paletized */ +#define M1064_XMULCTRL_2G8V16 0x05 /* 15 bpp video direct, half xres, 8bpp paletized */ +#define M1064_XMULCTRL_G16V16 0x06 /* 15 bpp video, 15bpp graphics, one of them paletized */ +#define M1064_XMULCTRL_DEPTH_32BPP 0x07 /* 24 bpp paletized + 8 bpp unused */ +#define M1064_XMULCTRL_GRAPHICS_PALETIZED 0x00 +#define M1064_XMULCTRL_VIDEO_PALETIZED 0x08 +#define M1064_XPIXCLKCTRL 0x1A +#define M1064_XPIXCLKCTRL_SRC_PCI 0x00 +#define M1064_XPIXCLKCTRL_SRC_PLL 0x01 +#define M1064_XPIXCLKCTRL_SRC_EXT 0x02 +#define M1064_XPIXCLKCTRL_SRC_MASK 0x03 +#define M1064_XPIXCLKCTRL_EN 0x00 +#define M1064_XPIXCLKCTRL_DIS 0x04 +#define M1064_XPIXCLKCTRL_PLL_DOWN 0x00 +#define M1064_XPIXCLKCTRL_PLL_UP 0x08 +#define M1064_XGENCTRL 0x1D +#define M1064_XGENCTRL_VS_0 0x00 +#define M1064_XGENCTRL_VS_1 0x01 +#define M1064_XGENCTRL_ALPHA_DIS 0x00 +#define M1064_XGENCTRL_ALPHA_EN 0x02 +#define M1064_XGENCTRL_BLACK_0IRE 0x00 +#define M1064_XGENCTRL_BLACK_75IRE 0x10 +#define M1064_XGENCTRL_SYNC_ON_GREEN 0x00 +#define M1064_XGENCTRL_NO_SYNC_ON_GREEN 0x20 +#define M1064_XGENCTRL_SYNC_ON_GREEN_MASK 0x20 +#define M1064_XMISCCTRL 0x1E +#define M1064_XMISCCTRL_DAC_DIS 0x00 +#define M1064_XMISCCTRL_DAC_EN 0x01 +#define M1064_XMISCCTRL_MFC_VGA 0x00 +#define M1064_XMISCCTRL_MFC_MAFC 0x02 +#define M1064_XMISCCTRL_MFC_DIS 0x06 +#define GX00_XMISCCTRL_MFC_MAFC 0x02 +#define GX00_XMISCCTRL_MFC_PANELLINK 0x04 +#define GX00_XMISCCTRL_MFC_DIS 0x06 +#define GX00_XMISCCTRL_MFC_MASK 0x06 +#define M1064_XMISCCTRL_DAC_6BIT 0x00 +#define M1064_XMISCCTRL_DAC_8BIT 0x08 +#define M1064_XMISCCTRL_DAC_WIDTHMASK 0x08 +#define M1064_XMISCCTRL_LUT_DIS 0x00 +#define M1064_XMISCCTRL_LUT_EN 0x10 +#define G400_XMISCCTRL_VDO_MAFC12 0x00 +#define G400_XMISCCTRL_VDO_BYPASS656 0x40 +#define G400_XMISCCTRL_VDO_C2_MAFC12 0x80 +#define G400_XMISCCTRL_VDO_C2_BYPASS656 0xC0 +#define G400_XMISCCTRL_VDO_MASK 0xE0 +#define M1064_XGENIOCTRL 0x2A +#define M1064_XGENIODATA 0x2B +#define DAC1064_XSYSPLLM 0x2C +#define DAC1064_XSYSPLLN 0x2D +#define DAC1064_XSYSPLLP 0x2E +#define DAC1064_XSYSPLLSTAT 0x2F +#define M1064_XZOOMCTRL 0x38 +#define M1064_XZOOMCTRL_1 0x00 +#define M1064_XZOOMCTRL_2 0x01 +#define M1064_XZOOMCTRL_4 0x03 +#define M1064_XSENSETEST 0x3A +#define M1064_XSENSETEST_BCOMP 0x01 +#define M1064_XSENSETEST_GCOMP 0x02 +#define M1064_XSENSETEST_RCOMP 0x04 +#define M1064_XSENSETEST_PDOWN 0x00 +#define M1064_XSENSETEST_PUP 0x80 +#define M1064_XCRCREML 0x3C +#define M1064_XCRCREMH 0x3D +#define M1064_XCRCBITSEL 0x3E +#define M1064_XCOLKEYMASKL 0x40 +#define M1064_XCOLKEYMASKH 0x41 +#define M1064_XCOLKEYL 0x42 +#define M1064_XCOLKEYH 0x43 +#define M1064_XPIXPLLAM 0x44 +#define M1064_XPIXPLLAN 0x45 +#define M1064_XPIXPLLAP 0x46 +#define M1064_XPIXPLLBM 0x48 +#define M1064_XPIXPLLBN 0x49 +#define M1064_XPIXPLLBP 0x4A +#define M1064_XPIXPLLCM 0x4C +#define M1064_XPIXPLLCN 0x4D +#define M1064_XPIXPLLCP 0x4E +#define M1064_XPIXPLLSTAT 0x4F + +enum POS1064 { + POS1064_XCURADDL=0, POS1064_XCURADDH, POS1064_XCURCTRL, + POS1064_XCURCOL0RED, POS1064_XCURCOL0GREEN, POS1064_XCURCOL0BLUE, + POS1064_XCURCOL1RED, POS1064_XCURCOL1GREEN, POS1064_XCURCOL1BLUE, + POS1064_XCURCOL2RED, POS1064_XCURCOL2GREEN, POS1064_XCURCOL2BLUE, + POS1064_XVREFCTRL, POS1064_XMULCTRL, POS1064_XPIXCLKCTRL, POS1064_XGENCTRL, + POS1064_XMISCCTRL, + POS1064_XGENIOCTRL, POS1064_XGENIODATA, POS1064_XZOOMCTRL, POS1064_XSENSETEST, + POS1064_XCRCBITSEL, + POS1064_XCOLKEYMASKL, POS1064_XCOLKEYMASKH, POS1064_XCOLKEYL, POS1064_XCOLKEYH }; + + +#endif /* __MATROXFB_DAC1064_H__ */ diff -uNr linux-2.2.16.SuSE/drivers/video/matrox/matroxfb_Ti3026.c linux.compile/drivers/video/matrox/matroxfb_Ti3026.c --- linux-2.2.16.SuSE/drivers/video/matrox/matroxfb_Ti3026.c Thu Jan 1 01:00:00 1970 +++ linux.compile/drivers/video/matrox/matroxfb_Ti3026.c Wed Jul 19 01:22:10 2000 @@ -0,0 +1,862 @@ +/* + * + * Hardware accelerated Matrox Millennium I, II, Mystique, G100, G200 and G400 + * + * (c) 1998,1999,2000 Petr Vandrovec + * + * Version: 1.21 2000/01/09 + * + * MTRR stuff: 1998 Tom Rini + * + * Contributors: "menion?" + * Betatesting, fixes, ideas + * + * "Kurt Garloff" + * Betatesting, fixes, ideas, videomodes, videomode timings + * + * "Tom Rini" + * MTRR stuff, PPC cleanups, betatesting, fixes, ideas + * + * "Bibek Sahu" + * Access device through readb|w|l and write b|w|l + * Extensive debugging stuff + * + * "Daniel Haun" + * Testing, hardware cursor fixes + * + * "Scott Wood" + * Fixes + * + * "Gerd Knorr" + * Betatesting + * + * "Kelly French" + * "Fernando Herrera" + * Betatesting, bug reporting + * + * "Pablo Bianucci" + * Fixes, ideas, betatesting + * + * "Inaky Perez Gonzalez" + * Fixes, enhandcements, ideas, betatesting + * + * "Ryuichi Oikawa" + * PPC betatesting, PPC support, backward compatibility + * + * "Paul Womar" + * "Owen Waller" + * PPC betatesting + * + * "Thomas Pornin" + * Alpha betatesting + * + * "Pieter van Leuven" + * "Ulf Jaenicke-Roessler" + * G100 testing + * + * "H. Peter Arvin" + * Ideas + * + * "Cort Dougan" + * CHRP fixes and PReP cleanup + * + * "Mark Vojkovich" + * G400 support + * + * (following author is not in any relation with this code, but his code + * is included in this driver) + * + * Based on framebuffer driver for VBE 2.0 compliant graphic boards + * (c) 1998 Gerd Knorr + * + * (following author is not in any relation with this code, but his ideas + * were used when writting this driver) + * + * FreeVBE/AF (Matrox), "Shawn Hargreaves" + * + */ + +/* make checkconfig does not verify included files... */ +#include + +#include "matroxfb_Ti3026.h" +#include "matroxfb_misc.h" +#include "matroxfb_accel.h" + +#ifdef CONFIG_FB_MATROX_MILLENIUM +#define outTi3026 matroxfb_DAC_out +#define inTi3026 matroxfb_DAC_in + +#define TVP3026_INDEX 0x00 +#define TVP3026_PALWRADD 0x00 +#define TVP3026_PALDATA 0x01 +#define TVP3026_PIXRDMSK 0x02 +#define TVP3026_PALRDADD 0x03 +#define TVP3026_CURCOLWRADD 0x04 +#define TVP3026_CLOVERSCAN 0x00 +#define TVP3026_CLCOLOR0 0x01 +#define TVP3026_CLCOLOR1 0x02 +#define TVP3026_CLCOLOR2 0x03 +#define TVP3026_CURCOLDATA 0x05 +#define TVP3026_CURCOLRDADD 0x07 +#define TVP3026_CURCTRL 0x09 +#define TVP3026_X_DATAREG 0x0A +#define TVP3026_CURRAMDATA 0x0B +#define TVP3026_CURPOSXL 0x0C +#define TVP3026_CURPOSXH 0x0D +#define TVP3026_CURPOSYL 0x0E +#define TVP3026_CURPOSYH 0x0F + +#define TVP3026_XSILICONREV 0x01 +#define TVP3026_XCURCTRL 0x06 +#define TVP3026_XCURCTRL_DIS 0x00 /* transparent, transparent, transparent, transparent */ +#define TVP3026_XCURCTRL_3COLOR 0x01 /* transparent, 0, 1, 2 */ +#define TVP3026_XCURCTRL_XGA 0x02 /* 0, 1, transparent, complement */ +#define TVP3026_XCURCTRL_XWIN 0x03 /* transparent, transparent, 0, 1 */ +#define TVP3026_XCURCTRL_BLANK2048 0x00 +#define TVP3026_XCURCTRL_BLANK4096 0x10 +#define TVP3026_XCURCTRL_INTERLACED 0x20 +#define TVP3026_XCURCTRL_ODD 0x00 /* ext.signal ODD/\EVEN */ +#define TVP3026_XCURCTRL_EVEN 0x40 /* ext.signal EVEN/\ODD */ +#define TVP3026_XCURCTRL_INDIRECT 0x00 +#define TVP3026_XCURCTRL_DIRECT 0x80 +#define TVP3026_XLATCHCTRL 0x0F +#define TVP3026_XLATCHCTRL_1_1 0x06 +#define TVP3026_XLATCHCTRL_2_1 0x07 +#define TVP3026_XLATCHCTRL_4_1 0x06 +#define TVP3026_XLATCHCTRL_8_1 0x06 +#define TVP3026_XLATCHCTRL_16_1 0x06 +#define TVP3026A_XLATCHCTRL_4_3 0x06 /* ??? do not understand... but it works... !!! */ +#define TVP3026A_XLATCHCTRL_8_3 0x07 +#define TVP3026B_XLATCHCTRL_4_3 0x08 +#define TVP3026B_XLATCHCTRL_8_3 0x06 /* ??? do not understand... but it works... !!! */ +#define TVP3026_XTRUECOLORCTRL 0x18 +#define TVP3026_XTRUECOLORCTRL_VRAM_SHIFT_ACCEL 0x00 +#define TVP3026_XTRUECOLORCTRL_VRAM_SHIFT_TVP 0x20 +#define TVP3026_XTRUECOLORCTRL_PSEUDOCOLOR 0x80 +#define TVP3026_XTRUECOLORCTRL_TRUECOLOR 0x40 /* paletized */ +#define TVP3026_XTRUECOLORCTRL_DIRECTCOLOR 0x00 +#define TVP3026_XTRUECOLORCTRL_24_ALTERNATE 0x08 /* 5:4/5:2 instead of 4:3/8:3 */ +#define TVP3026_XTRUECOLORCTRL_RGB_888 0x16 /* 4:3/8:3 (or 5:4/5:2) */ +#define TVP3026_XTRUECOLORCTRL_BGR_888 0x17 +#define TVP3026_XTRUECOLORCTRL_ORGB_8888 0x06 +#define TVP3026_XTRUECOLORCTRL_BGRO_8888 0x07 +#define TVP3026_XTRUECOLORCTRL_RGB_565 0x05 +#define TVP3026_XTRUECOLORCTRL_ORGB_1555 0x04 +#define TVP3026_XTRUECOLORCTRL_RGB_664 0x03 +#define TVP3026_XTRUECOLORCTRL_RGBO_4444 0x01 +#define TVP3026_XMUXCTRL 0x19 +#define TVP3026_XMUXCTRL_MEMORY_8BIT 0x01 /* - */ +#define TVP3026_XMUXCTRL_MEMORY_16BIT 0x02 /* - */ +#define TVP3026_XMUXCTRL_MEMORY_32BIT 0x03 /* 2MB RAM, 512K * 4 */ +#define TVP3026_XMUXCTRL_MEMORY_64BIT 0x04 /* >2MB RAM, 512K * 8 & more */ +#define TVP3026_XMUXCTRL_PIXEL_4BIT 0x40 /* L0,H0,L1,H1... */ +#define TVP3026_XMUXCTRL_PIXEL_4BIT_SWAPPED 0x60 /* H0,L0,H1,L1... */ +#define TVP3026_XMUXCTRL_PIXEL_8BIT 0x48 +#define TVP3026_XMUXCTRL_PIXEL_16BIT 0x50 +#define TVP3026_XMUXCTRL_PIXEL_32BIT 0x58 +#define TVP3026_XMUXCTRL_VGA 0x98 /* VGA MEMORY, 8BIT PIXEL */ +#define TVP3026_XCLKCTRL 0x1A +#define TVP3026_XCLKCTRL_DIV1 0x00 +#define TVP3026_XCLKCTRL_DIV2 0x10 +#define TVP3026_XCLKCTRL_DIV4 0x20 +#define TVP3026_XCLKCTRL_DIV8 0x30 +#define TVP3026_XCLKCTRL_DIV16 0x40 +#define TVP3026_XCLKCTRL_DIV32 0x50 +#define TVP3026_XCLKCTRL_DIV64 0x60 +#define TVP3026_XCLKCTRL_CLKSTOPPED 0x70 +#define TVP3026_XCLKCTRL_SRC_CLK0 0x00 +#define TVP3026_XCLKCTRL_SRC_CLK1 0x01 +#define TVP3026_XCLKCTRL_SRC_CLK2 0x02 /* CLK2 is TTL source*/ +#define TVP3026_XCLKCTRL_SRC_NCLK2 0x03 /* not CLK2 is TTL source */ +#define TVP3026_XCLKCTRL_SRC_ECLK2 0x04 /* CLK2 and not CLK2 is ECL source */ +#define TVP3026_XCLKCTRL_SRC_PLL 0x05 +#define TVP3026_XCLKCTRL_SRC_DIS 0x06 /* disable & poweroff internal clock */ +#define TVP3026_XCLKCTRL_SRC_CLK0VGA 0x07 +#define TVP3026_XPALETTEPAGE 0x1C +#define TVP3026_XGENCTRL 0x1D +#define TVP3026_XGENCTRL_HSYNC_POS 0x00 +#define TVP3026_XGENCTRL_HSYNC_NEG 0x01 +#define TVP3026_XGENCTRL_VSYNC_POS 0x00 +#define TVP3026_XGENCTRL_VSYNC_NEG 0x02 +#define TVP3026_XGENCTRL_LITTLE_ENDIAN 0x00 +#define TVP3026_XGENCTRL_BIG_ENDIAN 0x08 +#define TVP3026_XGENCTRL_BLACK_0IRE 0x00 +#define TVP3026_XGENCTRL_BLACK_75IRE 0x10 +#define TVP3026_XGENCTRL_NO_SYNC_ON_GREEN 0x00 +#define TVP3026_XGENCTRL_SYNC_ON_GREEN 0x20 +#define TVP3026_XGENCTRL_OVERSCAN_DIS 0x00 +#define TVP3026_XGENCTRL_OVERSCAN_EN 0x40 +#define TVP3026_XMISCCTRL 0x1E +#define TVP3026_XMISCCTRL_DAC_PUP 0x00 +#define TVP3026_XMISCCTRL_DAC_PDOWN 0x01 +#define TVP3026_XMISCCTRL_DAC_EXT 0x00 /* or 8, bit 3 is ignored */ +#define TVP3026_XMISCCTRL_DAC_6BIT 0x04 +#define TVP3026_XMISCCTRL_DAC_8BIT 0x0C +#define TVP3026_XMISCCTRL_PSEL_DIS 0x00 +#define TVP3026_XMISCCTRL_PSEL_EN 0x10 +#define TVP3026_XMISCCTRL_PSEL_LOW 0x00 /* PSEL high selects directcolor */ +#define TVP3026_XMISCCTRL_PSEL_HIGH 0x20 /* PSEL high selects truecolor or pseudocolor */ +#define TVP3026_XGENIOCTRL 0x2A +#define TVP3026_XGENIODATA 0x2B +#define TVP3026_XPLLADDR 0x2C +#define TVP3026_XPLLADDR_X(LOOP,MCLK,PIX) (((LOOP)<<4) | ((MCLK)<<2) | (PIX)) +#define TVP3026_XPLLDATA_N 0x00 +#define TVP3026_XPLLDATA_M 0x01 +#define TVP3026_XPLLDATA_P 0x02 +#define TVP3026_XPLLDATA_STAT 0x03 +#define TVP3026_XPIXPLLDATA 0x2D +#define TVP3026_XMEMPLLDATA 0x2E +#define TVP3026_XLOOPPLLDATA 0x2F +#define TVP3026_XCOLKEYOVRMIN 0x30 +#define TVP3026_XCOLKEYOVRMAX 0x31 +#define TVP3026_XCOLKEYREDMIN 0x32 +#define TVP3026_XCOLKEYREDMAX 0x33 +#define TVP3026_XCOLKEYGREENMIN 0x34 +#define TVP3026_XCOLKEYGREENMAX 0x35 +#define TVP3026_XCOLKEYBLUEMIN 0x36 +#define TVP3026_XCOLKEYBLUEMAX 0x37 +#define TVP3026_XCOLKEYCTRL 0x38 +#define TVP3026_XCOLKEYCTRL_OVR_EN 0x01 +#define TVP3026_XCOLKEYCTRL_RED_EN 0x02 +#define TVP3026_XCOLKEYCTRL_GREEN_EN 0x04 +#define TVP3026_XCOLKEYCTRL_BLUE_EN 0x08 +#define TVP3026_XCOLKEYCTRL_NEGATE 0x10 +#define TVP3026_XCOLKEYCTRL_ZOOM1 0x00 +#define TVP3026_XCOLKEYCTRL_ZOOM2 0x20 +#define TVP3026_XCOLKEYCTRL_ZOOM4 0x40 +#define TVP3026_XCOLKEYCTRL_ZOOM8 0x60 +#define TVP3026_XCOLKEYCTRL_ZOOM16 0x80 +#define TVP3026_XCOLKEYCTRL_ZOOM32 0xA0 +#define TVP3026_XMEMPLLCTRL 0x39 +#define TVP3026_XMEMPLLCTRL_DIV(X) (((X)-1)>>1) /* 2,4,6,8,10,12,14,16, division applied to LOOP PLL after divide by 2^P */ +#define TVP3026_XMEMPLLCTRL_STROBEMKC4 0x08 +#define TVP3026_XMEMPLLCTRL_MCLK_DOTCLOCK 0x00 /* MKC4 */ +#define TVP3026_XMEMPLLCTRL_MCLK_MCLKPLL 0x10 /* MKC4 */ +#define TVP3026_XMEMPLLCTRL_RCLK_PIXPLL 0x00 +#define TVP3026_XMEMPLLCTRL_RCLK_LOOPPLL 0x20 +#define TVP3026_XMEMPLLCTRL_RCLK_DOTDIVN 0x40 /* dot clock divided by loop pclk N prescaler */ +#define TVP3026_XSENSETEST 0x3A +#define TVP3026_XTESTMODEDATA 0x3B +#define TVP3026_XCRCREML 0x3C +#define TVP3026_XCRCREMH 0x3D +#define TVP3026_XCRCBITSEL 0x3E +#define TVP3026_XID 0x3F + +static const unsigned char DACseq[] = +{ TVP3026_XLATCHCTRL, TVP3026_XTRUECOLORCTRL, + TVP3026_XMUXCTRL, TVP3026_XCLKCTRL, + TVP3026_XPALETTEPAGE, + TVP3026_XGENCTRL, + TVP3026_XMISCCTRL, + TVP3026_XGENIOCTRL, + TVP3026_XGENIODATA, + TVP3026_XCOLKEYOVRMIN, TVP3026_XCOLKEYOVRMAX, TVP3026_XCOLKEYREDMIN, TVP3026_XCOLKEYREDMAX, + TVP3026_XCOLKEYGREENMIN, TVP3026_XCOLKEYGREENMAX, TVP3026_XCOLKEYBLUEMIN, TVP3026_XCOLKEYBLUEMAX, + TVP3026_XCOLKEYCTRL, + TVP3026_XMEMPLLCTRL, TVP3026_XSENSETEST, TVP3026_XCURCTRL }; + +#define POS3026_XLATCHCTRL 0 +#define POS3026_XTRUECOLORCTRL 1 +#define POS3026_XMUXCTRL 2 +#define POS3026_XCLKCTRL 3 +#define POS3026_XGENCTRL 5 +#define POS3026_XMISCCTRL 6 +#define POS3026_XMEMPLLCTRL 18 +#define POS3026_XCURCTRL 20 + +static const unsigned char MGADACbpp32[] = +{ TVP3026_XLATCHCTRL_2_1, TVP3026_XTRUECOLORCTRL_DIRECTCOLOR | TVP3026_XTRUECOLORCTRL_ORGB_8888, + 0x00, TVP3026_XCLKCTRL_DIV1 | TVP3026_XCLKCTRL_SRC_PLL, + 0x00, + TVP3026_XGENCTRL_HSYNC_POS | TVP3026_XGENCTRL_VSYNC_POS | TVP3026_XGENCTRL_LITTLE_ENDIAN | TVP3026_XGENCTRL_BLACK_0IRE | TVP3026_XGENCTRL_NO_SYNC_ON_GREEN | TVP3026_XGENCTRL_OVERSCAN_DIS, + TVP3026_XMISCCTRL_DAC_PUP | TVP3026_XMISCCTRL_DAC_8BIT | TVP3026_XMISCCTRL_PSEL_DIS | TVP3026_XMISCCTRL_PSEL_HIGH, + 0x00, + 0x1E, + 0xFF, 0xFF, 0xFF, 0xFF, + 0xFF, 0xFF, 0xFF, 0xFF, + TVP3026_XCOLKEYCTRL_ZOOM1, + 0x00, 0x00, TVP3026_XCURCTRL_DIS }; + +static void matroxfb_ti3026_flashcursor(unsigned long ptr) { +#define minfo ((struct matrox_fb_info*)ptr) + matroxfb_DAC_lock(); + outTi3026(PMINFO TVP3026_XCURCTRL, inTi3026(PMINFO TVP3026_XCURCTRL) ^ TVP3026_XCURCTRL_DIS ^ TVP3026_XCURCTRL_XGA); + ACCESS_FBINFO(cursor.timer.expires) = jiffies + HZ/2; + add_timer(&ACCESS_FBINFO(cursor.timer)); + matroxfb_DAC_unlock(); +#undef minfo +} + +static void matroxfb_ti3026_createcursor(WPMINFO struct display* p) { + unsigned long flags; + u_int32_t xline; + unsigned int i; + unsigned int to; + + if (ACCESS_FBINFO(currcon_display) != p) + return; + + DBG("matroxfb_ti3026_createcursor"); + + matroxfb_createcursorshape(PMINFO p, p->var.vmode); + + xline = (~0) << (32 - ACCESS_FBINFO(cursor.w)); + matroxfb_DAC_lock_irqsave(flags); + mga_outb(M_RAMDAC_BASE+TVP3026_INDEX, 0); + to = ACCESS_FBINFO(cursor.u); + for (i = 0; i < to; i++) { + mga_outb(M_RAMDAC_BASE+TVP3026_CURRAMDATA, 0); + mga_outb(M_RAMDAC_BASE+TVP3026_CURRAMDATA, 0); + mga_outb(M_RAMDAC_BASE+TVP3026_CURRAMDATA, 0); + mga_outb(M_RAMDAC_BASE+TVP3026_CURRAMDATA, 0); + mga_outb(M_RAMDAC_BASE+TVP3026_CURRAMDATA, 0); + mga_outb(M_RAMDAC_BASE+TVP3026_CURRAMDATA, 0); + mga_outb(M_RAMDAC_BASE+TVP3026_CURRAMDATA, 0); + mga_outb(M_RAMDAC_BASE+TVP3026_CURRAMDATA, 0); + } + to = ACCESS_FBINFO(cursor.d); + for (; i < to; i++) { + mga_outb(M_RAMDAC_BASE+TVP3026_CURRAMDATA, xline >> 24); + mga_outb(M_RAMDAC_BASE+TVP3026_CURRAMDATA, xline >> 16); + mga_outb(M_RAMDAC_BASE+TVP3026_CURRAMDATA, xline >> 8); + mga_outb(M_RAMDAC_BASE+TVP3026_CURRAMDATA, xline); + mga_outb(M_RAMDAC_BASE+TVP3026_CURRAMDATA, 0); + mga_outb(M_RAMDAC_BASE+TVP3026_CURRAMDATA, 0); + mga_outb(M_RAMDAC_BASE+TVP3026_CURRAMDATA, 0); + mga_outb(M_RAMDAC_BASE+TVP3026_CURRAMDATA, 0); + } + for (; i < 64; i++) { + mga_outb(M_RAMDAC_BASE+TVP3026_CURRAMDATA, 0); + mga_outb(M_RAMDAC_BASE+TVP3026_CURRAMDATA, 0); + mga_outb(M_RAMDAC_BASE+TVP3026_CURRAMDATA, 0); + mga_outb(M_RAMDAC_BASE+TVP3026_CURRAMDATA, 0); + mga_outb(M_RAMDAC_BASE+TVP3026_CURRAMDATA, 0); + mga_outb(M_RAMDAC_BASE+TVP3026_CURRAMDATA, 0); + mga_outb(M_RAMDAC_BASE+TVP3026_CURRAMDATA, 0); + mga_outb(M_RAMDAC_BASE+TVP3026_CURRAMDATA, 0); + } + for (i = 0; i < 512; i++) + mga_outb(M_RAMDAC_BASE+TVP3026_CURRAMDATA, 0xFF); + matroxfb_DAC_unlock_irqrestore(flags); +} + +static void matroxfb_ti3026_cursor(struct display* p, int mode, int x, int y) { + unsigned long flags; + MINFO_FROM_DISP(p); + + DBG("matroxfb_ti3026_cursor") + + if (ACCESS_FBINFO(currcon_display) != p) + return; + + if (mode == CM_ERASE) { + if (ACCESS_FBINFO(cursor.state) != CM_ERASE) { + del_timer_sync(&ACCESS_FBINFO(cursor.timer)); + matroxfb_DAC_lock_irqsave(flags); + ACCESS_FBINFO(cursor.state) = CM_ERASE; + outTi3026(PMINFO TVP3026_XCURCTRL, ACCESS_FBINFO(currenthw->DACreg[POS3026_XCURCTRL])); + matroxfb_DAC_unlock_irqrestore(flags); + } + return; + } + if ((p->conp->vc_cursor_type & CUR_HWMASK) != ACCESS_FBINFO(cursor.type)) + matroxfb_ti3026_createcursor(PMINFO p); + x *= fontwidth(p); + y *= fontheight(p); + y -= p->var.yoffset; + if (p->var.vmode & FB_VMODE_DOUBLE) + y *= 2; + del_timer_sync(&ACCESS_FBINFO(cursor.timer)); + matroxfb_DAC_lock_irqsave(flags); + if ((x != ACCESS_FBINFO(cursor.x)) || (y != ACCESS_FBINFO(cursor.y)) || ACCESS_FBINFO(cursor.redraw)) { + ACCESS_FBINFO(cursor.redraw) = 0; + ACCESS_FBINFO(cursor.x) = x; + ACCESS_FBINFO(cursor.y) = y; + x += 64; + y += 64; + outTi3026(PMINFO TVP3026_XCURCTRL, ACCESS_FBINFO(currenthw->DACreg[POS3026_XCURCTRL])); + mga_outb(M_RAMDAC_BASE+TVP3026_CURPOSXL, x); + mga_outb(M_RAMDAC_BASE+TVP3026_CURPOSXH, x >> 8); + mga_outb(M_RAMDAC_BASE+TVP3026_CURPOSYL, y); + mga_outb(M_RAMDAC_BASE+TVP3026_CURPOSYH, y >> 8); + } + ACCESS_FBINFO(cursor.state) = CM_DRAW; + if (ACCESS_FBINFO(devflags.blink)) + mod_timer(&ACCESS_FBINFO(cursor.timer), jiffies + HZ/2); + outTi3026(PMINFO TVP3026_XCURCTRL, ACCESS_FBINFO(currenthw->DACreg[POS3026_XCURCTRL]) | TVP3026_XCURCTRL_XGA); + matroxfb_DAC_unlock_irqrestore(flags); +} + +static int matroxfb_ti3026_setfont(struct display* p, int width, int height) { + + DBG("matrox_ti3026_setfont"); + + if (p && p->conp) + matroxfb_ti3026_createcursor(PMXINFO(p) p); + return 0; +} + +static int matroxfb_ti3026_selhwcursor(WPMINFO struct display* p) { + ACCESS_FBINFO(dispsw.cursor) = matroxfb_ti3026_cursor; + ACCESS_FBINFO(dispsw.set_font) = matroxfb_ti3026_setfont; + return 0; +} + +static int Ti3026_calcclock(CPMINFO unsigned int freq, unsigned int fmax, int* in, int* feed, int* post) { + unsigned int fvco; + unsigned int lin, lfeed, lpost; + + DBG("Ti3026_calcclock") + + fvco = PLL_calcclock(PMINFO freq, fmax, &lin, &lfeed, &lpost); + fvco >>= (*post = lpost); + *in = 64 - lin; + *feed = 64 - lfeed; + return fvco; +} + +static int Ti3026_setpclk(CPMINFO struct matrox_hw_state* hw, int clk, struct display* p) { + unsigned int f_pll; + unsigned int pixfeed, pixin, pixpost; + + DBG("Ti3026_setpclk") + + f_pll = Ti3026_calcclock(PMINFO clk, ACCESS_FBINFO(max_pixel_clock), &pixin, &pixfeed, &pixpost); + + hw->DACclk[0] = pixin | 0xC0; + hw->DACclk[1] = pixfeed; + hw->DACclk[2] = pixpost | 0xB0; + + if (p->type == FB_TYPE_TEXT) { + hw->DACreg[POS3026_XMEMPLLCTRL] = TVP3026_XMEMPLLCTRL_MCLK_MCLKPLL | TVP3026_XMEMPLLCTRL_RCLK_PIXPLL; + hw->DACclk[3] = 0xFD; + hw->DACclk[4] = 0x3D; + hw->DACclk[5] = 0x70; + } else { + unsigned int loopfeed, loopin, looppost, loopdiv, z; + unsigned int Bpp; + + Bpp = ACCESS_FBINFO(curr.final_bppShift); + + if (p->var.bits_per_pixel == 24) { + loopfeed = 3; /* set lm to any possible value */ + loopin = 3 * 32 / Bpp; + } else { + loopfeed = 4; + loopin = 4 * 32 / Bpp; + } + z = (110000 * loopin) / (f_pll * loopfeed); + loopdiv = 0; /* div 2 */ + if (z < 2) + looppost = 0; + else if (z < 4) + looppost = 1; + else if (z < 8) + looppost = 2; + else { + looppost = 3; + loopdiv = z/16; + } + if (p->var.bits_per_pixel == 24) { + hw->DACclk[3] = ((65 - loopin) & 0x3F) | 0xC0; + hw->DACclk[4] = (65 - loopfeed) | 0x80; + if (ACCESS_FBINFO(accel.ramdac_rev) > 0x20) { + if (isInterleave(MINFO)) + hw->DACreg[POS3026_XLATCHCTRL] = TVP3026B_XLATCHCTRL_8_3; + else { + hw->DACclk[4] &= ~0xC0; + hw->DACreg[POS3026_XLATCHCTRL] = TVP3026B_XLATCHCTRL_4_3; + } + } else { + if (isInterleave(MINFO)) + ; /* default... */ + else { + hw->DACclk[4] ^= 0xC0; /* change from 0x80 to 0x40 */ + hw->DACreg[POS3026_XLATCHCTRL] = TVP3026A_XLATCHCTRL_4_3; + } + } + hw->DACclk[5] = looppost | 0xF8; + if (ACCESS_FBINFO(devflags.mga_24bpp_fix)) + hw->DACclk[5] ^= 0x40; + } else { + hw->DACclk[3] = ((65 - loopin) & 0x3F) | 0xC0; + hw->DACclk[4] = 65 - loopfeed; + hw->DACclk[5] = looppost | 0xF0; + } + hw->DACreg[POS3026_XMEMPLLCTRL] = loopdiv | TVP3026_XMEMPLLCTRL_MCLK_MCLKPLL | TVP3026_XMEMPLLCTRL_RCLK_LOOPPLL; + } + return 0; +} + +static int Ti3026_init(CPMINFO struct matrox_hw_state* hw, struct my_timming* m, struct display* p) { + u_int8_t muxctrl = isInterleave(MINFO) ? TVP3026_XMUXCTRL_MEMORY_64BIT : TVP3026_XMUXCTRL_MEMORY_32BIT; + + DBG("Ti3026_init") + + memcpy(hw->DACreg, MGADACbpp32, sizeof(hw->DACreg)); + if (p->type == FB_TYPE_TEXT) { + hw->DACreg[POS3026_XLATCHCTRL] = TVP3026_XLATCHCTRL_8_1; + hw->DACreg[POS3026_XTRUECOLORCTRL] = TVP3026_XTRUECOLORCTRL_PSEUDOCOLOR; + hw->DACreg[POS3026_XMUXCTRL] = TVP3026_XMUXCTRL_VGA; + hw->DACreg[POS3026_XCLKCTRL] = TVP3026_XCLKCTRL_SRC_PLL | + TVP3026_XCLKCTRL_DIV4; + hw->DACreg[POS3026_XMISCCTRL] = TVP3026_XMISCCTRL_DAC_PUP | TVP3026_XMISCCTRL_DAC_6BIT | TVP3026_XMISCCTRL_PSEL_DIS | TVP3026_XMISCCTRL_PSEL_LOW; + } else { + switch (p->var.bits_per_pixel) { + case 4: hw->DACreg[POS3026_XLATCHCTRL] = TVP3026_XLATCHCTRL_16_1; /* or _8_1, they are same */ + hw->DACreg[POS3026_XTRUECOLORCTRL] = TVP3026_XTRUECOLORCTRL_PSEUDOCOLOR; + hw->DACreg[POS3026_XMUXCTRL] = muxctrl | TVP3026_XMUXCTRL_PIXEL_4BIT; + hw->DACreg[POS3026_XCLKCTRL] = TVP3026_XCLKCTRL_SRC_PLL | TVP3026_XCLKCTRL_DIV8; + hw->DACreg[POS3026_XMISCCTRL] = TVP3026_XMISCCTRL_DAC_PUP | TVP3026_XMISCCTRL_DAC_8BIT | TVP3026_XMISCCTRL_PSEL_DIS | TVP3026_XMISCCTRL_PSEL_LOW; + break; + case 8: hw->DACreg[POS3026_XLATCHCTRL] = TVP3026_XLATCHCTRL_8_1; /* or _4_1, they are same */ + hw->DACreg[POS3026_XTRUECOLORCTRL] = TVP3026_XTRUECOLORCTRL_PSEUDOCOLOR; + hw->DACreg[POS3026_XMUXCTRL] = muxctrl | TVP3026_XMUXCTRL_PIXEL_8BIT; + hw->DACreg[POS3026_XCLKCTRL] = TVP3026_XCLKCTRL_SRC_PLL | TVP3026_XCLKCTRL_DIV4; + hw->DACreg[POS3026_XMISCCTRL] = TVP3026_XMISCCTRL_DAC_PUP | TVP3026_XMISCCTRL_DAC_8BIT | TVP3026_XMISCCTRL_PSEL_DIS | TVP3026_XMISCCTRL_PSEL_LOW; + break; + case 16: + /* XLATCHCTRL should be _4_1 / _2_1... Why is not? (_2_1 is used everytime) */ + hw->DACreg[POS3026_XTRUECOLORCTRL] = (p->var.green.length == 5)? (TVP3026_XTRUECOLORCTRL_DIRECTCOLOR | TVP3026_XTRUECOLORCTRL_ORGB_1555 ) : (TVP3026_XTRUECOLORCTRL_DIRECTCOLOR | TVP3026_XTRUECOLORCTRL_RGB_565); + hw->DACreg[POS3026_XMUXCTRL] = muxctrl | TVP3026_XMUXCTRL_PIXEL_16BIT; + hw->DACreg[POS3026_XCLKCTRL] = TVP3026_XCLKCTRL_SRC_PLL | TVP3026_XCLKCTRL_DIV2; + break; + case 24: + /* XLATCHCTRL is: for (A) use _4_3 (?_8_3 is same? TBD), for (B) it is set in setpclk */ + hw->DACreg[POS3026_XTRUECOLORCTRL] = TVP3026_XTRUECOLORCTRL_DIRECTCOLOR | TVP3026_XTRUECOLORCTRL_RGB_888; + hw->DACreg[POS3026_XMUXCTRL] = muxctrl | TVP3026_XMUXCTRL_PIXEL_32BIT; + hw->DACreg[POS3026_XCLKCTRL] = TVP3026_XCLKCTRL_SRC_PLL | TVP3026_XCLKCTRL_DIV4; + break; + case 32: + /* XLATCHCTRL should be _2_1 / _1_1... Why is not? (_2_1 is used everytime) */ + hw->DACreg[POS3026_XMUXCTRL] = muxctrl | TVP3026_XMUXCTRL_PIXEL_32BIT; + break; + default: + return 1; /* TODO: failed */ + } + } + if (matroxfb_vgaHWinit(PMINFO hw, m, p)) return 1; + + /* set SYNC */ + hw->MiscOutReg = 0xCB; + if (m->sync & FB_SYNC_HOR_HIGH_ACT) + hw->DACreg[POS3026_XGENCTRL] |= TVP3026_XGENCTRL_HSYNC_NEG; + if (m->sync & FB_SYNC_VERT_HIGH_ACT) + hw->DACreg[POS3026_XGENCTRL] |= TVP3026_XGENCTRL_VSYNC_NEG; + if (m->sync & FB_SYNC_ON_GREEN) + hw->DACreg[POS3026_XGENCTRL] |= TVP3026_XGENCTRL_SYNC_ON_GREEN; + + /* set DELAY */ + if (ACCESS_FBINFO(video.len) < 0x400000) + hw->CRTCEXT[3] |= 0x08; + else if (ACCESS_FBINFO(video.len) > 0x400000) + hw->CRTCEXT[3] |= 0x10; + + /* set HWCURSOR */ + if (m->interlaced) { + hw->DACreg[POS3026_XCURCTRL] |= TVP3026_XCURCTRL_INTERLACED; + } + if (m->HTotal >= 1536) + hw->DACreg[POS3026_XCURCTRL] |= TVP3026_XCURCTRL_BLANK4096; + + /* set interleaving */ + hw->MXoptionReg &= ~0x00001000; + if ((p->type != FB_TYPE_TEXT) && isInterleave(MINFO)) hw->MXoptionReg |= 0x00001000; + + /* set DAC */ + Ti3026_setpclk(PMINFO hw, m->pixclock, p); + return 0; +} + +static void ti3026_setMCLK(CPMINFO struct matrox_hw_state* hw, int fout){ + unsigned int f_pll; + unsigned int pclk_m, pclk_n, pclk_p; + unsigned int mclk_m, mclk_n, mclk_p; + unsigned int rfhcnt, mclk_ctl; + int tmout; + + DBG("ti3026_setMCLK") + + f_pll = Ti3026_calcclock(PMINFO fout, ACCESS_FBINFO(max_pixel_clock), &mclk_n, &mclk_m, &mclk_p); + + /* save pclk */ + outTi3026(PMINFO TVP3026_XPLLADDR, 0xFC); + pclk_n = inTi3026(PMINFO TVP3026_XPIXPLLDATA); + outTi3026(PMINFO TVP3026_XPLLADDR, 0xFD); + pclk_m = inTi3026(PMINFO TVP3026_XPIXPLLDATA); + outTi3026(PMINFO TVP3026_XPLLADDR, 0xFE); + pclk_p = inTi3026(PMINFO TVP3026_XPIXPLLDATA); + + /* stop pclk */ + outTi3026(PMINFO TVP3026_XPLLADDR, 0xFE); + outTi3026(PMINFO TVP3026_XPIXPLLDATA, 0x00); + + /* set pclk to new mclk */ + outTi3026(PMINFO TVP3026_XPLLADDR, 0xFC); + outTi3026(PMINFO TVP3026_XPIXPLLDATA, mclk_n | 0xC0); + outTi3026(PMINFO TVP3026_XPIXPLLDATA, mclk_m); + outTi3026(PMINFO TVP3026_XPIXPLLDATA, mclk_p | 0xB0); + + /* wait for PLL to lock */ + for (tmout = 500000; tmout; tmout--) { + if (inTi3026(PMINFO TVP3026_XPIXPLLDATA) & 0x40) + break; + udelay(10); + }; + if (!tmout) + printk(KERN_ERR "matroxfb: Temporary pixel PLL not locked after 5 secs\n"); + + /* output pclk on mclk pin */ + mclk_ctl = inTi3026(PMINFO TVP3026_XMEMPLLCTRL); + outTi3026(PMINFO TVP3026_XMEMPLLCTRL, mclk_ctl & 0xE7); + outTi3026(PMINFO TVP3026_XMEMPLLCTRL, (mclk_ctl & 0xE7) | TVP3026_XMEMPLLCTRL_STROBEMKC4); + + /* stop MCLK */ + outTi3026(PMINFO TVP3026_XPLLADDR, 0xFB); + outTi3026(PMINFO TVP3026_XMEMPLLDATA, 0x00); + + /* set mclk to new freq */ + outTi3026(PMINFO TVP3026_XPLLADDR, 0xF3); + outTi3026(PMINFO TVP3026_XMEMPLLDATA, mclk_n | 0xC0); + outTi3026(PMINFO TVP3026_XMEMPLLDATA, mclk_m); + outTi3026(PMINFO TVP3026_XMEMPLLDATA, mclk_p | 0xB0); + + /* wait for PLL to lock */ + for (tmout = 500000; tmout; tmout--) { + if (inTi3026(PMINFO TVP3026_XMEMPLLDATA) & 0x40) + break; + udelay(10); + } + if (!tmout) + printk(KERN_ERR "matroxfb: Memory PLL not locked after 5 secs\n"); + + f_pll = f_pll * 333 / (10000 << mclk_p); + if (isMilleniumII(MINFO)) { + rfhcnt = (f_pll - 128) / 256; + if (rfhcnt > 15) + rfhcnt = 15; + } else { + rfhcnt = (f_pll - 64) / 128; + if (rfhcnt > 15) + rfhcnt = 0; + } + hw->MXoptionReg = (hw->MXoptionReg & ~0x000F0000) | (rfhcnt << 16); + pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg); + + /* output MCLK to MCLK pin */ + outTi3026(PMINFO TVP3026_XMEMPLLCTRL, (mclk_ctl & 0xE7) | TVP3026_XMEMPLLCTRL_MCLK_MCLKPLL); + outTi3026(PMINFO TVP3026_XMEMPLLCTRL, (mclk_ctl ) | TVP3026_XMEMPLLCTRL_MCLK_MCLKPLL | TVP3026_XMEMPLLCTRL_STROBEMKC4); + + /* stop PCLK */ + outTi3026(PMINFO TVP3026_XPLLADDR, 0xFE); + outTi3026(PMINFO TVP3026_XPIXPLLDATA, 0x00); + + /* restore pclk */ + outTi3026(PMINFO TVP3026_XPLLADDR, 0xFC); + outTi3026(PMINFO TVP3026_XPIXPLLDATA, pclk_n); + outTi3026(PMINFO TVP3026_XPIXPLLDATA, pclk_m); + outTi3026(PMINFO TVP3026_XPIXPLLDATA, pclk_p); + + /* wait for PLL to lock */ + for (tmout = 500000; tmout; tmout--) { + if (inTi3026(PMINFO TVP3026_XPIXPLLDATA) & 0x40) + break; + udelay(10); + } + if (!tmout) + printk(KERN_ERR "matroxfb: Pixel PLL not locked after 5 secs\n"); +} + +static void ti3026_ramdac_init(WPMINFO struct matrox_hw_state* hw){ + + DBG("ti3026_ramdac_init") + + ACCESS_FBINFO(features.pll.vco_freq_min) = 110000; + ACCESS_FBINFO(features.pll.ref_freq) = 114545; + ACCESS_FBINFO(features.pll.feed_div_min) = 2; + ACCESS_FBINFO(features.pll.feed_div_max) = 24; + ACCESS_FBINFO(features.pll.in_div_min) = 2; + ACCESS_FBINFO(features.pll.in_div_max) = 63; + ACCESS_FBINFO(features.pll.post_shift_max) = 3; + if (ACCESS_FBINFO(devflags.noinit)) + return; + ti3026_setMCLK(PMINFO hw, 60000); +} + +static void Ti3026_restore(WPMINFO struct matrox_hw_state* hw, struct matrox_hw_state* oldhw, struct display* p) { + int i; + CRITFLAGS + + DBG("Ti3026_restore") + +#ifdef DEBUG + dprintk(KERN_INFO "EXTVGA regs: "); + for (i = 0; i < 6; i++) + dprintk("%02X:", hw->CRTCEXT[i]); + dprintk("\n"); +#endif + + CRITBEGIN + + pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg); + + CRITEND + + matroxfb_vgaHWrestore(PMINFO hw, oldhw); + + CRITBEGIN + + for (i = 0; i < 6; i++) + mga_setr(M_EXTVGA_INDEX, i, hw->CRTCEXT[i]); + + for (i = 0; i < 21; i++) { + outTi3026(PMINFO DACseq[i], hw->DACreg[i]); + } + if (oldhw) { + outTi3026(PMINFO TVP3026_XPLLADDR, 0x00); + oldhw->DACclk[0] = inTi3026(PMINFO TVP3026_XPIXPLLDATA); + oldhw->DACclk[3] = inTi3026(PMINFO TVP3026_XLOOPPLLDATA); + outTi3026(PMINFO TVP3026_XPLLADDR, 0x15); + oldhw->DACclk[1] = inTi3026(PMINFO TVP3026_XPIXPLLDATA); + oldhw->DACclk[4] = inTi3026(PMINFO TVP3026_XLOOPPLLDATA); + outTi3026(PMINFO TVP3026_XPLLADDR, 0x2A); + oldhw->DACclk[2] = inTi3026(PMINFO TVP3026_XPIXPLLDATA); + oldhw->DACclk[5] = inTi3026(PMINFO TVP3026_XLOOPPLLDATA); + } + CRITEND + if (!oldhw || memcmp(hw->DACclk, oldhw->DACclk, 6)) { + /* agrhh... setting up PLL is very slow on Millennium... */ + /* Mystique PLL is locked in few ms, but Millennium PLL lock takes about 0.15 s... */ + /* Maybe even we should call schedule() ? */ + + CRITBEGIN + outTi3026(PMINFO TVP3026_XCLKCTRL, hw->DACreg[POS3026_XCLKCTRL]); + outTi3026(PMINFO TVP3026_XPLLADDR, 0x2A); + outTi3026(PMINFO TVP3026_XLOOPPLLDATA, 0); + outTi3026(PMINFO TVP3026_XPIXPLLDATA, 0); + + outTi3026(PMINFO TVP3026_XPLLADDR, 0x00); + for (i = 0; i < 3; i++) + outTi3026(PMINFO TVP3026_XPIXPLLDATA, hw->DACclk[i]); + /* wait for PLL only if PLL clock requested (always for PowerMode, never for VGA) */ + if (hw->MiscOutReg & 0x08) { + int tmout; + outTi3026(PMINFO TVP3026_XPLLADDR, 0x3F); + for (tmout = 500000; tmout; --tmout) { + if (inTi3026(PMINFO TVP3026_XPIXPLLDATA) & 0x40) + break; + udelay(10); + } + + CRITEND + + if (!tmout) + printk(KERN_ERR "matroxfb: Pixel PLL not locked after 5 secs\n"); + else + dprintk(KERN_INFO "PixelPLL: %d\n", 500000-tmout); + CRITBEGIN + } + outTi3026(PMINFO TVP3026_XMEMPLLCTRL, hw->DACreg[POS3026_XMEMPLLCTRL]); + outTi3026(PMINFO TVP3026_XPLLADDR, 0x00); + for (i = 3; i < 6; i++) + outTi3026(PMINFO TVP3026_XLOOPPLLDATA, hw->DACclk[i]); + CRITEND + if ((hw->MiscOutReg & 0x08) && ((hw->DACclk[5] & 0x80) == 0x80)) { + int tmout; + + CRITBEGIN + outTi3026(PMINFO TVP3026_XPLLADDR, 0x3F); + for (tmout = 500000; tmout; --tmout) { + if (inTi3026(PMINFO TVP3026_XLOOPPLLDATA) & 0x40) + break; + udelay(10); + } + CRITEND + if (!tmout) + printk(KERN_ERR "matroxfb: Loop PLL not locked after 5 secs\n"); + else + dprintk(KERN_INFO "LoopPLL: %d\n", 500000-tmout); + } + } + matrox_init_putc(PMINFO p, matroxfb_ti3026_createcursor); + +#ifdef DEBUG + dprintk(KERN_DEBUG "3026DACregs "); + for (i = 0; i < 21; i++) { + dprintk("R%02X=%02X ", DACseq[i], hw->DACreg[i]); + if ((i & 0x7) == 0x7) dprintk("\n" KERN_DEBUG "continuing... "); + } + dprintk("\n" KERN_DEBUG "DACclk "); + for (i = 0; i < 6; i++) + dprintk("C%02X=%02X ", i, hw->DACclk[i]); + dprintk("\n"); +#endif +} + +static void Ti3026_reset(WPMINFO struct matrox_hw_state* hw){ + + DBG("Ti3026_reset") + + matroxfb_fastfont_init(MINFO); + + ti3026_ramdac_init(PMINFO hw); +} + +static int Ti3026_preinit(WPMINFO struct matrox_hw_state* hw){ + static const int vxres_mill2[] = { 512, 640, 768, 800, 832, 960, + 1024, 1152, 1280, 1600, 1664, 1920, + 2048, 0}; + static const int vxres_mill1[] = { 640, 768, 800, 960, + 1024, 1152, 1280, 1600, 1920, + 2048, 0}; + + DBG("Ti3026_preinit") + + ACCESS_FBINFO(millenium) = 1; + ACCESS_FBINFO(milleniumII) = (ACCESS_FBINFO(pcidev)->device != PCI_DEVICE_ID_MATROX_MIL); + ACCESS_FBINFO(capable.cfb4) = 1; + ACCESS_FBINFO(capable.text) = 1; /* isMilleniumII(MINFO); */ + ACCESS_FBINFO(capable.vxres) = isMilleniumII(MINFO)?vxres_mill2:vxres_mill1; + ACCESS_FBINFO(cursor.timer.function) = matroxfb_ti3026_flashcursor; + + if (ACCESS_FBINFO(devflags.noinit)) + return 0; + /* preserve VGA I/O, BIOS and PPC */ + hw->MXoptionReg &= 0xC0000100; + hw->MXoptionReg |= 0x002C0000; + if (ACCESS_FBINFO(devflags.novga)) + hw->MXoptionReg &= ~0x00000100; + if (ACCESS_FBINFO(devflags.nobios)) + hw->MXoptionReg &= ~0x40000000; + if (ACCESS_FBINFO(devflags.nopciretry)) + hw->MXoptionReg |= 0x20000000; + pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg); + + ACCESS_FBINFO(accel.ramdac_rev) = inTi3026(PMINFO TVP3026_XSILICONREV); + + outTi3026(PMINFO TVP3026_XCLKCTRL, TVP3026_XCLKCTRL_SRC_CLK0VGA | TVP3026_XCLKCTRL_CLKSTOPPED); + outTi3026(PMINFO TVP3026_XTRUECOLORCTRL, TVP3026_XTRUECOLORCTRL_PSEUDOCOLOR); + outTi3026(PMINFO TVP3026_XMUXCTRL, TVP3026_XMUXCTRL_VGA); + + outTi3026(PMINFO TVP3026_XPLLADDR, 0x2A); + outTi3026(PMINFO TVP3026_XLOOPPLLDATA, 0x00); + outTi3026(PMINFO TVP3026_XPIXPLLDATA, 0x00); + + mga_outb(M_MISC_REG, 0x67); + + outTi3026(PMINFO TVP3026_XMEMPLLCTRL, TVP3026_XMEMPLLCTRL_STROBEMKC4 | TVP3026_XMEMPLLCTRL_MCLK_MCLKPLL); + + mga_outl(M_RESET, 1); + udelay(250); + mga_outl(M_RESET, 0); + udelay(250); + mga_outl(M_MACCESS, 0x00008000); + udelay(10); + return 0; +} + +struct matrox_switch matrox_millennium = { + Ti3026_preinit, Ti3026_reset, Ti3026_init, Ti3026_restore, matroxfb_ti3026_selhwcursor +}; +#endif diff -uNr linux-2.2.16.SuSE/drivers/video/matrox/matroxfb_Ti3026.h linux.compile/drivers/video/matrox/matroxfb_Ti3026.h --- linux-2.2.16.SuSE/drivers/video/matrox/matroxfb_Ti3026.h Thu Jan 1 01:00:00 1970 +++ linux.compile/drivers/video/matrox/matroxfb_Ti3026.h Wed Jul 19 02:15:10 2000 @@ -0,0 +1,13 @@ +#ifndef __MATROXFB_TI3026_H__ +#define __MATROXFB_TI3026_H__ + +/* make checkconfig does not walk through whole include tree */ +#include + +#include "matroxfb_base.h" + +#ifdef CONFIG_FB_MATROX_MILLENIUM +extern struct matrox_switch matrox_millennium; +#endif + +#endif /* __MATROXFB_TI3026_H__ */ diff -uNr linux-2.2.16.SuSE/drivers/video/matrox/matroxfb_accel.c linux.compile/drivers/video/matrox/matroxfb_accel.c --- linux-2.2.16.SuSE/drivers/video/matrox/matroxfb_accel.c Thu Jan 1 01:00:00 1970 +++ linux.compile/drivers/video/matrox/matroxfb_accel.c Wed Jul 19 01:22:10 2000 @@ -0,0 +1,1212 @@ +/* + * + * Hardware accelerated Matrox Millennium I, II, Mystique, G100, G200 and G400 + * + * (c) 1998,1999,2000 Petr Vandrovec + * + * Version: 1.21 2000/01/09 + * + * MTRR stuff: 1998 Tom Rini + * + * Contributors: "menion?" + * Betatesting, fixes, ideas + * + * "Kurt Garloff" + * Betatesting, fixes, ideas, videomodes, videomode timings + * + * "Tom Rini" + * MTRR stuff, PPC cleanups, betatesting, fixes, ideas + * + * "Bibek Sahu" + * Access device through readb|w|l and write b|w|l + * Extensive debugging stuff + * + * "Daniel Haun" + * Testing, hardware cursor fixes + * + * "Scott Wood" + * Fixes + * + * "Gerd Knorr" + * Betatesting + * + * "Kelly French" + * "Fernando Herrera" + * Betatesting, bug reporting + * + * "Pablo Bianucci" + * Fixes, ideas, betatesting + * + * "Inaky Perez Gonzalez" + * Fixes, enhandcements, ideas, betatesting + * + * "Ryuichi Oikawa" + * PPC betatesting, PPC support, backward compatibility + * + * "Paul Womar" + * "Owen Waller" + * PPC betatesting + * + * "Thomas Pornin" + * Alpha betatesting + * + * "Pieter van Leuven" + * "Ulf Jaenicke-Roessler" + * G100 testing + * + * "H. Peter Arvin" + * Ideas + * + * "Cort Dougan" + * CHRP fixes and PReP cleanup + * + * "Mark Vojkovich" + * G400 support + * + * (following author is not in any relation with this code, but his code + * is included in this driver) + * + * Based on framebuffer driver for VBE 2.0 compliant graphic boards + * (c) 1998 Gerd Knorr + * + * (following author is not in any relation with this code, but his ideas + * were used when writting this driver) + * + * FreeVBE/AF (Matrox), "Shawn Hargreaves" + * + */ + +#include "matroxfb_accel.h" +#include "matroxfb_DAC1064.h" +#include "matroxfb_Ti3026.h" +#include "matroxfb_misc.h" + +#define curr_ydstorg(x) ACCESS_FBINFO2(x, curr.ydstorg.pixels) + +#define mga_ydstlen(y,l) mga_outl(M_YDSTLEN | M_EXEC, ((y) << 16) | (l)) + +void matrox_cfbX_init(WPMINFO struct display* p) { + u_int32_t maccess; + u_int32_t mpitch; + u_int32_t mopmode; + + DBG("matrox_cfbX_init") + + mpitch = p->var.xres_virtual; + + if (p->type == FB_TYPE_TEXT) { + maccess = 0x00000000; + mpitch = (mpitch >> 4) | 0x8000; /* set something */ + mopmode = M_OPMODE_8BPP; + } else { + switch (p->var.bits_per_pixel) { + case 4: maccess = 0x00000000; /* accelerate as 8bpp video */ + mpitch = (mpitch >> 1) | 0x8000; /* disable linearization */ + mopmode = M_OPMODE_4BPP; + break; + case 8: maccess = 0x00000000; + mopmode = M_OPMODE_8BPP; + break; + case 16: if (p->var.green.length == 5) + maccess = 0xC0000001; + else + maccess = 0x40000001; + mopmode = M_OPMODE_16BPP; + break; + case 24: maccess = 0x00000003; + mopmode = M_OPMODE_24BPP; + break; + case 32: maccess = 0x00000002; + mopmode = M_OPMODE_32BPP; + break; + default: maccess = 0x00000000; + mopmode = 0x00000000; + break; /* turn off acceleration!!! */ + } + } + mga_fifo(8); + mga_outl(M_PITCH, mpitch); + mga_outl(M_YDSTORG, curr_ydstorg(MINFO)); + if (ACCESS_FBINFO(capable.plnwt)) + mga_outl(M_PLNWT, -1); + mga_outl(M_OPMODE, mopmode); + mga_outl(M_CXBNDRY, 0xFFFF0000); + mga_outl(M_YTOP, 0); + mga_outl(M_YBOT, 0x01FFFFFF); + mga_outl(M_MACCESS, maccess); + ACCESS_FBINFO(accel.m_dwg_rect) = M_DWG_TRAP | M_DWG_SOLID | M_DWG_ARZERO | M_DWG_SGNZERO | M_DWG_SHIFTZERO; + if (isMilleniumII(MINFO)) ACCESS_FBINFO(accel.m_dwg_rect) |= M_DWG_TRANSC; + ACCESS_FBINFO(accel.m_opmode) = mopmode; +} + +static void matrox_cfbX_bmove(struct display* p, int sy, int sx, int dy, int dx, int height, int width) { + int pixx = p->var.xres_virtual, start, end; + CRITFLAGS + MINFO_FROM_DISP(p); + + DBG("matrox_cfbX_bmove") + + CRITBEGIN + + sx *= fontwidth(p); + dx *= fontwidth(p); + width *= fontwidth(p); + height *= fontheight(p); + sy *= fontheight(p); + dy *= fontheight(p); + if ((dy < sy) || ((dy == sy) && (dx <= sx))) { + mga_fifo(2); + mga_outl(M_DWGCTL, M_DWG_BITBLT | M_DWG_SHIFTZERO | M_DWG_SGNZERO | + M_DWG_BFCOL | M_DWG_REPLACE); + mga_outl(M_AR5, pixx); + width--; + start = sy*pixx+sx+curr_ydstorg(MINFO); + end = start+width; + } else { + mga_fifo(3); + mga_outl(M_DWGCTL, M_DWG_BITBLT | M_DWG_SHIFTZERO | M_DWG_BFCOL | M_DWG_REPLACE); + mga_outl(M_SGN, 5); + mga_outl(M_AR5, -pixx); + width--; + end = (sy+height-1)*pixx+sx+curr_ydstorg(MINFO); + start = end+width; + dy += height-1; + } + mga_fifo(4); + mga_outl(M_AR0, end); + mga_outl(M_AR3, start); + mga_outl(M_FXBNDRY, ((dx+width)<<16) | dx); + mga_ydstlen(dy, height); + WaitTillIdle(); + + CRITEND +} + +#ifdef FBCON_HAS_CFB4 +static void matrox_cfb4_bmove(struct display* p, int sy, int sx, int dy, int dx, int height, int width) { + int pixx, start, end; + CRITFLAGS + MINFO_FROM_DISP(p); + /* both (sx or dx or width) and fontwidth() are odd, so their multiply is + also odd, that means that we cannot use acceleration */ + + DBG("matrox_cfb4_bmove") + + CRITBEGIN + + if ((sx | dx | width) & fontwidth(p) & 1) { + fbcon_cfb4_bmove(p, sy, sx, dy, dx, height, width); + return; + } + sx *= fontwidth(p); + dx *= fontwidth(p); + width *= fontwidth(p); + height *= fontheight(p); + sy *= fontheight(p); + dy *= fontheight(p); + pixx = p->var.xres_virtual >> 1; + sx >>= 1; + dx >>= 1; + width >>= 1; + if ((dy < sy) || ((dy == sy) && (dx <= sx))) { + mga_fifo(2); + mga_outl(M_AR5, pixx); + mga_outl(M_DWGCTL, M_DWG_BITBLT | M_DWG_SHIFTZERO | M_DWG_SGNZERO | + M_DWG_BFCOL | M_DWG_REPLACE); + width--; + start = sy*pixx+sx+curr_ydstorg(MINFO); + end = start+width; + } else { + mga_fifo(3); + mga_outl(M_SGN, 5); + mga_outl(M_AR5, -pixx); + mga_outl(M_DWGCTL, M_DWG_BITBLT | M_DWG_SHIFTZERO | M_DWG_BFCOL | M_DWG_REPLACE); + width--; + end = (sy+height-1)*pixx+sx+curr_ydstorg(MINFO); + start = end+width; + dy += height-1; + } + mga_fifo(5); + mga_outl(M_AR0, end); + mga_outl(M_AR3, start); + mga_outl(M_FXBNDRY, ((dx+width)<<16) | dx); + mga_outl(M_YDST, dy*pixx >> 5); + mga_outl(M_LEN | M_EXEC, height); + WaitTillIdle(); + + CRITEND +} +#endif + +static void matroxfb_accel_clear(WPMINFO u_int32_t color, int sy, int sx, int height, + int width) { + CRITFLAGS + + DBG("matroxfb_accel_clear") + + CRITBEGIN + + mga_fifo(5); + mga_outl(M_DWGCTL, ACCESS_FBINFO(accel.m_dwg_rect) | M_DWG_REPLACE); + mga_outl(M_FCOL, color); + mga_outl(M_FXBNDRY, ((sx + width) << 16) | sx); + mga_ydstlen(sy, height); + WaitTillIdle(); + + CRITEND +} + +static void matrox_cfbX_clear(u_int32_t color, struct display* p, int sy, int sx, int height, int width) { + + DBG("matrox_cfbX_clear") + + matroxfb_accel_clear(PMXINFO(p) color, sy * fontheight(p), sx * fontwidth(p), + height * fontheight(p), width * fontwidth(p)); +} + +#ifdef FBCON_HAS_CFB4 +static void matrox_cfb4_clear(struct vc_data* conp, struct display* p, int sy, int sx, int height, int width) { + u_int32_t bgx; + int whattodo; + CRITFLAGS + MINFO_FROM_DISP(p); + + DBG("matrox_cfb4_clear") + + CRITBEGIN + + whattodo = 0; + bgx = attr_bgcol_ec(p, conp); + bgx |= bgx << 4; + bgx |= bgx << 8; + bgx |= bgx << 16; + sy *= fontheight(p); + sx *= fontwidth(p); + height *= fontheight(p); + width *= fontwidth(p); + if (sx & 1) { + sx ++; + if (!width) return; + width --; + whattodo = 1; + } + if (width & 1) { + whattodo |= 2; + } + width >>= 1; + sx >>= 1; + if (width) { + mga_fifo(5); + mga_outl(M_DWGCTL, ACCESS_FBINFO(accel.m_dwg_rect) | M_DWG_REPLACE2); + mga_outl(M_FCOL, bgx); + mga_outl(M_FXBNDRY, ((sx + width) << 16) | sx); + mga_outl(M_YDST, sy * p->var.xres_virtual >> 6); + mga_outl(M_LEN | M_EXEC, height); + WaitTillIdle(); + } + if (whattodo) { + u_int32_t step = p->var.xres_virtual >> 1; + vaddr_t vbase = ACCESS_FBINFO(video.vbase); + if (whattodo & 1) { + unsigned int uaddr = sy * step + sx - 1; + u_int32_t loop; + u_int8_t bgx2 = bgx & 0xF0; + for (loop = height; loop > 0; loop --) { + mga_writeb(vbase, uaddr, (mga_readb(vbase, uaddr) & 0x0F) | bgx2); + uaddr += step; + } + } + if (whattodo & 2) { + unsigned int uaddr = sy * step + sx + width; + u_int32_t loop; + u_int8_t bgx2 = bgx & 0x0F; + for (loop = height; loop > 0; loop --) { + mga_writeb(vbase, uaddr, (mga_readb(vbase, uaddr) & 0xF0) | bgx2); + uaddr += step; + } + } + } + + CRITEND +} +#endif + +#ifdef FBCON_HAS_CFB8 +static void matrox_cfb8_clear(struct vc_data* conp, struct display* p, int sy, int sx, int height, int width) { + u_int32_t bgx; + + DBG("matrox_cfb8_clear") + + bgx = attr_bgcol_ec(p, conp); + bgx |= bgx << 8; + bgx |= bgx << 16; + matrox_cfbX_clear(bgx, p, sy, sx, height, width); +} +#endif + +#ifdef FBCON_HAS_CFB16 +static void matrox_cfb16_clear(struct vc_data* conp, struct display* p, int sy, int sx, int height, int width) { + u_int32_t bgx; + + DBG("matrox_cfb16_clear") + + bgx = ((u_int16_t*)p->dispsw_data)[attr_bgcol_ec(p, conp)]; + matrox_cfbX_clear((bgx << 16) | bgx, p, sy, sx, height, width); +} +#endif + +#if defined(FBCON_HAS_CFB32) || defined(FBCON_HAS_CFB24) +static void matrox_cfb32_clear(struct vc_data* conp, struct display* p, int sy, int sx, int height, int width) { + u_int32_t bgx; + + DBG("matrox_cfb32_clear") + + bgx = ((u_int32_t*)p->dispsw_data)[attr_bgcol_ec(p, conp)]; + matrox_cfbX_clear(bgx, p, sy, sx, height, width); +} +#endif + +static void matrox_cfbX_fastputc(u_int32_t fgx, u_int32_t bgx, struct display* p, int c, int yy, int xx) { + unsigned int charcell; + unsigned int ar3; + CRITFLAGS + MINFO_FROM_DISP(p); + + charcell = fontwidth(p) * fontheight(p); + yy *= fontheight(p); + xx *= fontwidth(p); + + CRITBEGIN + + mga_fifo(8); + mga_outl(M_DWGCTL, M_DWG_BITBLT | M_DWG_SGNZERO | M_DWG_SHIFTZERO | M_DWG_BMONOWF | M_DWG_LINEAR | M_DWG_REPLACE); + + mga_outl(M_FCOL, fgx); + mga_outl(M_BCOL, bgx); + mga_outl(M_FXBNDRY, ((xx + fontwidth(p) - 1) << 16) | xx); + ar3 = ACCESS_FBINFO(fastfont.mgabase) + (c & p->charmask) * charcell; + mga_outl(M_AR3, ar3); + mga_outl(M_AR0, (ar3 + charcell - 1) & 0x0003FFFF); + mga_ydstlen(yy, fontheight(p)); + WaitTillIdle(); + + CRITEND +} + +static void matrox_cfbX_putc(u_int32_t fgx, u_int32_t bgx, struct display* p, int c, int yy, int xx) { + u_int32_t ar0; + u_int32_t step; + CRITFLAGS + MINFO_FROM_DISP(p); + + DBG_HEAVY("matrox_cfbX_putc"); + + yy *= fontheight(p); + xx *= fontwidth(p); + + CRITBEGIN + +#ifdef __BIG_ENDIAN + WaitTillIdle(); + mga_outl(M_OPMODE, M_OPMODE_8BPP); +#else + mga_fifo(7); +#endif + ar0 = fontwidth(p) - 1; + mga_outl(M_FXBNDRY, ((xx+ar0)<<16) | xx); + if (fontwidth(p) <= 8) + step = 1; + else if (fontwidth(p) <= 16) + step = 2; + else + step = 4; + if (fontwidth(p) == step << 3) { + size_t charcell = fontheight(p)*step; + /* TODO: Align charcell to 4B for BE */ + mga_outl(M_DWGCTL, M_DWG_ILOAD | M_DWG_SGNZERO | M_DWG_SHIFTZERO | M_DWG_BMONOWF | M_DWG_LINEAR | M_DWG_REPLACE); + mga_outl(M_FCOL, fgx); + mga_outl(M_BCOL, bgx); + mga_outl(M_AR3, 0); + mga_outl(M_AR0, fontheight(p)*fontwidth(p)-1); + mga_ydstlen(yy, fontheight(p)); + mga_memcpy_toio(ACCESS_FBINFO(mmio.vbase), 0, p->fontdata+(c&p->charmask)*charcell, charcell); + } else { + u8* chardata = p->fontdata+(c&p->charmask)*fontheight(p)*step; + int i; + + mga_outl(M_DWGCTL, M_DWG_ILOAD | M_DWG_SGNZERO | M_DWG_SHIFTZERO | M_DWG_BMONOWF | M_DWG_REPLACE); + mga_outl(M_FCOL, fgx); + mga_outl(M_BCOL, bgx); + mga_outl(M_AR5, 0); + mga_outl(M_AR3, 0); + mga_outl(M_AR0, ar0); + mga_ydstlen(yy, fontheight(p)); + + switch (step) { + case 1: + for (i = fontheight(p); i > 0; i--) { +#ifdef __LITTLE_ENDIAN + mga_outl(0, *chardata++); +#else + mga_outl(0, (*chardata++) << 24); +#endif + } + break; + case 2: + for (i = fontheight(p); i > 0; i--) { +#ifdef __LITTLE_ENDIAN + mga_outl(0, *(u_int16_t*)chardata); +#else + mga_outl(0, (*(u_int16_t*)chardata) << 16); +#endif + chardata += 2; + } + break; + case 4: + mga_memcpy_toio(ACCESS_FBINFO(mmio.vbase), 0, chardata, fontheight(p) * 4); + break; + } + } + WaitTillIdle(); +#ifdef __BIG_ENDIAN + mga_outl(M_OPMODE, ACCESS_FBINFO(accel.m_opmode)); +#endif + CRITEND +} + +#ifdef FBCON_HAS_CFB8 +static void matrox_cfb8_putc(struct vc_data* conp, struct display* p, int c, int yy, int xx) { + u_int32_t fgx, bgx; + MINFO_FROM_DISP(p); + + DBG_HEAVY("matroxfb_cfb8_putc"); + + fgx = attr_fgcol(p, c); + bgx = attr_bgcol(p, c); + fgx |= (fgx << 8); + fgx |= (fgx << 16); + bgx |= (bgx << 8); + bgx |= (bgx << 16); + ACCESS_FBINFO(curr.putc)(fgx, bgx, p, c, yy, xx); +} +#endif + +#ifdef FBCON_HAS_CFB16 +static void matrox_cfb16_putc(struct vc_data* conp, struct display* p, int c, int yy, int xx) { + u_int32_t fgx, bgx; + MINFO_FROM_DISP(p); + + DBG_HEAVY("matroxfb_cfb16_putc"); + + fgx = ((u_int16_t*)p->dispsw_data)[attr_fgcol(p, c)]; + bgx = ((u_int16_t*)p->dispsw_data)[attr_bgcol(p, c)]; + fgx |= (fgx << 16); + bgx |= (bgx << 16); + ACCESS_FBINFO(curr.putc)(fgx, bgx, p, c, yy, xx); +} +#endif + +#if defined(FBCON_HAS_CFB32) || defined(FBCON_HAS_CFB24) +static void matrox_cfb32_putc(struct vc_data* conp, struct display* p, int c, int yy, int xx) { + u_int32_t fgx, bgx; + MINFO_FROM_DISP(p); + + DBG_HEAVY("matroxfb_cfb32_putc"); + + fgx = ((u_int32_t*)p->dispsw_data)[attr_fgcol(p, c)]; + bgx = ((u_int32_t*)p->dispsw_data)[attr_bgcol(p, c)]; + ACCESS_FBINFO(curr.putc)(fgx, bgx, p, c, yy, xx); +} +#endif + +static void matrox_cfbX_fastputcs(u_int32_t fgx, u_int32_t bgx, struct display* p, const unsigned short* s, int count, int yy, int xx) { + unsigned int charcell; + CRITFLAGS + MINFO_FROM_DISP(p); + + yy *= fontheight(p); + xx *= fontwidth(p); + charcell = fontwidth(p) * fontheight(p); + + CRITBEGIN + + mga_fifo(3); + mga_outl(M_DWGCTL, M_DWG_BITBLT | M_DWG_SGNZERO | M_DWG_SHIFTZERO | M_DWG_BMONOWF | M_DWG_LINEAR | M_DWG_REPLACE); + mga_outl(M_FCOL, fgx); + mga_outl(M_BCOL, bgx); + while (count--) { + u_int32_t ar3 = ACCESS_FBINFO(fastfont.mgabase) + (scr_readw(s++) & p->charmask)*charcell; + + mga_fifo(4); + mga_outl(M_FXBNDRY, ((xx + fontwidth(p) - 1) << 16) | xx); + mga_outl(M_AR3, ar3); + mga_outl(M_AR0, (ar3 + charcell - 1) & 0x0003FFFF); + mga_ydstlen(yy, fontheight(p)); + xx += fontwidth(p); + } + WaitTillIdle(); + + CRITEND +} + +static void matrox_cfbX_putcs(u_int32_t fgx, u_int32_t bgx, struct display* p, const unsigned short* s, int count, int yy, int xx) { + u_int32_t step; + u_int32_t ydstlen; + u_int32_t xlen; + u_int32_t ar0; + u_int32_t charcell; + u_int32_t fxbndry; + vaddr_t mmio; + int easy; + CRITFLAGS + MINFO_FROM_DISP(p); + + DBG_HEAVY("matroxfb_cfbX_putcs"); + + yy *= fontheight(p); + xx *= fontwidth(p); + if (fontwidth(p) <= 8) + step = 1; + else if (fontwidth(p) <= 16) + step = 2; + else + step = 4; + charcell = fontheight(p)*step; + xlen = (charcell + 3) & ~3; + ydstlen = (yy << 16) | fontheight(p); + if (fontwidth(p) == step << 3) { + ar0 = fontheight(p)*fontwidth(p) - 1; + easy = 1; + } else { + ar0 = fontwidth(p) - 1; + easy = 0; + } + + CRITBEGIN + +#ifdef __BIG_ENDIAN + WaitTillIdle(); + mga_outl(M_OPMODE, M_OPMODE_8BPP); +#else + mga_fifo(3); +#endif + if (easy) + mga_outl(M_DWGCTL, M_DWG_ILOAD | M_DWG_SGNZERO | M_DWG_SHIFTZERO | M_DWG_BMONOWF | M_DWG_LINEAR | M_DWG_REPLACE); + else + mga_outl(M_DWGCTL, M_DWG_ILOAD | M_DWG_SGNZERO | M_DWG_SHIFTZERO | M_DWG_BMONOWF | M_DWG_REPLACE); + mga_outl(M_FCOL, fgx); + mga_outl(M_BCOL, bgx); + fxbndry = ((xx + fontwidth(p) - 1) << 16) | xx; + mmio = ACCESS_FBINFO(mmio.vbase); + while (count--) { + u_int8_t* chardata = p->fontdata + (scr_readw(s++) & p->charmask)*charcell; + + mga_fifo(6); + mga_writel(mmio, M_FXBNDRY, fxbndry); + mga_writel(mmio, M_AR0, ar0); + mga_writel(mmio, M_AR3, 0); + if (easy) { + mga_writel(mmio, M_YDSTLEN | M_EXEC, ydstlen); + mga_memcpy_toio(mmio, 0, chardata, xlen); + } else { + mga_writel(mmio, M_AR5, 0); + mga_writel(mmio, M_YDSTLEN | M_EXEC, ydstlen); + switch (step) { + case 1: { + u_int8_t* charend = chardata + charcell; + for (; chardata != charend; chardata++) { +#ifdef __LITTLE_ENDIAN + mga_writel(mmio, 0, *chardata); +#else + mga_writel(mmio, 0, (*chardata) << 24); +#endif + } + } + break; + case 2: { + u_int8_t* charend = chardata + charcell; + for (; chardata != charend; chardata += 2) { +#ifdef __LITTLE_ENDIAN + mga_writel(mmio, 0, *(u_int16_t*)chardata); +#else + mga_writel(mmio, 0, (*(u_int16_t*)chardata) << 16); +#endif + } + } + break; + default: + mga_memcpy_toio(mmio, 0, chardata, charcell); + break; + } + } + fxbndry += fontwidth(p) + (fontwidth(p) << 16); + } + WaitTillIdle(); +#ifdef __BIG_ENDIAN + mga_outl(M_OPMODE, ACCESS_FBINFO(accel.m_opmode)); +#endif + CRITEND +} + +#ifdef FBCON_HAS_CFB8 +static void matrox_cfb8_putcs(struct vc_data* conp, struct display* p, const unsigned short* s, int count, int yy, int xx) { + u_int32_t fgx, bgx; + MINFO_FROM_DISP(p); + + DBG_HEAVY("matroxfb_cfb8_putcs"); + + fgx = attr_fgcol(p, scr_readw(s)); + bgx = attr_bgcol(p, scr_readw(s)); + fgx |= (fgx << 8); + fgx |= (fgx << 16); + bgx |= (bgx << 8); + bgx |= (bgx << 16); + ACCESS_FBINFO(curr.putcs)(fgx, bgx, p, s, count, yy, xx); +} +#endif + +#ifdef FBCON_HAS_CFB16 +static void matrox_cfb16_putcs(struct vc_data* conp, struct display* p, const unsigned short* s, int count, int yy, int xx) { + u_int32_t fgx, bgx; + MINFO_FROM_DISP(p); + + DBG_HEAVY("matroxfb_cfb16_putcs"); + + fgx = ((u_int16_t*)p->dispsw_data)[attr_fgcol(p, scr_readw(s))]; + bgx = ((u_int16_t*)p->dispsw_data)[attr_bgcol(p, scr_readw(s))]; + fgx |= (fgx << 16); + bgx |= (bgx << 16); + ACCESS_FBINFO(curr.putcs)(fgx, bgx, p, s, count, yy, xx); +} +#endif + +#if defined(FBCON_HAS_CFB32) || defined(FBCON_HAS_CFB24) +static void matrox_cfb32_putcs(struct vc_data* conp, struct display* p, const unsigned short* s, int count, int yy, int xx) { + u_int32_t fgx, bgx; + MINFO_FROM_DISP(p); + + DBG_HEAVY("matroxfb_cfb32_putcs"); + + fgx = ((u_int32_t*)p->dispsw_data)[attr_fgcol(p, scr_readw(s))]; + bgx = ((u_int32_t*)p->dispsw_data)[attr_bgcol(p, scr_readw(s))]; + ACCESS_FBINFO(curr.putcs)(fgx, bgx, p, s, count, yy, xx); +} +#endif + +#ifdef FBCON_HAS_CFB4 +static void matrox_cfb4_revc(struct display* p, int xx, int yy) { + CRITFLAGS + MINFO_FROM_DISP(p); + + DBG_LOOP("matroxfb_cfb4_revc"); + + if (fontwidth(p) & 1) { + fbcon_cfb4_revc(p, xx, yy); + return; + } + yy *= fontheight(p); + xx *= fontwidth(p); + xx |= (xx + fontwidth(p)) << 16; + xx >>= 1; + + CRITBEGIN + + mga_fifo(5); + mga_outl(M_DWGCTL, ACCESS_FBINFO(accel.m_dwg_rect) | M_DWG_XOR); + mga_outl(M_FCOL, 0xFFFFFFFF); + mga_outl(M_FXBNDRY, xx); + mga_outl(M_YDST, yy * p->var.xres_virtual >> 6); + mga_outl(M_LEN | M_EXEC, fontheight(p)); + WaitTillIdle(); + + CRITEND +} +#endif + +#ifdef FBCON_HAS_CFB8 +static void matrox_cfb8_revc(struct display* p, int xx, int yy) { + CRITFLAGS + MINFO_FROM_DISP(p); + + DBG_LOOP("matrox_cfb8_revc") + + yy *= fontheight(p); + xx *= fontwidth(p); + + CRITBEGIN + + mga_fifo(4); + mga_outl(M_DWGCTL, ACCESS_FBINFO(accel.m_dwg_rect) | M_DWG_XOR); + mga_outl(M_FCOL, 0x0F0F0F0F); + mga_outl(M_FXBNDRY, ((xx + fontwidth(p)) << 16) | xx); + mga_ydstlen(yy, fontheight(p)); + WaitTillIdle(); + + CRITEND +} +#endif + +static void matrox_cfbX_revc(struct display* p, int xx, int yy) { + CRITFLAGS + MINFO_FROM_DISP(p); + + DBG_LOOP("matrox_cfbX_revc") + + yy *= fontheight(p); + xx *= fontwidth(p); + + CRITBEGIN + + mga_fifo(4); + mga_outl(M_DWGCTL, ACCESS_FBINFO(accel.m_dwg_rect) | M_DWG_XOR); + mga_outl(M_FCOL, 0xFFFFFFFF); + mga_outl(M_FXBNDRY, ((xx + fontwidth(p)) << 16) | xx); + mga_ydstlen(yy, fontheight(p)); + WaitTillIdle(); + + CRITEND +} + +static void matrox_cfbX_clear_margins(struct vc_data* conp, struct display* p, int bottom_only) { + unsigned int bottom_height, right_width; + unsigned int bottom_start, right_start; + unsigned int cell_h, cell_w; + + DBG("matrox_cfbX_clear_margins") + + cell_w = fontwidth(p); + if (!cell_w) return; /* PARANOID */ + right_width = p->var.xres % cell_w; + right_start = p->var.xres - right_width; + if (!bottom_only && right_width) { + /* clear whole right margin, not only visible portion */ + matroxfb_accel_clear( PMXINFO(p) + /* color */ 0x00000000, + /* y */ 0, + /* x */ p->var.xoffset + right_start, + /* height */ p->var.yres_virtual, + /* width */ right_width); + } + cell_h = fontheight(p); + if (!cell_h) return; /* PARANOID */ + bottom_height = p->var.yres % cell_h; + if (bottom_height) { + bottom_start = p->var.yres - bottom_height; + matroxfb_accel_clear( PMXINFO(p) + /* color */ 0x00000000, + /* y */ p->var.yoffset + bottom_start, + /* x */ p->var.xoffset, + /* height */ bottom_height, + /* width */ right_start); + } +} + +static void matrox_text_setup(struct display* p) { + MINFO_FROM_DISP(p); + + p->next_line = p->line_length ? p->line_length : ((p->var.xres_virtual / (fontwidth(p)?fontwidth(p):8)) * ACCESS_FBINFO(devflags.textstep)); + p->next_plane = 0; +} + +static void matrox_text_bmove(struct display* p, int sy, int sx, int dy, int dx, + int height, int width) { + unsigned int srcoff; + unsigned int dstoff; + unsigned int step; + CRITFLAGS + MINFO_FROM_DISP(p); + + CRITBEGIN + + step = ACCESS_FBINFO(devflags.textstep); + srcoff = (sy * p->next_line) + (sx * step); + dstoff = (dy * p->next_line) + (dx * step); + if (dstoff < srcoff) { + while (height > 0) { + int i; + for (i = width; i > 0; dstoff += step, srcoff += step, i--) + mga_writew(ACCESS_FBINFO(video.vbase), dstoff, mga_readw(ACCESS_FBINFO(video.vbase), srcoff)); + height--; + dstoff += p->next_line - width * step; + srcoff += p->next_line - width * step; + } + } else { + unsigned int off; + + off = (height - 1) * p->next_line + (width - 1) * step; + srcoff += off; + dstoff += off; + while (height > 0) { + int i; + for (i = width; i > 0; dstoff -= step, srcoff -= step, i--) + mga_writew(ACCESS_FBINFO(video.vbase), dstoff, mga_readw(ACCESS_FBINFO(video.vbase), srcoff)); + dstoff -= p->next_line - width * step; + srcoff -= p->next_line - width * step; + height--; + } + } + CRITEND +} + +static void matrox_text_clear(struct vc_data* conp, struct display* p, int sy, int sx, + int height, int width) { + unsigned int offs; + unsigned int val; + unsigned int step; + CRITFLAGS + MINFO_FROM_DISP(p); + + step = ACCESS_FBINFO(devflags.textstep); + offs = sy * p->next_line + sx * step; + val = ntohs((attr_bgcol(p, conp->vc_video_erase_char) << 4) | attr_fgcol(p, conp->vc_video_erase_char) | (' ' << 8)); + + CRITBEGIN + + while (height > 0) { + int i; + for (i = width; i > 0; offs += step, i--) + mga_writew(ACCESS_FBINFO(video.vbase), offs, val); + offs += p->next_line - width * step; + height--; + } + CRITEND +} + +static void matrox_text_putc(struct vc_data* conp, struct display* p, int c, int yy, int xx) { + unsigned int offs; + unsigned int chr; + unsigned int step; + CRITFLAGS + MINFO_FROM_DISP(p); + + step = ACCESS_FBINFO(devflags.textstep); + offs = yy * p->next_line + xx * step; + chr = attr_fgcol(p,c) | (attr_bgcol(p,c) << 4) | ((c & p->charmask) << 8); + if (chr & 0x10000) chr |= 0x08; + + CRITBEGIN + + mga_writew(ACCESS_FBINFO(video.vbase), offs, ntohs(chr)); + + CRITEND +} + +static void matrox_text_putcs(struct vc_data* conp, struct display* p, const unsigned short* s, + int count, int yy, int xx) { + unsigned int offs; + unsigned int attr; + unsigned int step; + CRITFLAGS + MINFO_FROM_DISP(p); + + step = ACCESS_FBINFO(devflags.textstep); + offs = yy * p->next_line + xx * step; + attr = attr_fgcol(p, scr_readw(s)) | (attr_bgcol(p, scr_readw(s)) << 4); + + CRITBEGIN + + while (count-- > 0) { + unsigned int chr = ((scr_readw(s++)) & p->charmask) << 8; + if (chr & 0x10000) chr ^= 0x10008; + mga_writew(ACCESS_FBINFO(video.vbase), offs, ntohs(attr|chr)); + offs += step; + } + + CRITEND +} + +static void matrox_text_revc(struct display* p, int xx, int yy) { + unsigned int offs; + unsigned int step; + CRITFLAGS + MINFO_FROM_DISP(p); + + step = ACCESS_FBINFO(devflags.textstep); + offs = yy * p->next_line + xx * step + 1; + + CRITBEGIN + + mga_writeb(ACCESS_FBINFO(video.vbase), offs, mga_readb(ACCESS_FBINFO(video.vbase), offs) ^ 0x77); + + CRITEND +} + +void matrox_text_createcursor(WPMINFO struct display* p) { + CRITFLAGS + + if (ACCESS_FBINFO(currcon_display) != p) + return; + + matroxfb_createcursorshape(PMINFO p, 0); + + CRITBEGIN + + mga_setr(M_CRTC_INDEX, 0x0A, ACCESS_FBINFO(cursor.u)); + mga_setr(M_CRTC_INDEX, 0x0B, ACCESS_FBINFO(cursor.d) - 1); + + CRITEND +} + +static void matrox_text_cursor(struct display* p, int mode, int x, int y) { + unsigned int pos; + CRITFLAGS + MINFO_FROM_DISP(p); + + if (ACCESS_FBINFO(currcon_display) != p) + return; + + if (mode == CM_ERASE) { + if (ACCESS_FBINFO(cursor.state) != CM_ERASE) { + + CRITBEGIN + + mga_setr(M_CRTC_INDEX, 0x0A, 0x20); + + CRITEND + + ACCESS_FBINFO(cursor.state) = CM_ERASE; + } + return; + } + if ((p->conp->vc_cursor_type & CUR_HWMASK) != ACCESS_FBINFO(cursor.type)) + matrox_text_createcursor(PMINFO p); + + /* DO NOT CHECK cursor.x != x because of matroxfb_vgaHWinit moves cursor to 0,0 */ + ACCESS_FBINFO(cursor.x) = x; + ACCESS_FBINFO(cursor.y) = y; + pos = p->next_line / ACCESS_FBINFO(devflags.textstep) * y + x; + + CRITBEGIN + + mga_setr(M_CRTC_INDEX, 0x0F, pos); + mga_setr(M_CRTC_INDEX, 0x0E, pos >> 8); + + mga_setr(M_CRTC_INDEX, 0x0A, ACCESS_FBINFO(cursor.u)); + + CRITEND + + ACCESS_FBINFO(cursor.state) = CM_DRAW; +} + +void matrox_text_round(CPMINFO struct fb_var_screeninfo* var, struct display* p) { + unsigned hf; + unsigned vf; + unsigned vxres; + unsigned ych; + + hf = fontwidth(p); + if (!hf) hf = 8; + /* do not touch xres */ + vxres = (var->xres_virtual + hf - 1) / hf; + if (vxres >= 256) + vxres = 255; + if (vxres < 16) + vxres = 16; + vxres = (vxres + 1) & ~1; /* must be even */ + vf = fontheight(p); + if (!vf) vf = 16; + if (var->yres < var->yres_virtual) { + ych = ACCESS_FBINFO(devflags.textvram) / vxres; + var->yres_virtual = ych * vf; + } else + ych = var->yres_virtual / vf; + if (vxres * ych > ACCESS_FBINFO(devflags.textvram)) { + ych = ACCESS_FBINFO(devflags.textvram) / vxres; + var->yres_virtual = ych * vf; + } + var->xres_virtual = vxres * hf; +} + +static int matrox_text_setfont(struct display* p, int width, int height) { + DBG("matrox_text_setfont"); + + if (p) { + MINFO_FROM_DISP(p); + + matrox_text_round(PMINFO &p->var, p); + p->next_line = p->line_length = ((p->var.xres_virtual / (fontwidth(p)?fontwidth(p):8)) * ACCESS_FBINFO(devflags.textstep)); + + if (p->conp) + matrox_text_createcursor(PMINFO p); + } + return 0; +} + +#define matrox_cfb16_revc matrox_cfbX_revc +#define matrox_cfb24_revc matrox_cfbX_revc +#define matrox_cfb32_revc matrox_cfbX_revc + +#define matrox_cfb24_clear matrox_cfb32_clear +#define matrox_cfb24_putc matrox_cfb32_putc +#define matrox_cfb24_putcs matrox_cfb32_putcs + +#ifdef FBCON_HAS_VGATEXT +static struct display_switch matroxfb_text = { + matrox_text_setup, matrox_text_bmove, matrox_text_clear, + matrox_text_putc, matrox_text_putcs, matrox_text_revc, + matrox_text_cursor, matrox_text_setfont, NULL, + FONTWIDTH(8)|FONTWIDTH(9) +}; +#endif + +#ifdef FBCON_HAS_CFB4 +static struct display_switch matroxfb_cfb4 = { + fbcon_cfb4_setup, matrox_cfb4_bmove, matrox_cfb4_clear, + fbcon_cfb4_putc, fbcon_cfb4_putcs, matrox_cfb4_revc, + NULL, NULL, NULL, + /* cursor... */ /* set_font... */ + FONTWIDTH(8) /* fix, fix, fix it */ +}; +#endif + +#ifdef FBCON_HAS_CFB8 +static struct display_switch matroxfb_cfb8 = { + fbcon_cfb8_setup, matrox_cfbX_bmove, matrox_cfb8_clear, + matrox_cfb8_putc, matrox_cfb8_putcs, matrox_cfb8_revc, + NULL, NULL, matrox_cfbX_clear_margins, + ~1 /* FONTWIDTHS */ +}; +#endif + +#ifdef FBCON_HAS_CFB16 +static struct display_switch matroxfb_cfb16 = { + fbcon_cfb16_setup, matrox_cfbX_bmove, matrox_cfb16_clear, + matrox_cfb16_putc, matrox_cfb16_putcs, matrox_cfb16_revc, + NULL, NULL, matrox_cfbX_clear_margins, + ~1 /* FONTWIDTHS */ +}; +#endif + +#ifdef FBCON_HAS_CFB24 +static struct display_switch matroxfb_cfb24 = { + fbcon_cfb24_setup, matrox_cfbX_bmove, matrox_cfb24_clear, + matrox_cfb24_putc, matrox_cfb24_putcs, matrox_cfb24_revc, + NULL, NULL, matrox_cfbX_clear_margins, + ~1 /* FONTWIDTHS */ /* TODO: and what about non-aligned access on BE? I think that there are no in my code */ +}; +#endif + +#ifdef FBCON_HAS_CFB32 +static struct display_switch matroxfb_cfb32 = { + fbcon_cfb32_setup, matrox_cfbX_bmove, matrox_cfb32_clear, + matrox_cfb32_putc, matrox_cfb32_putcs, matrox_cfb32_revc, + NULL, NULL, matrox_cfbX_clear_margins, + ~1 /* FONTWIDTHS */ +}; +#endif + +void initMatrox(WPMINFO struct display* p) { + struct display_switch *swtmp; + + DBG("initMatrox") + + if (ACCESS_FBINFO(currcon_display) != p) + return; + if (p->dispsw && p->conp) + fb_con.con_cursor(p->conp, CM_ERASE); + p->dispsw_data = NULL; + if ((p->var.accel_flags & FB_ACCELF_TEXT) != FB_ACCELF_TEXT) { + if (p->type == FB_TYPE_TEXT) { + swtmp = &matroxfb_text; + } else { + switch (p->var.bits_per_pixel) { +#ifdef FBCON_HAS_CFB4 + case 4: + swtmp = &fbcon_cfb4; + break; +#endif +#ifdef FBCON_HAS_CFB8 + case 8: + swtmp = &fbcon_cfb8; + break; +#endif +#ifdef FBCON_HAS_CFB16 + case 16: + p->dispsw_data = &ACCESS_FBINFO(cmap.cfb16); + swtmp = &fbcon_cfb16; + break; +#endif +#ifdef FBCON_HAS_CFB24 + case 24: + p->dispsw_data = &ACCESS_FBINFO(cmap.cfb24); + swtmp = &fbcon_cfb24; + break; +#endif +#ifdef FBCON_HAS_CFB32 + case 32: + p->dispsw_data = &ACCESS_FBINFO(cmap.cfb32); + swtmp = &fbcon_cfb32; + break; +#endif + default: + p->dispsw = &fbcon_dummy; + return; + } + } + dprintk(KERN_INFO "matroxfb: acceleration disabled\n"); + } else if (p->type == FB_TYPE_TEXT) { + swtmp = &matroxfb_text; + } else { + switch (p->var.bits_per_pixel) { +#ifdef FBCON_HAS_CFB4 + case 4: + swtmp = &matroxfb_cfb4; + break; +#endif +#ifdef FBCON_HAS_CFB8 + case 8: + swtmp = &matroxfb_cfb8; + break; +#endif +#ifdef FBCON_HAS_CFB16 + case 16: + p->dispsw_data = &ACCESS_FBINFO(cmap.cfb16); + swtmp = &matroxfb_cfb16; + break; +#endif +#ifdef FBCON_HAS_CFB24 + case 24: + p->dispsw_data = &ACCESS_FBINFO(cmap.cfb24); + swtmp = &matroxfb_cfb24; + break; +#endif +#ifdef FBCON_HAS_CFB32 + case 32: + p->dispsw_data = &ACCESS_FBINFO(cmap.cfb32); + swtmp = &matroxfb_cfb32; + break; +#endif + default: + p->dispsw = &fbcon_dummy; + return; + } + } + memcpy(&ACCESS_FBINFO(dispsw), swtmp, sizeof(ACCESS_FBINFO(dispsw))); + p->dispsw = &ACCESS_FBINFO(dispsw); + if ((p->type != FB_TYPE_TEXT) && ACCESS_FBINFO(devflags.hwcursor)) { + ACCESS_FBINFO(hw_switch)->selhwcursor(PMINFO p); + } +} + +void matrox_init_putc(WPMINFO struct display* p, void (*dac_createcursor)(WPMINFO struct display* p)) { + int i; + + if (p && p->conp) { + if (p->type == FB_TYPE_TEXT) { + matrox_text_createcursor(PMINFO p); + matrox_text_loadfont(PMINFO p); + i = 0; + } else { + dac_createcursor(PMINFO p); + i = matroxfb_fastfont_tryset(PMINFO p); + } + } else + i = 0; + if (i) { + ACCESS_FBINFO(curr.putc) = matrox_cfbX_fastputc; + ACCESS_FBINFO(curr.putcs) = matrox_cfbX_fastputcs; + } else { + ACCESS_FBINFO(curr.putc) = matrox_cfbX_putc; + ACCESS_FBINFO(curr.putcs) = matrox_cfbX_putcs; + } +} diff -uNr linux-2.2.16.SuSE/drivers/video/matrox/matroxfb_accel.h linux.compile/drivers/video/matrox/matroxfb_accel.h --- linux-2.2.16.SuSE/drivers/video/matrox/matroxfb_accel.h Thu Jan 1 01:00:00 1970 +++ linux.compile/drivers/video/matrox/matroxfb_accel.h Wed Jul 19 02:15:10 2000 @@ -0,0 +1,12 @@ +#ifndef __MATROXFB_ACCEL_H__ +#define __MATROXFB_ACCEL_H__ + +#include "matroxfb_base.h" + +void matrox_init_putc(WPMINFO struct display* p, void (*)(WPMINFO struct display *p)); +void matrox_cfbX_init(WPMINFO struct display* p); +void matrox_text_createcursor(WPMINFO struct display* p); +void matrox_text_round(CPMINFO struct fb_var_screeninfo* var, struct display* p); +void initMatrox(WPMINFO struct display* p); + +#endif diff -uNr linux-2.2.16.SuSE/drivers/video/matrox/matroxfb_base.c linux.compile/drivers/video/matrox/matroxfb_base.c --- linux-2.2.16.SuSE/drivers/video/matrox/matroxfb_base.c Thu Jan 1 01:00:00 1970 +++ linux.compile/drivers/video/matrox/matroxfb_base.c Wed Jul 19 22:15:54 2000 @@ -0,0 +1,2652 @@ +/* + * + * Hardware accelerated Matrox Millennium I, II, Mystique, G100, G200 and G400 + * + * (c) 1998,1999,2000 Petr Vandrovec + * + * Version: 1.21 1999/01/09 + * + * MTRR stuff: 1998 Tom Rini + * + * Contributors: "menion?" + * Betatesting, fixes, ideas + * + * "Kurt Garloff" + * Betatesting, fixes, ideas, videomodes, videomode timings + * 2.4.0t3 -> 2.2.17p10 backport + * + * "Tom Rini" + * MTRR stuff, PPC cleanups, betatesting, fixes, ideas + * + * "Bibek Sahu" + * Access device through readb|w|l and write b|w|l + * Extensive debugging stuff + * + * "Daniel Haun" + * Testing, hardware cursor fixes + * + * "Scott Wood" + * Fixes + * + * "Gerd Knorr" + * Betatesting + * + * "Kelly French" + * "Fernando Herrera" + * Betatesting, bug reporting + * + * "Pablo Bianucci" + * Fixes, ideas, betatesting + * + * "Inaky Perez Gonzalez" + * Fixes, enhandcements, ideas, betatesting + * + * "Ryuichi Oikawa" + * PPC betatesting, PPC support, backward compatibility + * + * "Paul Womar" + * "Owen Waller" + * PPC betatesting + * + * "Thomas Pornin" + * Alpha betatesting + * + * "Pieter van Leuven" + * "Ulf Jaenicke-Roessler" + * G100 testing + * + * "H. Peter Arvin" + * Ideas + * + * "Cort Dougan" + * CHRP fixes and PReP cleanup + * + * "Mark Vojkovich" + * G400 support + * + * "Samuel Hocevar" + * Fixes + * + * "Anton Altaparmakov" + * G400 MAX/non-MAX distinction + * + * (following author is not in any relation with this code, but his code + * is included in this driver) + * + * Based on framebuffer driver for VBE 2.0 compliant graphic boards + * (c) 1998 Gerd Knorr + * + * (following author is not in any relation with this code, but his ideas + * were used when writting this driver) + * + * FreeVBE/AF (Matrox), "Shawn Hargreaves" + * + */ + +/* make checkconfig does not check included files... */ +#include +#include + +#include "matroxfb_base.h" +#include "matroxfb_misc.h" +#include "matroxfb_accel.h" +#include "matroxfb_DAC1064.h" +#include "matroxfb_Ti3026.h" +#include "matroxfb_maven.h" +#include "matroxfb_crtc2.h" +#include +#include + +#if defined(CONFIG_FB_OF) +unsigned char nvram_read_byte(int); +static int default_vmode = VMODE_NVRAM; +static int default_cmode = CMODE_NVRAM; +#endif + +static void matroxfb_unregister_device(struct matrox_fb_info* minfo); + +/* --------------------------------------------------------------------- */ + +/* + * card parameters + */ + +/* --------------------------------------------------------------------- */ + +static struct fb_var_screeninfo vesafb_defined = { + 640,480,640,480,/* W,H, W, H (virtual) load xres,xres_virtual*/ + 0,0, /* virtual -> visible no offset */ + 8, /* depth -> load bits_per_pixel */ + 0, /* greyscale ? */ + {0,0,0}, /* R */ + {0,0,0}, /* G */ + {0,0,0}, /* B */ + {0,0,0}, /* transparency */ + 0, /* standard pixel format */ + FB_ACTIVATE_NOW, + -1,-1, + FB_ACCELF_TEXT, /* accel flags */ + 39721L,48L,16L,33L,10L, + 96L,2L,~0, /* No sync info */ + FB_VMODE_NONINTERLACED, + {0,0,0,0,0,0} +}; + + + +/* --------------------------------------------------------------------- */ + +static void matrox_pan_var(WPMINFO struct fb_var_screeninfo *var) { + unsigned int pos; + unsigned short p0, p1, p2; +#ifdef CONFIG_FB_MATROX_32MB + unsigned int p3; +#endif + struct display *disp; + CRITFLAGS + + DBG("matrox_pan_var") + + if (ACCESS_FBINFO(dead)) + return; + + disp = ACCESS_FBINFO(currcon_display); + if (disp->type == FB_TYPE_TEXT) { + pos = var->yoffset / fontheight(disp) * disp->next_line / ACCESS_FBINFO(devflags.textstep) + var->xoffset / (fontwidth(disp)?fontwidth(disp):8); + } else { + pos = (var->yoffset * var->xres_virtual + var->xoffset) * ACCESS_FBINFO(curr.final_bppShift) / 32; + pos += ACCESS_FBINFO(curr.ydstorg.chunks); + } + p0 = ACCESS_FBINFO(currenthw)->CRTC[0x0D] = pos & 0xFF; + p1 = ACCESS_FBINFO(currenthw)->CRTC[0x0C] = (pos & 0xFF00) >> 8; + p2 = ACCESS_FBINFO(currenthw)->CRTCEXT[0] = (ACCESS_FBINFO(currenthw)->CRTCEXT[0] & 0xB0) | ((pos >> 16) & 0x0F) | ((pos >> 14) & 0x40); +#ifdef CONFIG_FB_MATROX_32MB + p3 = ACCESS_FBINFO(currenthw)->CRTCEXT[8] = pos >> 21; +#endif + + CRITBEGIN + + mga_setr(M_CRTC_INDEX, 0x0D, p0); + mga_setr(M_CRTC_INDEX, 0x0C, p1); +#ifdef CONFIG_FB_MATROX_32MB + if (ACCESS_FBINFO(devflags.support32MB)) + mga_setr(M_EXTVGA_INDEX, 0x08, p3); +#endif + mga_setr(M_EXTVGA_INDEX, 0x00, p2); + + CRITEND +} + +static void matroxfb_remove(WPMINFO int dummy) { + /* Currently we are holding big kernel lock on all dead & usecount updates. + * Destroy everything after all users release it. Especially do not unregister + * framebuffer and iounmap memory, neither fbmem nor fbcon-cfb* does not check + * for device unplugged when in use. + * In future we should point mmio.vbase & video.vbase somewhere where we can + * write data without causing too much damage... + */ + + ACCESS_FBINFO(dead) = 1; + if (ACCESS_FBINFO(usecount)) { + /* destroy it later */ + return; + } + matroxfb_unregister_device(MINFO); + unregister_framebuffer(&ACCESS_FBINFO(fbcon)); + del_timer_sync(&ACCESS_FBINFO(cursor.timer)); +#ifdef CONFIG_MTRR + if (ACCESS_FBINFO(mtrr.vram_valid)) + mtrr_del(ACCESS_FBINFO(mtrr.vram), ACCESS_FBINFO(video.base), ACCESS_FBINFO(video.len)); +#endif + mga_iounmap(ACCESS_FBINFO(mmio.vbase)); + mga_iounmap(ACCESS_FBINFO(video.vbase)); + release_mem_region(ACCESS_FBINFO(video.base), ACCESS_FBINFO(video.len_maximum)); + release_mem_region(ACCESS_FBINFO(mmio.base), 16384); +#ifdef CONFIG_FB_MATROX_MULTIHEAD + kfree_s(ACCESS_FBINFO(fbcon.disp), sizeof(struct display)); + kfree_s(minfo, sizeof(struct matrox_fb_info)); +#endif +} + + /* + * Open/Release the frame buffer device + */ + +static int matroxfb_open(struct fb_info *info, int user) +{ +#define minfo ((struct matrox_fb_info*)info) + DBG_LOOP("matroxfb_open") + + if (ACCESS_FBINFO(dead)) { + return -ENXIO; + } + ACCESS_FBINFO(usecount)++; +#undef minfo + return(0); +} + +static int matroxfb_release(struct fb_info *info, int user) +{ +#define minfo ((struct matrox_fb_info*)info) + DBG_LOOP("matroxfb_release") + + if (!(--ACCESS_FBINFO(usecount)) && ACCESS_FBINFO(dead)) { + matroxfb_remove(PMINFO 0); + } +#undef minfo + return(0); +} + +static int matroxfb_pan_display(struct fb_var_screeninfo *var, int con, + struct fb_info* info) { +#define minfo ((struct matrox_fb_info*)info) + + DBG("matroxfb_pan_display") + + if (var->vmode & FB_VMODE_YWRAP) { + if (var->yoffset < 0 || var->yoffset >= fb_display[con].var.yres_virtual || var->xoffset) + return -EINVAL; + } else { + if (var->xoffset+fb_display[con].var.xres > fb_display[con].var.xres_virtual || + var->yoffset+fb_display[con].var.yres > fb_display[con].var.yres_virtual) + return -EINVAL; + } + if (con == ACCESS_FBINFO(currcon)) + matrox_pan_var(PMINFO var); + fb_display[con].var.xoffset = var->xoffset; + fb_display[con].var.yoffset = var->yoffset; + if (var->vmode & FB_VMODE_YWRAP) + fb_display[con].var.vmode |= FB_VMODE_YWRAP; + else + fb_display[con].var.vmode &= ~FB_VMODE_YWRAP; + return 0; +#undef minfo +} + +static int matroxfb_updatevar(int con, struct fb_info *info) +{ +#define minfo ((struct matrox_fb_info*)info) + DBG("matroxfb_updatevar"); + + matrox_pan_var(PMINFO &fb_display[con].var); + return 0; +#undef minfo +} + +static int matroxfb_get_final_bppShift(CPMINFO int bpp) { + int bppshft2; + + DBG("matroxfb_get_final_bppShift") + + bppshft2 = bpp; + if (!bppshft2) { + return 8; + } + if (isInterleave(MINFO)) + bppshft2 >>= 1; + if (ACCESS_FBINFO(devflags.video64bits)) + bppshft2 >>= 1; + return bppshft2; +} + +static int matroxfb_test_and_set_rounding(CPMINFO int xres, int bpp) { + int over; + int rounding; + + DBG("matroxfb_test_and_set_rounding") + + switch (bpp) { + case 0: return xres; + case 4: rounding = 128; + break; + case 8: rounding = 64; /* doc says 64; 32 is OK for G400 */ + break; + case 16: rounding = 32; + break; + case 24: rounding = 64; /* doc says 64; 32 is OK for G400 */ + break; + default: rounding = 16; + /* on G400, 16 really does not work */ + if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG400) + rounding = 32; + break; + } + if (isInterleave(MINFO)) { + rounding *= 2; + } + over = xres % rounding; + if (over) + xres += rounding-over; + return xres; +} + +static int matroxfb_pitch_adjust(CPMINFO int xres, int bpp) { + const int* width; + int xres_new; + + DBG("matroxfb_pitch_adjust") + + if (!bpp) return xres; + + width = ACCESS_FBINFO(capable.vxres); + + if (ACCESS_FBINFO(devflags.precise_width)) { + while (*width) { + if ((*width >= xres) && (matroxfb_test_and_set_rounding(PMINFO *width, bpp) == *width)) { + break; + } + width++; + } + xres_new = *width; + } else { + xres_new = matroxfb_test_and_set_rounding(PMINFO xres, bpp); + } + if (!xres_new) return 0; + if (xres != xres_new) { + printk(KERN_INFO "matroxfb: cannot set xres to %d, rounded up to %d\n", xres, xres_new); + } + return xres_new; +} + +static int matroxfb_get_cmap_len(struct fb_var_screeninfo *var) { + + DBG("matroxfb_get_cmap_len") + + switch (var->bits_per_pixel) { +#ifdef FBCON_HAS_VGATEXT + case 0: + return 16; /* pseudocolor... 16 entries HW palette */ +#endif +#ifdef FBCON_HAS_CFB4 + case 4: + return 16; /* pseudocolor... 16 entries HW palette */ +#endif +#ifdef FBCON_HAS_CFB8 + case 8: + return 256; /* pseudocolor... 256 entries HW palette */ +#endif +#ifdef FBCON_HAS_CFB16 + case 16: + return 16; /* directcolor... 16 entries SW palette */ + /* Mystique: truecolor, 16 entries SW palette, HW palette hardwired into 1:1 mapping */ +#endif +#ifdef FBCON_HAS_CFB24 + case 24: + return 16; /* directcolor... 16 entries SW palette */ + /* Mystique: truecolor, 16 entries SW palette, HW palette hardwired into 1:1 mapping */ +#endif +#ifdef FBCON_HAS_CFB32 + case 32: + return 16; /* directcolor... 16 entries SW palette */ + /* Mystique: truecolor, 16 entries SW palette, HW palette hardwired into 1:1 mapping */ +#endif + } + return 16; /* return something reasonable... or panic()? */ +} + +static int matroxfb_decode_var(CPMINFO struct display* p, struct fb_var_screeninfo *var, int *visual, int *video_cmap_len, unsigned int* ydstorg) { + unsigned int vramlen; + unsigned int memlen; + + DBG("matroxfb_decode_var") + + switch (var->bits_per_pixel) { +#ifdef FBCON_HAS_VGATEXT + case 0: if (!ACCESS_FBINFO(capable.text)) return -EINVAL; + break; +#endif +#ifdef FBCON_HAS_CFB4 + case 4: if (!ACCESS_FBINFO(capable.cfb4)) return -EINVAL; + break; +#endif +#ifdef FBCON_HAS_CFB8 + case 8: break; +#endif +#ifdef FBCON_HAS_CFB16 + case 16: break; +#endif +#ifdef FBCON_HAS_CFB24 + case 24: break; +#endif +#ifdef FBCON_HAS_CFB32 + case 32: break; +#endif + default: return -EINVAL; + } + *ydstorg = 0; + vramlen = ACCESS_FBINFO(video.len_usable); + if (var->yres_virtual < var->yres) + var->yres_virtual = var->yres; + if (var->xres_virtual < var->xres) + var->xres_virtual = var->xres; + if (var->bits_per_pixel) { + var->xres_virtual = matroxfb_pitch_adjust(PMINFO var->xres_virtual, var->bits_per_pixel); + memlen = var->xres_virtual * var->bits_per_pixel * var->yres_virtual / 8; + if (memlen > vramlen) { + var->yres_virtual = vramlen * 8 / (var->xres_virtual * var->bits_per_pixel); + memlen = var->xres_virtual * var->bits_per_pixel * var->yres_virtual / 8; + } + /* There is hardware bug that no line can cross 4MB boundary */ + /* give up for CFB24, it is impossible to easy workaround it */ + /* for other try to do something */ + if (!ACCESS_FBINFO(capable.cross4MB) && (memlen > 0x400000)) { + if (var->bits_per_pixel == 24) { + /* sorry */ + } else { + unsigned int linelen; + unsigned int m1 = linelen = var->xres_virtual * var->bits_per_pixel / 8; + unsigned int m2 = PAGE_SIZE; /* or 128 if you do not need PAGE ALIGNED address */ + unsigned int max_yres; + + while (m1) { + int t; + + while (m2 >= m1) m2 -= m1; + t = m1; + m1 = m2; + m2 = t; + } + m2 = linelen * PAGE_SIZE / m2; + *ydstorg = m2 = 0x400000 % m2; + max_yres = (vramlen - m2) / linelen; + if (var->yres_virtual > max_yres) + var->yres_virtual = max_yres; + } + } + } else { + matrox_text_round(PMINFO var, p); +#if 0 +/* we must limit pixclock by mclk... + Millennium I: 66 MHz = 15000 + Millennium II: 61 MHz = 16300 + Millennium G200: 83 MHz = 12000 */ + if (var->pixclock < 15000) + var->pixclock = 15000; /* limit for "normal" gclk & mclk */ +#endif + } + /* YDSTLEN contains only signed 16bit value */ + if (var->yres_virtual > 32767) + var->yres_virtual = 32767; + /* we must round yres/xres down, we already rounded y/xres_virtual up + if it was possible. We should return -EINVAL, but I disagree */ + if (var->yres_virtual < var->yres) + var->yres = var->yres_virtual; + if (var->xres_virtual < var->xres) + var->xres = var->xres_virtual; + if (var->xoffset + var->xres > var->xres_virtual) + var->xoffset = var->xres_virtual - var->xres; + if (var->yoffset + var->yres > var->yres_virtual) + var->yoffset = var->yres_virtual - var->yres; + + if (var->bits_per_pixel == 0) { + var->red.offset = 0; + var->red.length = 6; + var->green.offset = 0; + var->green.length = 6; + var->blue.offset = 0; + var->blue.length = 6; + var->transp.offset = 0; + var->transp.length = 0; + *visual = MX_VISUAL_PSEUDOCOLOR; + } else if (var->bits_per_pixel == 4) { + var->red.offset = 0; + var->red.length = 8; + var->green.offset = 0; + var->green.length = 8; + var->blue.offset = 0; + var->blue.length = 8; + var->transp.offset = 0; + var->transp.length = 0; + *visual = MX_VISUAL_PSEUDOCOLOR; + } else if (var->bits_per_pixel <= 8) { + var->red.offset = 0; + var->red.length = 8; + var->green.offset = 0; + var->green.length = 8; + var->blue.offset = 0; + var->blue.length = 8; + var->transp.offset = 0; + var->transp.length = 0; + *visual = MX_VISUAL_PSEUDOCOLOR; + } else { + if (var->bits_per_pixel <= 16) { + if (var->green.length == 5) { + var->red.offset = 10; + var->red.length = 5; + var->green.offset = 5; + var->green.length = 5; + var->blue.offset = 0; + var->blue.length = 5; + var->transp.offset = 15; + var->transp.length = 1; + } else { + var->red.offset = 11; + var->red.length = 5; + var->green.offset = 5; + var->green.length = 6; + var->blue.offset = 0; + var->blue.length = 5; + var->transp.offset = 0; + var->transp.length = 0; + } + } else if (var->bits_per_pixel <= 24) { + var->red.offset = 16; + var->red.length = 8; + var->green.offset = 8; + var->green.length = 8; + var->blue.offset = 0; + var->blue.length = 8; + var->transp.offset = 0; + var->transp.length = 0; + } else { + var->red.offset = 16; + var->red.length = 8; + var->green.offset = 8; + var->green.length = 8; + var->blue.offset = 0; + var->blue.length = 8; + var->transp.offset = 24; + var->transp.length = 8; + } + dprintk("matroxfb: truecolor: " + "size=%d:%d:%d:%d, shift=%d:%d:%d:%d\n", + var->transp.length, + var->red.length, + var->green.length, + var->blue.length, + var->transp.offset, + var->red.offset, + var->green.offset, + var->blue.offset); + *visual = MX_VISUAL_DIRECTCOLOR; + } + *video_cmap_len = matroxfb_get_cmap_len(var); + dprintk(KERN_INFO "requested %d*%d/%dbpp (%d*%d)\n", var->xres, var->yres, var->bits_per_pixel, + var->xres_virtual, var->yres_virtual); + return 0; +} + +static int matrox_setcolreg(unsigned regno, unsigned red, unsigned green, + unsigned blue, unsigned transp, + struct fb_info *fb_info) +{ + struct display* p; +#ifdef CONFIG_FB_MATROX_MULTIHEAD + struct matrox_fb_info* minfo = (struct matrox_fb_info*)fb_info; +#endif + + DBG("matrox_setcolreg") + + /* + * Set a single color register. The values supplied are + * already rounded down to the hardware's capabilities + * (according to the entries in the `var' structure). Return + * != 0 for invalid regno. + */ + + if (regno >= ACCESS_FBINFO(curr.cmap_len)) + return 1; + + ACCESS_FBINFO(palette[regno].red) = red; + ACCESS_FBINFO(palette[regno].green) = green; + ACCESS_FBINFO(palette[regno].blue) = blue; + ACCESS_FBINFO(palette[regno].transp) = transp; + + p = ACCESS_FBINFO(currcon_display); + if (p->var.grayscale) { + /* gray = 0.30*R + 0.59*G + 0.11*B */ + red = green = blue = (red * 77 + green * 151 + blue * 28) >> 8; + } + + red = CNVT_TOHW(red, p->var.red.length); + green = CNVT_TOHW(green, p->var.green.length); + blue = CNVT_TOHW(blue, p->var.blue.length); + transp = CNVT_TOHW(transp, p->var.transp.length); + + switch (p->var.bits_per_pixel) { +#if defined(FBCON_HAS_CFB8) || defined(FBCON_HAS_CFB4) || defined(FBCON_HAS_VGATEXT) +#ifdef FBCON_HAS_VGATEXT + case 0: +#endif +#ifdef FBCON_HAS_CFB4 + case 4: +#endif +#ifdef FBCON_HAS_CFB8 + case 8: +#endif + mga_outb(M_DAC_REG, regno); + mga_outb(M_DAC_VAL, red); + mga_outb(M_DAC_VAL, green); + mga_outb(M_DAC_VAL, blue); + break; +#endif +#ifdef FBCON_HAS_CFB16 + case 16: + ACCESS_FBINFO(cmap.cfb16[regno]) = + (red << p->var.red.offset) | + (green << p->var.green.offset) | + (blue << p->var.blue.offset) | + (transp << p->var.transp.offset); /* for 1:5:5:5 */ + break; +#endif +#ifdef FBCON_HAS_CFB24 + case 24: + ACCESS_FBINFO(cmap.cfb24[regno]) = + (red << p->var.red.offset) | + (green << p->var.green.offset) | + (blue << p->var.blue.offset); + break; +#endif +#ifdef FBCON_HAS_CFB32 + case 32: + ACCESS_FBINFO(cmap.cfb32[regno]) = + (red << p->var.red.offset) | + (green << p->var.green.offset) | + (blue << p->var.blue.offset) | + (transp << p->var.transp.offset); /* 8:8:8:8 */ + break; +#endif + } + return 0; +} + +static void do_install_cmap(WPMINFO struct display* dsp) +{ + DBG("do_install_cmap") + + if (dsp->cmap.len) + fb_set_cmap(&dsp->cmap, 1, matrox_setcolreg, &ACCESS_FBINFO(fbcon)); + else + fb_set_cmap(fb_default_cmap(ACCESS_FBINFO(curr.cmap_len)), + 1, matrox_setcolreg, &ACCESS_FBINFO(fbcon)); +} + +static int matroxfb_get_fix(struct fb_fix_screeninfo *fix, int con, + struct fb_info *info) +{ + struct display* p; + DBG("matroxfb_get_fix") + +#define minfo ((struct matrox_fb_info*)info) + + if (ACCESS_FBINFO(dead)) { + return -ENXIO; + } + + if (con >= 0) + p = fb_display + con; + else + p = ACCESS_FBINFO(fbcon.disp); + + memset(fix, 0, sizeof(struct fb_fix_screeninfo)); + strcpy(fix->id,"MATROX"); + + fix->smem_start = (char*) ACCESS_FBINFO(video.base) + ACCESS_FBINFO(curr.ydstorg.bytes); + fix->smem_len = ACCESS_FBINFO(video.len_usable) - ACCESS_FBINFO(curr.ydstorg.bytes); + fix->type = p->type; + fix->type_aux = p->type_aux; + fix->visual = p->visual; + fix->xpanstep = 8; /* 8 for 8bpp, 4 for 16bpp, 2 for 32bpp */ + fix->ypanstep = 1; + fix->ywrapstep = 0; + fix->line_length = p->line_length; + fix->mmio_start = (char*) ACCESS_FBINFO(mmio.base); + fix->mmio_len = ACCESS_FBINFO(mmio.len); + fix->accel = ACCESS_FBINFO(devflags.accelerator); + return 0; +#undef minfo +} + +static int matroxfb_get_var(struct fb_var_screeninfo *var, int con, + struct fb_info *info) +{ +#define minfo ((struct matrox_fb_info*)info) + DBG("matroxfb_get_var") + + if(con < 0) + *var=ACCESS_FBINFO(fbcon.disp)->var; + else + *var=fb_display[con].var; + return 0; +#undef minfo +} + +static int matroxfb_set_var(struct fb_var_screeninfo *var, int con, + struct fb_info *info) +{ +#define minfo ((struct matrox_fb_info*)info) + int err; + int visual; + int cmap_len; + unsigned int ydstorg; + struct display* display; + int chgvar; + + DBG("matroxfb_set_var") + + if (ACCESS_FBINFO(dead)) { + return -ENXIO; + } + + if (con >= 0) + display = fb_display + con; + else + display = ACCESS_FBINFO(fbcon.disp); + if ((err = matroxfb_decode_var(PMINFO display, var, &visual, &cmap_len, &ydstorg)) != 0) + return err; + switch (var->activate & FB_ACTIVATE_MASK) { + case FB_ACTIVATE_TEST: return 0; + case FB_ACTIVATE_NXTOPEN: /* ?? */ + case FB_ACTIVATE_NOW: break; /* continue */ + default: return -EINVAL; /* unknown */ + } + if (con >= 0) { + chgvar = ((display->var.xres != var->xres) || + (display->var.yres != var->yres) || + (display->var.xres_virtual != var->xres_virtual) || + (display->var.yres_virtual != var->yres_virtual) || + (display->var.bits_per_pixel != var->bits_per_pixel) || + memcmp(&display->var.red, &var->red, sizeof(var->red)) || + memcmp(&display->var.green, &var->green, sizeof(var->green)) || + memcmp(&display->var.blue, &var->blue, sizeof(var->blue))); + } else { + chgvar = 0; + } + display->var = *var; + /* cmap */ + display->screen_base = vaddr_va(ACCESS_FBINFO(video.vbase)) + ydstorg; + display->visual = visual; + display->ypanstep = 1; + display->ywrapstep = 0; + if (var->bits_per_pixel) { + display->type = FB_TYPE_PACKED_PIXELS; + display->type_aux = 0; + display->next_line = display->line_length = (var->xres_virtual * var->bits_per_pixel) >> 3; + } else { + display->type = FB_TYPE_TEXT; + display->type_aux = ACCESS_FBINFO(devflags.text_type_aux); + display->next_line = display->line_length = (var->xres_virtual / (fontwidth(display)?fontwidth(display):8)) * ACCESS_FBINFO(devflags.textstep); + } + display->can_soft_blank = 1; + display->inverse = ACCESS_FBINFO(devflags.inverse); + /* conp, fb_info, vrows, cursor_x, cursor_y, fgcol, bgcol */ + /* next_plane, fontdata, _font*, userfont */ + initMatrox(PMINFO display); /* dispsw */ + /* dispsw, scrollmode, yscroll */ + /* fgshift, bgshift, charmask */ + if (chgvar && info && info->changevar) + info->changevar(con); + if (con == ACCESS_FBINFO(currcon)) { + unsigned int pos; + + ACCESS_FBINFO(curr.cmap_len) = cmap_len; + if (display->type == FB_TYPE_TEXT) { + /* textmode must be in first megabyte, so no ydstorg allowed */ + ACCESS_FBINFO(curr.ydstorg.bytes) = 0; + ACCESS_FBINFO(curr.ydstorg.chunks) = 0; + ACCESS_FBINFO(curr.ydstorg.pixels) = 0; + } else { + ydstorg += ACCESS_FBINFO(devflags.ydstorg); + ACCESS_FBINFO(curr.ydstorg.bytes) = ydstorg; + ACCESS_FBINFO(curr.ydstorg.chunks) = ydstorg >> (isInterleave(MINFO)?3:2); + if (var->bits_per_pixel == 4) + ACCESS_FBINFO(curr.ydstorg.pixels) = ydstorg; + else + ACCESS_FBINFO(curr.ydstorg.pixels) = (ydstorg * 8) / var->bits_per_pixel; + } + ACCESS_FBINFO(curr.final_bppShift) = matroxfb_get_final_bppShift(PMINFO var->bits_per_pixel); + if (visual == MX_VISUAL_PSEUDOCOLOR) { + int i; + + for (i = 0; i < 16; i++) { + int j; + + j = color_table[i]; + ACCESS_FBINFO(palette[i].red) = default_red[j]; + ACCESS_FBINFO(palette[i].green) = default_grn[j]; + ACCESS_FBINFO(palette[i].blue) = default_blu[j]; + } + } + + { struct my_timming mt; + struct matrox_hw_state* hw; + struct matrox_hw_state* ohw; + + matroxfb_var2my(var, &mt); + /* CRTC1 delays */ + switch (var->bits_per_pixel) { + case 0: mt.delay = 31 + 0; break; + case 16: mt.delay = 21 + 8; break; + case 24: mt.delay = 17 + 8; break; + case 32: mt.delay = 16 + 8; break; + default: mt.delay = 31 + 8; break; + } + + hw = ACCESS_FBINFO(newhw); + ohw = ACCESS_FBINFO(currenthw); + + /* copy last setting... */ + memcpy(hw, ohw, sizeof(*hw)); + + del_timer_sync(&ACCESS_FBINFO(cursor.timer)); + ACCESS_FBINFO(cursor.state) = CM_ERASE; + + ACCESS_FBINFO(hw_switch->init(PMINFO hw, &mt, display)); + if (display->type == FB_TYPE_TEXT) { + if (fontheight(display)) + pos = var->yoffset / fontheight(display) * display->next_line / ACCESS_FBINFO(devflags.textstep) + var->xoffset / (fontwidth(display)?fontwidth(display):8); + else + pos = 0; + } else { + pos = (var->yoffset * var->xres_virtual + var->xoffset) * ACCESS_FBINFO(curr.final_bppShift) / 32; + pos += ACCESS_FBINFO(curr.ydstorg.chunks); + } + + hw->CRTC[0x0D] = pos & 0xFF; + hw->CRTC[0x0C] = (pos & 0xFF00) >> 8; + hw->CRTCEXT[0] = (hw->CRTCEXT[0] & 0xF0) | ((pos >> 16) & 0x0F) | ((pos >> 14) & 0x40); + hw->CRTCEXT[8] = pos >> 21; + if (ACCESS_FBINFO(output.ph) & (MATROXFB_OUTPUT_CONN_PRIMARY | MATROXFB_OUTPUT_CONN_DFP)) { + if (ACCESS_FBINFO(primout)) + ACCESS_FBINFO(primout)->compute(MINFO, &mt, hw); + } + if (ACCESS_FBINFO(output.ph) & MATROXFB_OUTPUT_CONN_SECONDARY) { + down_read(&ACCESS_FBINFO(altout.lock)); + if (ACCESS_FBINFO(altout.output)) + ACCESS_FBINFO(altout.output)->compute(ACCESS_FBINFO(altout.device), &mt, hw); + up_read(&ACCESS_FBINFO(altout.lock)); + } + ACCESS_FBINFO(hw_switch->restore(PMINFO hw, ohw, display)); + if (ACCESS_FBINFO(output.ph) & (MATROXFB_OUTPUT_CONN_PRIMARY | MATROXFB_OUTPUT_CONN_DFP)) { + if (ACCESS_FBINFO(primout)) + ACCESS_FBINFO(primout)->program(MINFO, hw); + } + if (ACCESS_FBINFO(output.ph) & MATROXFB_OUTPUT_CONN_SECONDARY) { + down_read(&ACCESS_FBINFO(altout.lock)); + if (ACCESS_FBINFO(altout.output)) + ACCESS_FBINFO(altout.output)->program(ACCESS_FBINFO(altout.device), hw); + up_read(&ACCESS_FBINFO(altout.lock)); + } + ACCESS_FBINFO(cursor.redraw) = 1; + ACCESS_FBINFO(currenthw) = hw; + ACCESS_FBINFO(newhw) = ohw; + if (ACCESS_FBINFO(output.ph) & (MATROXFB_OUTPUT_CONN_PRIMARY | MATROXFB_OUTPUT_CONN_DFP)) { + if (ACCESS_FBINFO(primout)) + ACCESS_FBINFO(primout)->start(MINFO); + } + if (ACCESS_FBINFO(output.ph) & MATROXFB_OUTPUT_CONN_SECONDARY) { + down_read(&ACCESS_FBINFO(altout.lock)); + if (ACCESS_FBINFO(altout.output)) + ACCESS_FBINFO(altout.output)->start(ACCESS_FBINFO(altout.device)); + up_read(&ACCESS_FBINFO(altout.lock)); + } + matrox_cfbX_init(PMINFO display); + do_install_cmap(PMINFO display); +#if defined(CONFIG_FB_COMPAT_XPMAC) + if (console_fb_info == &ACCESS_FBINFO(fbcon)) { + int vmode, cmode; + + display_info.width = var->xres; + display_info.height = var->yres; + display_info.depth = var->bits_per_pixel; + display_info.pitch = (var->xres_virtual)*(var->bits_per_pixel)/8; + if (mac_var_to_vmode(var, &vmode, &cmode)) + display_info.mode = 0; + else + display_info.mode = vmode; + strcpy(display_info.name, ACCESS_FBINFO(matrox_name)); + display_info.fb_address = ACCESS_FBINFO(video.base); + display_info.cmap_adr_address = 0; + display_info.cmap_data_address = 0; + display_info.disp_reg_address = ACCESS_FBINFO(mmio.base); + } +#endif /* CONFIG_FB_COMPAT_XPMAC */ + } + } + return 0; +#undef minfo +} + +static int matrox_getcolreg(unsigned regno, unsigned *red, unsigned *green, + unsigned *blue, unsigned *transp, + struct fb_info *info) +{ + + DBG("matrox_getcolreg") + +#define minfo ((struct matrox_fb_info*)info) + /* + * Read a single color register and split it into colors/transparent. + * Return != 0 for invalid regno. + */ + + if (regno >= ACCESS_FBINFO(curr.cmap_len)) + return 1; + + *red = ACCESS_FBINFO(palette[regno].red); + *green = ACCESS_FBINFO(palette[regno].green); + *blue = ACCESS_FBINFO(palette[regno].blue); + *transp = ACCESS_FBINFO(palette[regno].transp); + return 0; +#undef minfo +} + +static int matroxfb_get_cmap(struct fb_cmap *cmap, int kspc, int con, + struct fb_info *info) +{ +#define minfo ((struct matrox_fb_info*)info) + struct display* dsp = (con < 0) ? ACCESS_FBINFO(fbcon.disp) + : fb_display + con; + + DBG("matroxfb_get_cmap") + + if (ACCESS_FBINFO(dead)) { + return -ENXIO; + } + + if (con == ACCESS_FBINFO(currcon)) /* current console? */ + return fb_get_cmap(cmap, kspc, matrox_getcolreg, info); + else if (dsp->cmap.len) /* non default colormap? */ + fb_copy_cmap(&dsp->cmap, cmap, kspc ? 0 : 2); + else + fb_copy_cmap(fb_default_cmap(matroxfb_get_cmap_len(&dsp->var)), + cmap, kspc ? 0 : 2); + return 0; +#undef minfo +} + +static int matroxfb_set_cmap(struct fb_cmap *cmap, int kspc, int con, + struct fb_info *info) +{ + unsigned int cmap_len; + struct display* dsp = (con < 0) ? info->disp : (fb_display + con); +#define minfo ((struct matrox_fb_info*)info) + + DBG("matroxfb_set_cmap") + + if (ACCESS_FBINFO(dead)) { + return -ENXIO; + } + + cmap_len = matroxfb_get_cmap_len(&dsp->var); + if (dsp->cmap.len != cmap_len) { + int err; + + err = fb_alloc_cmap(&dsp->cmap, cmap_len, 0); + if (err) + return err; + } + if (con == ACCESS_FBINFO(currcon)) { /* current console? */ + return fb_set_cmap(cmap, kspc, matrox_setcolreg, info); + } else + fb_copy_cmap(cmap, &dsp->cmap, kspc ? 0 : 1); + return 0; +#undef minfo +} + +static int matroxfb_switch(int con, struct fb_info *info); + +static int matroxfb_get_vblank(CPMINFO struct fb_vblank *vblank) +{ + unsigned int sts1; + + memset(vblank, 0, sizeof(*vblank)); + vblank->flags = FB_VBLANK_HAVE_VCOUNT | FB_VBLANK_HAVE_VSYNC | + FB_VBLANK_HAVE_VBLANK | FB_VBLANK_HAVE_HBLANK; + sts1 = mga_inb(M_INSTS1); + vblank->vcount = mga_inl(M_VCOUNT); + /* BTW, on my PIII/450 with G400, reading M_INSTS1 + byte makes this call about 12% slower (1.70 vs. 2.05 us + per ioctl()) */ + if (sts1 & 1) + vblank->flags |= FB_VBLANK_HBLANKING; + if (sts1 & 8) + vblank->flags |= FB_VBLANK_VSYNCING; + if (vblank->count >= ACCESS_FBINFO(currcon_display)->var.yres) + vblank->flags |= FB_VBLANK_VBLANKING; + vblank->hcount = 0; + vblank->count = 0; + return 0; +} + +static int matroxfb_ioctl(struct inode *inode, struct file *file, + unsigned int cmd, unsigned long arg, int con, + struct fb_info *info) +{ +#define minfo ((struct matrox_fb_info*)info) + DBG("matroxfb_ioctl") + + if (ACCESS_FBINFO(dead)) { + return -ENXIO; + } + + switch (cmd) { + case FBIOGET_VBLANK: + { + struct fb_vblank vblank; + int err; + + err = matroxfb_get_vblank(PMINFO &vblank); + if (err) + return err; + copy_to_user_ret((struct fb_vblank*)arg, &vblank, sizeof(vblank), -EFAULT); + return 0; + } + case MATROXFB_SET_OUTPUT_MODE: + { + struct matroxioc_output_mode mom; + int val; + + copy_from_user_ret(&mom, (struct matroxioc_output_mode*)arg, sizeof(mom), -EFAULT); + if (mom.output >= sizeof(u_int32_t)) + return -EINVAL; + switch (mom.output) { + case MATROXFB_OUTPUT_PRIMARY: + if (mom.mode != MATROXFB_OUTPUT_MODE_MONITOR) + return -EINVAL; + /* mode did not change... */ + return 0; + case MATROXFB_OUTPUT_SECONDARY: + val = -EINVAL; + down_read(&ACCESS_FBINFO(altout.lock)); + if (ACCESS_FBINFO(altout.output) && ACCESS_FBINFO(altout.device)) + val = ACCESS_FBINFO(altout.output)->setmode(ACCESS_FBINFO(altout.device), mom.mode); + up_read(&ACCESS_FBINFO(altout.lock)); + if (val != 1) + return val; + if (ACCESS_FBINFO(output.ph) & MATROXFB_OUTPUT_CONN_SECONDARY) + matroxfb_switch(ACCESS_FBINFO(currcon), info); + if (ACCESS_FBINFO(output.sh) & MATROXFB_OUTPUT_CONN_SECONDARY) { + struct matroxfb_dh_fb_info* crtc2; + + down_read(&ACCESS_FBINFO(crtc2.lock)); + crtc2 = (struct matroxfb_dh_fb_info*)(ACCESS_FBINFO(crtc2.info)); + if (crtc2) + crtc2->fbcon.switch_con(crtc2->currcon, &crtc2->fbcon); + up_read(&ACCESS_FBINFO(crtc2.lock)); + } + return 0; + case MATROXFB_OUTPUT_DFP: + if (!(ACCESS_FBINFO(output.all) & MATROXFB_OUTPUT_CONN_DFP)) + return -ENXIO; + if (mom.mode!= MATROXFB_OUTPUT_MODE_MONITOR) + return -EINVAL; + /* mode did not change... */ + return 0; + default: + return -EINVAL; + } + return 0; + } + case MATROXFB_GET_OUTPUT_MODE: + { + struct matroxioc_output_mode mom; + int val; + + copy_from_user_ret(&mom, (struct matroxioc_output_mode*)arg, sizeof(mom), -EFAULT); + if (mom.output >= sizeof(u_int32_t)) + return -EINVAL; + switch (mom.output) { + case MATROXFB_OUTPUT_PRIMARY: + mom.mode = MATROXFB_OUTPUT_MODE_MONITOR; + break; + case MATROXFB_OUTPUT_SECONDARY: + val = -EINVAL; + down_read(&ACCESS_FBINFO(altout.lock)); + if (ACCESS_FBINFO(altout.output) && ACCESS_FBINFO(altout.device)) + val = ACCESS_FBINFO(altout.output)->getmode(ACCESS_FBINFO(altout.device), &mom.mode); + up_read(&ACCESS_FBINFO(altout.lock)); + if (val) + return val; + break; + case MATROXFB_OUTPUT_DFP: + if (!(ACCESS_FBINFO(output.all) & MATROXFB_OUTPUT_CONN_DFP)) + return -ENXIO; + mom.mode = MATROXFB_OUTPUT_MODE_MONITOR; + break; + default: + return -EINVAL; + } + copy_to_user_ret((struct matroxioc_output_mode*)arg, &mom, sizeof(mom), -EFAULT); + return 0; + } + case MATROXFB_SET_OUTPUT_CONNECTION: + { + u_int32_t tmp; + + copy_from_user_ret(&tmp, (u_int32_t*)arg, sizeof(tmp), -EFAULT); + if (tmp & ~ACCESS_FBINFO(output.all)) + return -EINVAL; + if (tmp & ACCESS_FBINFO(output.sh)) + return -EINVAL; + if (tmp & MATROXFB_OUTPUT_CONN_DFP) { + if (tmp & MATROXFB_OUTPUT_CONN_SECONDARY) + return -EINVAL; + if (ACCESS_FBINFO(output.sh)) + return -EINVAL; + } + if (tmp == ACCESS_FBINFO(output.ph)) + return 0; + ACCESS_FBINFO(output.ph) = tmp; + matroxfb_switch(ACCESS_FBINFO(currcon), info); + return 0; + } + case MATROXFB_GET_OUTPUT_CONNECTION: + { + put_user_ret(ACCESS_FBINFO(output.ph), (u_int32_t*)arg, -EFAULT); + return 0; + } + case MATROXFB_GET_AVAILABLE_OUTPUTS: + { + u_int32_t tmp; + + tmp = ACCESS_FBINFO(output.all) & ~ACCESS_FBINFO(output.sh); + if (ACCESS_FBINFO(output.ph) & MATROXFB_OUTPUT_CONN_DFP) + tmp &= ~MATROXFB_OUTPUT_CONN_SECONDARY; + if (ACCESS_FBINFO(output.ph) & MATROXFB_OUTPUT_CONN_SECONDARY) + tmp &= ~MATROXFB_OUTPUT_CONN_DFP; + put_user_ret(tmp, (u_int32_t*)arg, -EFAULT); + return 0; + } + case MATROXFB_GET_ALL_OUTPUTS: + { + put_user_ret(ACCESS_FBINFO(output.all), (u_int32_t*)arg, -EFAULT); + return 0; + } + } + return -EINVAL; +#undef minfo +} + +static struct fb_ops matroxfb_ops = { +// owner: THIS_MODULE, + fb_open: matroxfb_open, + fb_release: matroxfb_release, + fb_get_fix: matroxfb_get_fix, + fb_get_var: matroxfb_get_var, + fb_set_var: matroxfb_set_var, + fb_get_cmap: matroxfb_get_cmap, + fb_set_cmap: matroxfb_set_cmap, + fb_pan_display: matroxfb_pan_display, + fb_ioctl: matroxfb_ioctl, +}; + +static int matroxfb_switch(int con, struct fb_info *info) +{ +#define minfo ((struct matrox_fb_info*)info) + struct fb_cmap* cmap; + struct display *p; + + DBG("matroxfb_switch"); + + if (ACCESS_FBINFO(currcon) >= 0) { + /* Do we have to save the colormap? */ + cmap = &(ACCESS_FBINFO(currcon_display)->cmap); + dprintk(KERN_DEBUG "switch1: con = %d, cmap.len = %d\n", ACCESS_FBINFO(currcon), cmap->len); + + if (cmap->len) { + dprintk(KERN_DEBUG "switch1a: %p %p %p %p\n", cmap->red, cmap->green, cmap->blue, cmap->transp); + fb_get_cmap(cmap, 1, matrox_getcolreg, info); +#ifdef DEBUG + if (cmap->red) { + dprintk(KERN_DEBUG "switch1r: %X\n", cmap->red[0]); + } +#endif + } + } + ACCESS_FBINFO(currcon) = con; + if (con < 0) + p = ACCESS_FBINFO(fbcon.disp); + else + p = fb_display + con; + ACCESS_FBINFO(currcon_display) = p; + p->var.activate = FB_ACTIVATE_NOW; +#ifdef DEBUG + cmap = &p->cmap; + dprintk(KERN_DEBUG "switch2: con = %d, cmap.len = %d\n", con, cmap->len); + dprintk(KERN_DEBUG "switch2a: %p %p %p %p\n", cmap->red, cmap->green, cmap->blue, cmap->transp); + if (p->cmap.red) { + dprintk(KERN_DEBUG "switch2r: %X\n", cmap->red[0]); + } +#endif + matroxfb_set_var(&p->var, con, info); +#ifdef DEBUG + dprintk(KERN_DEBUG "switch3: con = %d, cmap.len = %d\n", con, cmap->len); + dprintk(KERN_DEBUG "switch3a: %p %p %p %p\n", cmap->red, cmap->green, cmap->blue, cmap->transp); + if (p->cmap.red) { + dprintk(KERN_DEBUG "switch3r: %X\n", cmap->red[0]); + } +#endif + return 0; +#undef minfo +} + +/* 0 unblank, 1 blank, 2 no vsync, 3 no hsync, 4 off */ + +static void matroxfb_blank(int blank, struct fb_info *info) +{ +#define minfo ((struct matrox_fb_info*)info) + int seq; + int crtc; + CRITFLAGS + + DBG("matroxfb_blank") + + if (ACCESS_FBINFO(dead)) + return; + + switch (blank) { + case 1: seq = 0x20; crtc = 0x00; break; /* works ??? */ + case 2: seq = 0x20; crtc = 0x10; break; + case 3: seq = 0x20; crtc = 0x20; break; + case 4: seq = 0x20; crtc = 0x30; break; + default: seq = 0x00; crtc = 0x00; break; + } + + CRITBEGIN + + mga_outb(M_SEQ_INDEX, 1); + mga_outb(M_SEQ_DATA, (mga_inb(M_SEQ_DATA) & ~0x20) | seq); + mga_outb(M_EXTVGA_INDEX, 1); + mga_outb(M_EXTVGA_DATA, (mga_inb(M_EXTVGA_DATA) & ~0x30) | crtc); + + CRITEND + +#undef minfo +} + +#define RSDepth(X) (((X) >> 8) & 0x0F) +#define RS8bpp 0x1 +#define RS15bpp 0x2 +#define RS16bpp 0x3 +#define RS32bpp 0x4 +#define RS4bpp 0x5 +#define RS24bpp 0x6 +#define RSText 0x7 +#define RSText8 0x8 +/* 9-F */ +static struct { struct fb_bitfield red, green, blue, transp; int bits_per_pixel; } colors[] = { + { { 0, 8, 0}, { 0, 8, 0}, { 0, 8, 0}, { 0, 0, 0}, 8 }, + { { 10, 5, 0}, { 5, 5, 0}, { 0, 5, 0}, { 15, 1, 0}, 16 }, + { { 11, 5, 0}, { 5, 6, 0}, { 0, 5, 0}, { 0, 0, 0}, 16 }, + { { 16, 8, 0}, { 8, 8, 0}, { 0, 8, 0}, { 24, 8, 0}, 32 }, + { { 0, 8, 0}, { 0, 8, 0}, { 0, 8, 0}, { 0, 0, 0}, 4 }, + { { 16, 8, 0}, { 8, 8, 0}, { 0, 8, 0}, { 0, 0, 0}, 24 }, + { { 0, 6, 0}, { 0, 6, 0}, { 0, 6, 0}, { 0, 0, 0}, 0 }, /* textmode with (default) VGA8x16 */ + { { 0, 6, 0}, { 0, 6, 0}, { 0, 6, 0}, { 0, 0, 0}, 0 }, /* textmode hardwired to VGA8x8 */ +}; + +/* initialized by setup, see explanation at end of file (search for MODULE_PARM_DESC) */ +static unsigned int mem = 0; /* "matrox:mem:xxxxxM" */ +static int option_precise_width = 1; /* cannot be changed, option_precise_width==0 must imply noaccel */ +static int inv24 = 0; /* "matrox:inv24" */ +static int cross4MB = -1; /* "matrox:cross4MB" */ +static int disabled = 0; /* "matrox:disabled" */ +static int noaccel = 0; /* "matrox:noaccel" */ +static int nopan = 0; /* "matrox:nopan" */ +static int no_pci_retry = 0; /* "matrox:nopciretry" */ +static int novga = 0; /* "matrox:novga" */ +static int nobios = 0; /* "matrox:nobios" */ +static int noinit = 1; /* "matrox:init" */ +static int inverse = 0; /* "matrox:inverse" */ +static int hwcursor = 1; /* "matrox:nohwcursor" */ +static int blink = 1; /* "matrox:noblink" */ +static int sgram = 0; /* "matrox:sgram" */ +#ifdef CONFIG_MTRR +static int mtrr = 1; /* "matrox:nomtrr" */ +#endif +static int grayscale = 0; /* "matrox:grayscale" */ +static unsigned int fastfont = 0; /* "matrox:fastfont:xxxxx" */ +static int dev = -1; /* "matrox:dev:xxxxx" */ +static unsigned int vesa = ~0; /* "matrox:vesa:xxxxx" */ +static int depth = -1; /* "matrox:depth:xxxxx" */ +static unsigned int xres = 0; /* "matrox:xres:xxxxx" */ +static unsigned int yres = 0; /* "matrox:yres:xxxxx" */ +static unsigned int upper = ~0; /* "matrox:upper:xxxxx" */ +static unsigned int lower = ~0; /* "matrox:lower:xxxxx" */ +static unsigned int vslen = 0; /* "matrox:vslen:xxxxx" */ +static unsigned int left = ~0; /* "matrox:left:xxxxx" */ +static unsigned int right = ~0; /* "matrox:right:xxxxx" */ +static unsigned int hslen = 0; /* "matrox:hslen:xxxxx" */ +static unsigned int pixclock = 0; /* "matrox:pixclock:xxxxx" */ +static int sync = -1; /* "matrox:sync:xxxxx" */ +static unsigned int fv = 0; /* "matrox:fv:xxxxx" */ +static unsigned int fh = 0; /* "matrox:fh:xxxxxk" */ +static unsigned int maxclk = 0; /* "matrox:maxclk:xxxxM" */ +static int dfp = 0; /* "matrox:dfp */ +static char fontname[64]; /* "matrox:font:xxxxx" */ + +#ifndef MODULE +static char videomode[64]; /* "matrox:mode:xxxxx" or "matrox:xxxxx" */ +#endif + +static int matroxfb_getmemory(WPMINFO unsigned int maxSize, unsigned int *realSize){ + vaddr_t vm; + unsigned int offs; + unsigned int offs2; + unsigned char store; + unsigned char bytes[32]; + unsigned char* tmp; + + DBG("matroxfb_getmemory") + + vm = ACCESS_FBINFO(video.vbase); + maxSize &= ~0x1FFFFF; /* must be X*2MB (really it must be 2 or X*4MB) */ + /* at least 2MB */ + if (maxSize < 0x0200000) return 0; + if (maxSize > 0x2000000) maxSize = 0x2000000; + + mga_outb(M_EXTVGA_INDEX, 0x03); + mga_outb(M_EXTVGA_DATA, mga_inb(M_EXTVGA_DATA) | 0x80); + + store = mga_readb(vm, 0x1234); + tmp = bytes; + for (offs = 0x100000; offs < maxSize; offs += 0x200000) + *tmp++ = mga_readb(vm, offs); + for (offs = 0x100000; offs < maxSize; offs += 0x200000) + mga_writeb(vm, offs, 0x02); + if (ACCESS_FBINFO(features.accel.has_cacheflush)) + mga_outb(M_CACHEFLUSH, 0x00); + else + mga_writeb(vm, 0x1234, 0x99); + for (offs = 0x100000; offs < maxSize; offs += 0x200000) { + if (mga_readb(vm, offs) != 0x02) + break; + mga_writeb(vm, offs, mga_readb(vm, offs) - 0x02); + if (mga_readb(vm, offs)) + break; + } + tmp = bytes; + for (offs2 = 0x100000; offs2 < maxSize; offs2 += 0x200000) + mga_writeb(vm, offs2, *tmp++); + mga_writeb(vm, 0x1234, store); + + mga_outb(M_EXTVGA_INDEX, 0x03); + mga_outb(M_EXTVGA_DATA, mga_inb(M_EXTVGA_DATA) & ~0x80); + + *realSize = offs - 0x100000; +#ifdef CONFIG_FB_MATROX_MILLENIUM + ACCESS_FBINFO(interleave) = !(!isMillenium(MINFO) || ((offs - 0x100000) & 0x3FFFFF)); +#endif + return 1; +} + +struct video_board { + int maxvram; + int maxdisplayable; + int accelID; + struct matrox_switch* lowlevel; + }; +#ifdef CONFIG_FB_MATROX_MILLENIUM +static struct video_board vbMillennium = {0x0800000, 0x0800000, FB_ACCEL_MATROX_MGA2064W, &matrox_millennium}; +static struct video_board vbMillennium2 = {0x1000000, 0x0800000, FB_ACCEL_MATROX_MGA2164W, &matrox_millennium}; +static struct video_board vbMillennium2A = {0x1000000, 0x0800000, FB_ACCEL_MATROX_MGA2164W_AGP, &matrox_millennium}; +#endif /* CONFIG_FB_MATROX_MILLENIUM */ +#ifdef CONFIG_FB_MATROX_MYSTIQUE +static struct video_board vbMystique = {0x0800000, 0x0800000, FB_ACCEL_MATROX_MGA1064SG, &matrox_mystique}; +#endif /* CONFIG_FB_MATROX_MYSTIQUE */ +#ifdef CONFIG_FB_MATROX_G100 +static struct video_board vbG100 = {0x0800000, 0x0800000, FB_ACCEL_MATROX_MGAG100, &matrox_G100}; +static struct video_board vbG200 = {0x1000000, 0x1000000, FB_ACCEL_MATROX_MGAG200, &matrox_G100}; +#ifdef CONFIG_FB_MATROX_32MB +/* from doc it looks like that accelerator can draw only to low 16MB :-( Direct accesses & displaying are OK for + whole 32MB */ +static struct video_board vbG400 = {0x2000000, 0x1000000, FB_ACCEL_MATROX_MGAG400, &matrox_G100}; +#else +static struct video_board vbG400 = {0x2000000, 0x1000000, FB_ACCEL_MATROX_MGAG400, &matrox_G100}; +#endif +#endif + +#define DEVF_VIDEO64BIT 0x0001 +#define DEVF_SWAPS 0x0002 +#define DEVF_MILLENNIUM 0x0004 +#define DEVF_MILLENNIUM2 0x0008 +#define DEVF_CROSS4MB 0x0010 +#define DEVF_TEXT4B 0x0020 +#define DEVF_DDC_8_2 0x0040 +#define DEVF_DMA 0x0080 +#define DEVF_SUPPORT32MB 0x0100 +#define DEVF_ANY_VXRES 0x0200 +#define DEVF_TEXT16B 0x0400 +#define DEVF_CRTC2 0x0800 +#define DEVF_MAVEN_CAPABLE 0x1000 +#define DEVF_PANELLINK_CAPABLE 0x2000 + +#define DEVF_GCORE (DEVF_VIDEO64BIT | DEVF_SWAPS | DEVF_CROSS4MB | DEVF_DDC_8_2) +#define DEVF_G2CORE (DEVF_GCORE | DEVF_ANY_VXRES | DEVF_MAVEN_CAPABLE | DEVF_PANELLINK_CAPABLE) +#define DEVF_G100 (DEVF_GCORE) /* no doc, no vxres... */ +#define DEVF_G200 (DEVF_G2CORE) +#define DEVF_G400 (DEVF_G2CORE | DEVF_SUPPORT32MB | DEVF_TEXT16B | DEVF_CRTC2) + +static struct board { + unsigned short vendor, device, rev, svid, sid; + unsigned int flags; + unsigned int maxclk; + struct video_board* base; + const char* name; + } dev_list[] = { +#ifdef CONFIG_FB_MATROX_MILLENIUM + {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_MIL, 0xFF, + 0, 0, + DEVF_MILLENNIUM | DEVF_TEXT4B, + 230000, + &vbMillennium, + "Millennium (PCI)"}, + {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_MIL_2, 0xFF, + 0, 0, + DEVF_MILLENNIUM | DEVF_MILLENNIUM2 | DEVF_SWAPS, + 220000, + &vbMillennium2, + "Millennium II (PCI)"}, + {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_MIL_2_AGP, 0xFF, + 0, 0, + DEVF_MILLENNIUM | DEVF_MILLENNIUM2 | DEVF_SWAPS, + 250000, + &vbMillennium2A, + "Millennium II (AGP)"}, +#endif +#ifdef CONFIG_FB_MATROX_MYSTIQUE + {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_MYS, 0x02, + 0, 0, + DEVF_VIDEO64BIT, + 180000, + &vbMystique, + "Mystique (PCI)"}, + {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_MYS, 0xFF, + 0, 0, + DEVF_VIDEO64BIT | DEVF_SWAPS, + 220000, + &vbMystique, + "Mystique 220 (PCI)"}, +#endif +#ifdef CONFIG_FB_MATROX_G100 + {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_G100, 0xFF, + PCI_SS_VENDOR_ID_MATROX, PCI_SS_ID_MATROX_MGA_G100_PCI, + DEVF_G100, + 230000, + &vbG100, + "MGA-G100 (PCI)"}, + {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_G100, 0xFF, + 0, 0, + DEVF_G100, + 230000, + &vbG100, + "unknown G100 (PCI)"}, + {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_G100_AGP, 0xFF, + PCI_SS_VENDOR_ID_MATROX, PCI_SS_ID_MATROX_GENERIC, + DEVF_G100, + 230000, + &vbG100, + "MGA-G100 (AGP)"}, + {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_G100_AGP, 0xFF, + PCI_SS_VENDOR_ID_MATROX, PCI_SS_ID_MATROX_MGA_G100_AGP, + DEVF_G100, + 230000, + &vbG100, + "MGA-G100 (AGP)"}, + {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_G100_AGP, 0xFF, + PCI_SS_VENDOR_ID_SIEMENS_NIXDORF, PCI_SS_ID_SIEMENS_MGA_G100_AGP, + DEVF_G100, + 230000, + &vbG100, + "MGA-G100 (AGP)"}, + {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_G100_AGP, 0xFF, + PCI_SS_VENDOR_ID_MATROX, PCI_SS_ID_MATROX_PRODUCTIVA_G100_AGP, + DEVF_G100, + 230000, + &vbG100, + "Productiva G100 (AGP)"}, + {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_G100_AGP, 0xFF, + 0, 0, + DEVF_G100, + 230000, + &vbG100, + "unknown G100 (AGP)"}, + {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_G200_PCI, 0xFF, + 0, 0, + DEVF_G200, + 250000, + &vbG200, + "unknown G200 (PCI)"}, + {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_G200_AGP, 0xFF, + PCI_SS_VENDOR_ID_MATROX, PCI_SS_ID_MATROX_GENERIC, + DEVF_G200, + 220000, + &vbG200, + "MGA-G200 (AGP)"}, + {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_G200_AGP, 0xFF, + PCI_SS_VENDOR_ID_MATROX, PCI_SS_ID_MATROX_MYSTIQUE_G200_AGP, + DEVF_G200, + 230000, + &vbG200, + "Mystique G200 (AGP)"}, + {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_G200_AGP, 0xFF, + PCI_SS_VENDOR_ID_MATROX, PCI_SS_ID_MATROX_MILLENIUM_G200_AGP, + DEVF_G200, + 250000, + &vbG200, + "Millennium G200 (AGP)"}, + {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_G200_AGP, 0xFF, + PCI_SS_VENDOR_ID_MATROX, PCI_SS_ID_MATROX_MARVEL_G200_AGP, + DEVF_G200, + 230000, + &vbG200, + "Marvel G200 (AGP)"}, + {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_G200_AGP, 0xFF, + PCI_SS_VENDOR_ID_SIEMENS_NIXDORF, PCI_SS_ID_SIEMENS_MGA_G200_AGP, + DEVF_G200, + 230000, + &vbG200, + "MGA-G200 (AGP)"}, + {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_G200_AGP, 0xFF, + 0, 0, + DEVF_G200, + 230000, + &vbG200, + "unknown G200 (AGP)"}, + {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_G400_AGP, 0xFF, + PCI_SS_VENDOR_ID_MATROX, PCI_SS_ID_MATROX_MILLENNIUM_G400_MAX_AGP, + DEVF_G400, + 360000, + &vbG400, + "Millennium G400 MAX (AGP)"}, + {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_G400_AGP, 0xFF, + 0, 0, + DEVF_G400, + 300000, + &vbG400, + "unknown G400 (AGP)"}, +#endif + {0, 0, 0xFF, + 0, 0, + 0, + 0, + NULL, + NULL}}; + +#if 0 //ndef MODULE +static struct fb_videomode defaultmode = { + /* 640x480 @ 60Hz, 31.5 kHz */ + NULL, 60, 640, 480, 39721, 40, 24, 32, 11, 96, 2, + 0, FB_VMODE_NONINTERLACED +}; +#endif /* !MODULE */ + +static int hotplug = 0; + +static int initMatrox2(WPMINFO struct display* d, struct board* b){ + unsigned long ctrlptr_phys = 0; + unsigned long video_base_phys = 0; + unsigned int memsize; + struct matrox_hw_state* hw = ACCESS_FBINFO(currenthw); + int err; + + DBG("initMatrox2") + + /* set default values... */ + vesafb_defined.accel_flags = FB_ACCELF_TEXT; + + ACCESS_FBINFO(hw_switch) = b->base->lowlevel; + ACCESS_FBINFO(devflags.accelerator) = b->base->accelID; + ACCESS_FBINFO(max_pixel_clock) = b->maxclk; + + printk(KERN_INFO "matroxfb: Matrox %s detected\n", b->name); + ACCESS_FBINFO(capable.plnwt) = 1; + ACCESS_FBINFO(devflags.video64bits) = b->flags & DEVF_VIDEO64BIT; + if (b->flags & DEVF_TEXT4B) { + ACCESS_FBINFO(devflags.vgastep) = 4; + ACCESS_FBINFO(devflags.textmode) = 4; + ACCESS_FBINFO(devflags.text_type_aux) = FB_AUX_TEXT_MGA_STEP16; + } else if (b->flags & DEVF_TEXT16B) { + ACCESS_FBINFO(devflags.vgastep) = 16; + ACCESS_FBINFO(devflags.textmode) = 1; + ACCESS_FBINFO(devflags.text_type_aux) = FB_AUX_TEXT_MGA_STEP16; + } else { + ACCESS_FBINFO(devflags.vgastep) = 8; + ACCESS_FBINFO(devflags.textmode) = 1; + ACCESS_FBINFO(devflags.text_type_aux) = FB_AUX_TEXT_MGA_STEP8; + } +#ifdef CONFIG_FB_MATROX_32MB + ACCESS_FBINFO(devflags.support32MB) = b->flags & DEVF_SUPPORT32MB; +#endif + ACCESS_FBINFO(devflags.precise_width) = !(b->flags & DEVF_ANY_VXRES); + ACCESS_FBINFO(devflags.crtc2) = b->flags & DEVF_CRTC2; + ACCESS_FBINFO(devflags.maven_capable) = b->flags & DEVF_MAVEN_CAPABLE; + if (b->flags & DEVF_PANELLINK_CAPABLE) { + ACCESS_FBINFO(output.all) |= MATROXFB_OUTPUT_CONN_DFP; + if (dfp) + ACCESS_FBINFO(output.ph) |= MATROXFB_OUTPUT_CONN_DFP; + } + + ACCESS_FBINFO(devflags.textstep) = ACCESS_FBINFO(devflags.vgastep) * ACCESS_FBINFO(devflags.textmode); + ACCESS_FBINFO(devflags.textvram) = 65536 / ACCESS_FBINFO(devflags.textmode); + + if (ACCESS_FBINFO(capable.cross4MB) < 0) + ACCESS_FBINFO(capable.cross4MB) = b->flags & DEVF_CROSS4MB; + if (b->flags & DEVF_SWAPS) { + ctrlptr_phys = pci_resource_start(ACCESS_FBINFO(pcidev), 1); + video_base_phys = pci_resource_start(ACCESS_FBINFO(pcidev), 0) & ~0x7FFFFF; + } else { + ctrlptr_phys = pci_resource_start(ACCESS_FBINFO(pcidev), 0); + video_base_phys = pci_resource_start(ACCESS_FBINFO(pcidev), 1) & ~0x7FFFFF; + } + err = -EINVAL; + if (!ctrlptr_phys) { + printk(KERN_ERR "matroxfb: control registers are not available, matroxfb disabled\n"); + goto fail; + } + if (!video_base_phys) { + printk(KERN_ERR "matroxfb: video RAM is not available in PCI address space, matroxfb disabled\n"); + goto fail; + } + memsize = b->base->maxvram; + if (!request_mem_region(ctrlptr_phys, 16384, "matroxfb MMIO")) { + goto fail; + } + if (!request_mem_region(video_base_phys, memsize, "matroxfb FB")) { + goto failCtrlMR; + } + ACCESS_FBINFO(video.len_maximum) = memsize; + /* convert mem (autodetect k, M) */ + if (mem < 1024) mem *= 1024; + if (mem < 0x00100000) mem *= 1024; + + if (mem && (mem < memsize)) + memsize = mem; + err = -ENOMEM; + if (mga_ioremap(ctrlptr_phys, 16384, MGA_IOREMAP_MMIO, &ACCESS_FBINFO(mmio.vbase))) { + printk(KERN_ERR "matroxfb: cannot ioremap(%lX, 16384), matroxfb disabled\n", ctrlptr_phys); + goto failVideoMR; + } + ACCESS_FBINFO(mmio.base) = ctrlptr_phys; + ACCESS_FBINFO(mmio.len) = 16384; + ACCESS_FBINFO(video.base) = video_base_phys; + if (mga_ioremap(video_base_phys, memsize, MGA_IOREMAP_FB, &ACCESS_FBINFO(video.vbase))) { + printk(KERN_ERR "matroxfb: cannot ioremap(%lX, %d), matroxfb disabled\n", + video_base_phys, memsize); + goto failCtrlIO; + } + { + u_int32_t cmd; + u_int32_t mga_option; + + pci_read_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, &mga_option); + pci_read_config_dword(ACCESS_FBINFO(pcidev), PCI_COMMAND, &cmd); + mga_option &= 0x7FFFFFFF; /* clear BIG_ENDIAN */ + mga_option |= MX_OPTION_BSWAP; + /* disable palette snooping */ + cmd &= ~PCI_COMMAND_VGA_PALETTE; + if (pci_find_device(PCI_VENDOR_ID_INTEL, PCI_DEVICE_ID_INTEL_82437, NULL)) { + if (!(mga_option & 0x20000000) && !ACCESS_FBINFO(devflags.nopciretry)) { + printk(KERN_WARNING "matroxfb: Disabling PCI retries due to i82437 present\n"); + } + mga_option |= 0x20000000; + ACCESS_FBINFO(devflags.nopciretry) = 1; + } + pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_COMMAND, cmd); + pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, mga_option); + hw->MXoptionReg = mga_option; + + /* select non-DMA memory for PCI_MGA_DATA, otherwise dump of PCI cfg space can lock PCI bus */ + /* maybe preinit() candidate, but it is same... for all devices... at this time... */ + pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_MGA_INDEX, 0x00003C00); + } + + err = -ENXIO; + if (ACCESS_FBINFO(hw_switch)->preinit(PMINFO hw)) { + goto failVideoIO; + } + + err = -ENOMEM; + if (!matroxfb_getmemory(PMINFO memsize, &ACCESS_FBINFO(video.len)) || !ACCESS_FBINFO(video.len)) { + printk(KERN_ERR "matroxfb: cannot determine memory size\n"); + goto failVideoIO; + } + ACCESS_FBINFO(devflags.ydstorg) = 0; + + ACCESS_FBINFO(currcon) = -1; + ACCESS_FBINFO(currcon_display) = d; + mga_iounmap(ACCESS_FBINFO(video.vbase)); + ACCESS_FBINFO(video.base) = video_base_phys; + if (mga_ioremap(video_base_phys, ACCESS_FBINFO(video.len), MGA_IOREMAP_FB, &ACCESS_FBINFO(video.vbase))) { + printk(KERN_ERR "matroxfb: cannot ioremap(%lX, %d), matroxfb disabled\n", + video_base_phys, ACCESS_FBINFO(video.len)); + goto failCtrlIO; + } + ACCESS_FBINFO(video.len_usable) = ACCESS_FBINFO(video.len); + if (ACCESS_FBINFO(video.len_usable) > b->base->maxdisplayable) + ACCESS_FBINFO(video.len_usable) = b->base->maxdisplayable; +#ifdef CONFIG_MTRR + if (mtrr) { + ACCESS_FBINFO(mtrr.vram) = mtrr_add(video_base_phys, ACCESS_FBINFO(video.len), MTRR_TYPE_WRCOMB, 1); + ACCESS_FBINFO(mtrr.vram_valid) = 1; + printk(KERN_INFO "matroxfb: MTRR's turned on\n"); + } +#endif /* CONFIG_MTRR */ + + if (!ACCESS_FBINFO(devflags.novga)) + request_region(0x3C0, 32, "matrox"); + ACCESS_FBINFO(hw_switch->reset(PMINFO hw)); + + ACCESS_FBINFO(fbcon.monspecs.hfmin) = 0; + ACCESS_FBINFO(fbcon.monspecs.hfmax) = fh; + ACCESS_FBINFO(fbcon.monspecs.vfmin) = 0; + ACCESS_FBINFO(fbcon.monspecs.vfmax) = fv; + ACCESS_FBINFO(fbcon.monspecs.dpms) = 0; /* TBD */ + + /* static settings */ + if ((depth == RSText8) && (!*ACCESS_FBINFO(fbcon.fontname))) { + strcpy(ACCESS_FBINFO(fbcon.fontname), "VGA8x8"); + } + vesafb_defined.red = colors[depth-1].red; + vesafb_defined.green = colors[depth-1].green; + vesafb_defined.blue = colors[depth-1].blue; + vesafb_defined.bits_per_pixel = colors[depth-1].bits_per_pixel; + vesafb_defined.grayscale = grayscale; + vesafb_defined.vmode = 0; + if (noaccel) + vesafb_defined.accel_flags &= ~FB_ACCELF_TEXT; + + strcpy(ACCESS_FBINFO(fbcon.modename), "MATROX VGA"); + ACCESS_FBINFO(fbcon.changevar) = NULL; + ACCESS_FBINFO(fbcon.node) = -1; + ACCESS_FBINFO(fbcon.fbops) = &matroxfb_ops; + ACCESS_FBINFO(fbcon.disp) = d; + ACCESS_FBINFO(fbcon.switch_con) = &matroxfb_switch; + ACCESS_FBINFO(fbcon.updatevar) = &matroxfb_updatevar; + ACCESS_FBINFO(fbcon.blank) = &matroxfb_blank; + /* after __init time we are like module... no logo */ + ACCESS_FBINFO(fbcon.flags) = hotplug ? FBINFO_FLAG_MODULE : FBINFO_FLAG_DEFAULT; + ACCESS_FBINFO(video.len_usable) &= PAGE_MASK; + +#if 0 //ndef MODULE + /* mode database is marked __init!!! */ + if (!hotplug) { + fb_find_mode(&vesafb_defined, &ACCESS_FBINFO(fbcon), videomode[0]?videomode:NULL, + NULL, 0, &defaultmode, vesafb_defined.bits_per_pixel); + } +#endif /* !MODULE */ + + /* mode modifiers */ + if (hslen) + vesafb_defined.hsync_len = hslen; + if (vslen) + vesafb_defined.vsync_len = vslen; + if (left != ~0) + vesafb_defined.left_margin = left; + if (right != ~0) + vesafb_defined.right_margin = right; + if (upper != ~0) + vesafb_defined.upper_margin = upper; + if (lower != ~0) + vesafb_defined.lower_margin = lower; + if (xres) + vesafb_defined.xres = xres; + if (yres) + vesafb_defined.yres = yres; + if (sync != -1) + vesafb_defined.sync = sync; + else if (vesafb_defined.sync == ~0) { + vesafb_defined.sync = 0; + if (yres < 400) + vesafb_defined.sync |= FB_SYNC_HOR_HIGH_ACT; + else if (yres < 480) + vesafb_defined.sync |= FB_SYNC_VERT_HIGH_ACT; + } + + /* fv, fh, maxclk limits was specified */ + { + unsigned int tmp; + + if (fv) { + tmp = fv * (vesafb_defined.upper_margin + vesafb_defined.yres + + vesafb_defined.lower_margin + vesafb_defined.vsync_len); + if ((tmp < fh) || (fh == 0)) fh = tmp; + } + if (fh) { + tmp = fh * (vesafb_defined.left_margin + vesafb_defined.xres + + vesafb_defined.right_margin + vesafb_defined.hsync_len); + if ((tmp < maxclk) || (maxclk == 0)) maxclk = tmp; + } + maxclk = (maxclk + 499) / 500; + if (maxclk) { + tmp = (2000000000 + maxclk) / maxclk; + if (tmp > pixclock) pixclock = tmp; + } + } + if (pixclock) { + if (pixclock < 2000) /* > 500MHz */ + pixclock = 4000; /* 250MHz */ + if (pixclock > 1000000) + pixclock = 1000000; /* 1MHz */ + vesafb_defined.pixclock = pixclock; + } + + /* FIXME: Where to move this?! */ +#if defined(CONFIG_PPC) +#if defined(CONFIG_FB_COMPAT_XPMAC) + strcpy(ACCESS_FBINFO(matrox_name), "MTRX,"); /* OpenFirmware naming convension */ + strncat(ACCESS_FBINFO(matrox_name), b->name, 26); + if (!console_fb_info) + console_fb_info = &ACCESS_FBINFO(fbcon); +#endif + if ((xres <= 640) && (yres <= 480)) { + struct fb_var_screeninfo var; + if (default_vmode == VMODE_NVRAM) { + default_vmode = nvram_read_byte(NV_VMODE); + if (default_vmode <= 0 || default_vmode > VMODE_MAX) + default_vmode = VMODE_CHOOSE; + } + if (default_vmode <= 0 || default_vmode > VMODE_MAX) + default_vmode = VMODE_640_480_60; + if (default_cmode == CMODE_NVRAM) + default_cmode = nvram_read_byte(NV_CMODE); + if (default_cmode < CMODE_8 || default_cmode > CMODE_32) + default_cmode = CMODE_8; + if (!mac_vmode_to_var(default_vmode, default_cmode, &var)) { + var.accel_flags = vesafb_defined.accel_flags; + var.xoffset = var.yoffset = 0; + vesafb_defined = var; /* Note: mac_vmode_to_var() doesnot set all parameters */ + } + } +#endif /* CONFIG_PPC */ + vesafb_defined.xres_virtual = vesafb_defined.xres; + if (nopan) { + vesafb_defined.yres_virtual = vesafb_defined.yres; + } else { + vesafb_defined.yres_virtual = 65536; /* large enough to be INF, but small enough + to yres_virtual * xres_virtual < 2^32 */ + } + err = -EINVAL; + if (matroxfb_set_var(&vesafb_defined, -2, &ACCESS_FBINFO(fbcon))) { + printk(KERN_ERR "matroxfb: cannot set required parameters\n"); + goto failVideoIO; + } + + printk(KERN_INFO "matroxfb: %dx%dx%dbpp (virtual: %dx%d)\n", + vesafb_defined.xres, vesafb_defined.yres, vesafb_defined.bits_per_pixel, + vesafb_defined.xres_virtual, vesafb_defined.yres_virtual); + printk(KERN_INFO "matroxfb: framebuffer at 0x%lX, mapped to 0x%p, size %d\n", + ACCESS_FBINFO(video.base), vaddr_va(ACCESS_FBINFO(video.vbase)), ACCESS_FBINFO(video.len)); + +/* We do not have to set currcon to 0... register_framebuffer do it for us on first console + * and we do not want currcon == 0 for subsequent framebuffers */ + + if (register_framebuffer(&ACCESS_FBINFO(fbcon)) < 0) { + goto failVideoIO; + } + printk("fb%d: %s frame buffer device\n", + GET_FB_IDX(ACCESS_FBINFO(fbcon.node)), ACCESS_FBINFO(fbcon.modename)); + if (ACCESS_FBINFO(currcon) < 0) { + /* there is no console on this fb... but we have to initialize hardware + * until someone tells me what is proper thing to do */ + printk(KERN_INFO "fb%d: initializing hardware\n", + GET_FB_IDX(ACCESS_FBINFO(fbcon.node))); + matroxfb_set_var(&vesafb_defined, -1, &ACCESS_FBINFO(fbcon)); + } + return 0; +failVideoIO:; + mga_iounmap(ACCESS_FBINFO(video.vbase)); +failCtrlIO:; + mga_iounmap(ACCESS_FBINFO(mmio.vbase)); +failVideoMR:; + release_mem_region(video_base_phys, ACCESS_FBINFO(video.len_maximum)); +failCtrlMR:; + release_mem_region(ctrlptr_phys, 16384); +fail:; + return err; +} + +LIST_HEAD(matroxfb_list); +LIST_HEAD(matroxfb_driver_list); + +#define matroxfb_l(x) list_entry(x, struct matrox_fb_info, next_fb) +#define matroxfb_driver_l(x) list_entry(x, struct matroxfb_driver, node) +int matroxfb_register_driver(struct matroxfb_driver* drv) { + struct matrox_fb_info* minfo; + + list_add(&drv->node, &matroxfb_driver_list); + for (minfo = matroxfb_l(matroxfb_list.next); + minfo != matroxfb_l(&matroxfb_list); + minfo = matroxfb_l(minfo->next_fb.next)) { + void* p; + + if (minfo->drivers_count == MATROXFB_MAX_FB_DRIVERS) + continue; + p = drv->probe(minfo); + if (p) { + minfo->drivers_data[minfo->drivers_count] = p; + minfo->drivers[minfo->drivers_count++] = drv; + } + } + return 0; +} + +void matroxfb_unregister_driver(struct matroxfb_driver* drv) { + struct matrox_fb_info* minfo; + + list_del(&drv->node); + for (minfo = matroxfb_l(matroxfb_list.next); + minfo != matroxfb_l(&matroxfb_list); + minfo = matroxfb_l(minfo->next_fb.next)) { + int i; + + for (i = 0; i < minfo->drivers_count; ) { + if (minfo->drivers[i] == drv) { + if (drv && drv->remove) + drv->remove(minfo, minfo->drivers_data[i]); + minfo->drivers[i] = minfo->drivers[--minfo->drivers_count]; + minfo->drivers_data[i] = minfo->drivers_data[minfo->drivers_count]; + } else + i++; + } + } +} + +static void matroxfb_register_device(struct matrox_fb_info* minfo) { + struct matroxfb_driver* drv; + int i = 0; + list_add(&ACCESS_FBINFO(next_fb), &matroxfb_list); + for (drv = matroxfb_driver_l(matroxfb_driver_list.next); + drv != matroxfb_driver_l(&matroxfb_driver_list); + drv = matroxfb_driver_l(drv->node.next)) { + if (drv && drv->probe) { + void *p = drv->probe(minfo); + if (p) { + minfo->drivers_data[i] = p; + minfo->drivers[i++] = drv; + if (i == MATROXFB_MAX_FB_DRIVERS) + break; + } + } + } + minfo->drivers_count = i; +} + +static void matroxfb_unregister_device(struct matrox_fb_info* minfo) { + int i; + + list_del(&ACCESS_FBINFO(next_fb)); + for (i = 0; i < minfo->drivers_count; i++) { + struct matroxfb_driver* drv = minfo->drivers[i]; + + if (drv && drv->remove) + drv->remove(minfo, minfo->drivers_data[i]); + } +} + +static int matroxfb_probe(struct pci_dev* pdev, const struct pci_device_id* dummy) { + struct board* b; + u_int8_t rev; + u_int16_t svid; + u_int16_t sid; + struct matrox_fb_info* minfo; + struct display* d; + int err; + u_int32_t cmd; +#ifndef CONFIG_FB_MATROX_MULTIHEAD + static int registered = 0; +#endif + DBG("matroxfb_probe") + + pci_read_config_byte(pdev, PCI_REVISION_ID, &rev); + //svid = pdev->subsystem_vendor; + //sid = pdev->subsystem_device; + pci_read_config_word(pdev, PCI_SUBSYSTEM_VENDOR_ID, &svid); + pci_read_config_word(pdev, PCI_SUBSYSTEM_ID, &sid); + for (b = dev_list; b->vendor; b++) { + if ((b->vendor != pdev->vendor) || (b->device != pdev->device) || (b->rev < rev)) continue; + if (b->svid) + if ((b->svid != svid) || (b->sid != sid)) continue; + break; + } + /* not match... */ + if (!b->vendor) + return -1; + if (dev > 0) { + /* not requested one... */ + dev--; + return -1; + } + pci_read_config_dword(pdev, PCI_COMMAND, &cmd); + if (pci_enable_device(pdev)) { + return -1; + } + +#ifdef CONFIG_FB_MATROX_MULTIHEAD + minfo = (struct matrox_fb_info*)kmalloc(sizeof(*minfo), GFP_KERNEL); + if (!minfo) + return -1; + d = (struct display*)kmalloc(sizeof(*d), GFP_KERNEL); + if (!d) { + kfree(minfo); + return -1; + } +#else + if (registered) /* singlehead driver... */ + return -1; + minfo = &matroxfb_global_mxinfo; + d = &global_disp; +#endif + memset(MINFO, 0, sizeof(*MINFO)); + memset(d, 0, sizeof(*d)); + + ACCESS_FBINFO(currenthw) = &ACCESS_FBINFO(hw1); + ACCESS_FBINFO(newhw) = &ACCESS_FBINFO(hw2); + ACCESS_FBINFO(pcidev) = pdev; + ACCESS_FBINFO(dead) = 0; + ACCESS_FBINFO(usecount) = 0; + //pdev->driver_data = MINFO; + /* CMDLINE */ + memcpy(ACCESS_FBINFO(fbcon.fontname), fontname, sizeof(ACCESS_FBINFO(fbcon.fontname))); + /* DEVFLAGS */ + ACCESS_FBINFO(devflags.inverse) = inverse; + if (cmd & PCI_COMMAND_MEMORY) { + ACCESS_FBINFO(devflags.novga) = novga; + ACCESS_FBINFO(devflags.nobios) = nobios; + ACCESS_FBINFO(devflags.noinit) = noinit; + /* subsequent heads always needs initialization and must not enable BIOS */ + novga = 1; + nobios = 1; + noinit = 0; + } else { + ACCESS_FBINFO(devflags.novga) = 1; + ACCESS_FBINFO(devflags.nobios) = 1; + ACCESS_FBINFO(devflags.noinit) = 0; + } + ACCESS_FBINFO(devflags.nopciretry) = no_pci_retry; + ACCESS_FBINFO(devflags.mga_24bpp_fix) = inv24; + ACCESS_FBINFO(devflags.precise_width) = option_precise_width; + ACCESS_FBINFO(devflags.hwcursor) = hwcursor; + ACCESS_FBINFO(devflags.blink) = blink; + ACCESS_FBINFO(devflags.sgram) = sgram; + ACCESS_FBINFO(capable.cross4MB) = cross4MB; + + ACCESS_FBINFO(fastfont.size) = fastfont; + + ACCESS_FBINFO(cursor.state) = CM_ERASE; + init_timer (&ACCESS_FBINFO(cursor.timer)); + ACCESS_FBINFO(cursor.timer.data) = (unsigned long)MINFO; + spin_lock_init(&ACCESS_FBINFO(lock.DAC)); + spin_lock_init(&ACCESS_FBINFO(lock.accel)); + init_rwsem(&ACCESS_FBINFO(crtc2.lock)); + init_rwsem(&ACCESS_FBINFO(altout.lock)); + + ACCESS_FBINFO(output.all) = MATROXFB_OUTPUT_CONN_PRIMARY; + ACCESS_FBINFO(output.ph) = MATROXFB_OUTPUT_CONN_PRIMARY; + ACCESS_FBINFO(output.sh) = 0; + + err = initMatrox2(PMINFO d, b); + if (!err) { +#ifndef CONFIG_FB_MATROX_MULTIHEAD + registered = 1; +#endif + matroxfb_register_device(MINFO); + return 0; + } +#ifdef CONFIG_FB_MATROX_MULTIHEAD + kfree(d); + kfree(minfo); +#endif + return -1; +} + +/* +static void pci_remove_matrox(struct pci_dev* pdev) { + struct matrox_fb_info* minfo; + + minfo = pdev->driver_data; + matroxfb_remove(PMINFO 1); +} + +static struct pci_driver matroxfb_driver = { + name: "matroxfb", + probe: matroxfb_probe, + remove: pci_remove_matrox, +}; +*/ + +/* **************************** init-time only **************************** */ + +#define RSResolution(X) ((X) & 0x0F) +#define RS640x400 1 +#define RS640x480 2 +#define RS800x600 3 +#define RS1024x768 4 +#define RS1280x1024 5 +#define RS1600x1200 6 +#define RS768x576 7 +#define RS960x720 8 +#define RS1152x864 9 +#define RS1408x1056 10 +#define RS640x350 11 +#define RS1056x344 12 /* 132 x 43 text */ +#define RS1056x400 13 /* 132 x 50 text */ +#define RS1056x480 14 /* 132 x 60 text */ +#define RSNoxNo 15 +/* 10-FF */ +static struct { int xres, yres, left, right, upper, lower, hslen, vslen, vfreq; } timmings[] __initdata = { + { 640, 400, 48, 16, 39, 8, 96, 2, 70 }, + { 640, 480, 48, 16, 33, 10, 96, 2, 60 }, + { 800, 600, 144, 24, 28, 8, 112, 6, 60 }, + { 1024, 768, 160, 32, 30, 4, 128, 4, 60 }, + { 1280, 1024, 224, 32, 32, 4, 136, 4, 60 }, + { 1600, 1200, 272, 48, 32, 5, 152, 5, 60 }, + { 768, 576, 144, 16, 28, 6, 112, 4, 60 }, + { 960, 720, 144, 24, 28, 8, 112, 4, 60 }, + { 1152, 864, 192, 32, 30, 4, 128, 4, 60 }, + { 1408, 1056, 256, 40, 32, 5, 144, 5, 60 }, + { 640, 350, 48, 16, 39, 8, 96, 2, 70 }, + { 1056, 344, 96, 24, 59, 44, 160, 2, 70 }, + { 1056, 400, 96, 24, 39, 8, 160, 2, 70 }, + { 1056, 480, 96, 24, 36, 12, 160, 3, 60 }, + { 0, 0, ~0, ~0, ~0, ~0, 0, 0, 0 } +}; + +#define RSCreate(X,Y) ((X) | ((Y) << 8)) +static struct { unsigned int vesa; unsigned int info; } *RSptr, vesamap[] __initdata = { +/* default must be first */ +#ifdef FBCON_HAS_CFB8 + { ~0, RSCreate(RSNoxNo, RS8bpp ) }, + { 0x101, RSCreate(RS640x480, RS8bpp ) }, + { 0x100, RSCreate(RS640x400, RS8bpp ) }, + { 0x180, RSCreate(RS768x576, RS8bpp ) }, + { 0x103, RSCreate(RS800x600, RS8bpp ) }, + { 0x188, RSCreate(RS960x720, RS8bpp ) }, + { 0x105, RSCreate(RS1024x768, RS8bpp ) }, + { 0x190, RSCreate(RS1152x864, RS8bpp ) }, + { 0x107, RSCreate(RS1280x1024, RS8bpp ) }, + { 0x198, RSCreate(RS1408x1056, RS8bpp ) }, + { 0x11C, RSCreate(RS1600x1200, RS8bpp ) }, +#endif +#ifdef FBCON_HAS_CFB16 + { ~0, RSCreate(RSNoxNo, RS15bpp) }, + { 0x110, RSCreate(RS640x480, RS15bpp) }, + { 0x181, RSCreate(RS768x576, RS15bpp) }, + { 0x113, RSCreate(RS800x600, RS15bpp) }, + { 0x189, RSCreate(RS960x720, RS15bpp) }, + { 0x116, RSCreate(RS1024x768, RS15bpp) }, + { 0x191, RSCreate(RS1152x864, RS15bpp) }, + { 0x119, RSCreate(RS1280x1024, RS15bpp) }, + { 0x199, RSCreate(RS1408x1056, RS15bpp) }, + { 0x11D, RSCreate(RS1600x1200, RS15bpp) }, + { 0x111, RSCreate(RS640x480, RS16bpp) }, + { 0x182, RSCreate(RS768x576, RS16bpp) }, + { 0x114, RSCreate(RS800x600, RS16bpp) }, + { 0x18A, RSCreate(RS960x720, RS16bpp) }, + { 0x117, RSCreate(RS1024x768, RS16bpp) }, + { 0x192, RSCreate(RS1152x864, RS16bpp) }, + { 0x11A, RSCreate(RS1280x1024, RS16bpp) }, + { 0x19A, RSCreate(RS1408x1056, RS16bpp) }, + { 0x11E, RSCreate(RS1600x1200, RS16bpp) }, +#endif +#ifdef FBCON_HAS_CFB24 + { ~0, RSCreate(RSNoxNo, RS24bpp) }, + { 0x1B2, RSCreate(RS640x480, RS24bpp) }, + { 0x184, RSCreate(RS768x576, RS24bpp) }, + { 0x1B5, RSCreate(RS800x600, RS24bpp) }, + { 0x18C, RSCreate(RS960x720, RS24bpp) }, + { 0x1B8, RSCreate(RS1024x768, RS24bpp) }, + { 0x194, RSCreate(RS1152x864, RS24bpp) }, + { 0x1BB, RSCreate(RS1280x1024, RS24bpp) }, + { 0x19C, RSCreate(RS1408x1056, RS24bpp) }, + { 0x1BF, RSCreate(RS1600x1200, RS24bpp) }, +#endif +#ifdef FBCON_HAS_CFB32 + { ~0, RSCreate(RSNoxNo, RS32bpp) }, + { 0x112, RSCreate(RS640x480, RS32bpp) }, + { 0x183, RSCreate(RS768x576, RS32bpp) }, + { 0x115, RSCreate(RS800x600, RS32bpp) }, + { 0x18B, RSCreate(RS960x720, RS32bpp) }, + { 0x118, RSCreate(RS1024x768, RS32bpp) }, + { 0x193, RSCreate(RS1152x864, RS32bpp) }, + { 0x11B, RSCreate(RS1280x1024, RS32bpp) }, + { 0x19B, RSCreate(RS1408x1056, RS32bpp) }, + { 0x11F, RSCreate(RS1600x1200, RS32bpp) }, +#endif +#ifdef FBCON_HAS_VGATEXT + { ~0, RSCreate(RSNoxNo, RSText ) }, + { 0x002, RSCreate(RS640x400, RSText ) }, /* 80x25 */ + { 0x003, RSCreate(RS640x400, RSText ) }, /* 80x25 */ + { 0x007, RSCreate(RS640x400, RSText ) }, /* 80x25 */ + { 0x1C0, RSCreate(RS640x400, RSText8) }, /* 80x50 */ + { 0x108, RSCreate(RS640x480, RSText8) }, /* 80x60 */ + { 0x109, RSCreate(RS1056x400, RSText ) }, /* 132x25 */ + { 0x10A, RSCreate(RS1056x344, RSText8) }, /* 132x43 */ + { 0x10B, RSCreate(RS1056x400, RSText8) }, /* 132x50 */ + { 0x10C, RSCreate(RS1056x480, RSText8) }, /* 132x60 */ +#endif +#ifdef FBCON_HAS_CFB4 + { ~0, RSCreate(RSNoxNo, RS4bpp ) }, + { 0x010, RSCreate(RS640x350, RS4bpp ) }, + { 0x012, RSCreate(RS640x480, RS4bpp ) }, + { 0x102, RSCreate(RS800x600, RS4bpp ) }, + { 0x104, RSCreate(RS1024x768, RS4bpp ) }, + { 0x106, RSCreate(RS1280x1024, RS4bpp ) }, +#endif + { 0, 0 }}; + +static void __init matroxfb_init_params(void) { + /* fh from kHz to Hz */ + if (fh < 1000) + fh *= 1000; /* 1kHz minimum */ + /* maxclk */ + if (maxclk < 1000) maxclk *= 1000; /* kHz -> Hz, MHz -> kHz */ + if (maxclk < 1000000) maxclk *= 1000; /* kHz -> Hz, 1MHz minimum */ + /* fix VESA number */ + if (vesa != ~0) + vesa &= 0x1DFF; /* mask out clearscreen, acceleration and so on */ + + /* static settings */ + for (RSptr = vesamap; RSptr->vesa; RSptr++) { + if (RSptr->vesa == vesa) break; + } + if (!RSptr->vesa) { + printk(KERN_ERR "Invalid vesa mode 0x%04X\n", vesa); + RSptr = vesamap; + } + { + int res = RSResolution(RSptr->info)-1; + if (left == ~0) + left = timmings[res].left; + if (!xres) + xres = timmings[res].xres; + if (right == ~0) + right = timmings[res].right; + if (!hslen) + hslen = timmings[res].hslen; + if (upper == ~0) + upper = timmings[res].upper; + if (!yres) + yres = timmings[res].yres; + if (lower == ~0) + lower = timmings[res].lower; + if (!vslen) + vslen = timmings[res].vslen; + if (!(fv||fh||maxclk||pixclock)) + fv = timmings[res].vfreq; + if (depth == -1) + depth = RSDepth(RSptr->info); + } +} + +static struct pci_dev* pci_find(struct pci_dev* p) { + if (p) return p->next; + return pci_devices; +} + +static int __init matrox_init(void) { + struct pci_dev *pdev = NULL; + int found = 0; + + matroxfb_init_params(); + + while ((pdev = pci_find(pdev)) != NULL) { + if (!matroxfb_probe (pdev, NULL)) { + found++; + } + } + dev = found; + if (dev == 0) return -1; + pci_register_driver(&matroxfb_driver); + return 0; +} + +/* **************************** exit-time only **************************** */ + +static void __exit matrox_done(void) { + pci_unregister_driver(&matroxfb_driver); +} + +#ifndef MODULE + +/* ************************* init in-kernel code ************************** */ + +int __init matroxfb_setup(char *options) { + char *this_opt; + + DBG("matroxfb_setup") + + fontname[0] = '\0'; + + if (!options || !*options) + return 0; + + for(this_opt=strtok(options,","); this_opt; this_opt=strtok(NULL,",")) { + if (!*this_opt) continue; + + dprintk("matroxfb_setup: option %s\n", this_opt); + + if (!strncmp(this_opt, "dev:", 4)) + dev = simple_strtoul(this_opt+4, NULL, 0); + else if (!strncmp(this_opt, "depth:", 6)) { + switch (simple_strtoul(this_opt+6, NULL, 0)) { + case 0: depth = RSText; break; + case 4: depth = RS4bpp; break; + case 8: depth = RS8bpp; break; + case 15:depth = RS15bpp; break; + case 16:depth = RS16bpp; break; + case 24:depth = RS24bpp; break; + case 32:depth = RS32bpp; break; + default: + printk(KERN_ERR "matroxfb: unsupported color depth\n"); + } + } else if (!strncmp(this_opt, "xres:", 5)) + xres = simple_strtoul(this_opt+5, NULL, 0); + else if (!strncmp(this_opt, "yres:", 5)) + yres = simple_strtoul(this_opt+5, NULL, 0); + else if (!strncmp(this_opt, "vslen:", 6)) + vslen = simple_strtoul(this_opt+6, NULL, 0); + else if (!strncmp(this_opt, "hslen:", 6)) + hslen = simple_strtoul(this_opt+6, NULL, 0); + else if (!strncmp(this_opt, "left:", 5)) + left = simple_strtoul(this_opt+5, NULL, 0); + else if (!strncmp(this_opt, "right:", 6)) + right = simple_strtoul(this_opt+6, NULL, 0); + else if (!strncmp(this_opt, "upper:", 6)) + upper = simple_strtoul(this_opt+6, NULL, 0); + else if (!strncmp(this_opt, "lower:", 6)) + lower = simple_strtoul(this_opt+6, NULL, 0); + else if (!strncmp(this_opt, "pixclock:", 9)) + pixclock = simple_strtoul(this_opt+9, NULL, 0); + else if (!strncmp(this_opt, "sync:", 5)) + sync = simple_strtoul(this_opt+5, NULL, 0); + else if (!strncmp(this_opt, "vesa:", 5)) + vesa = simple_strtoul(this_opt+5, NULL, 0); + else if (!strncmp(this_opt, "font:", 5)) + strncpy(fontname, this_opt+5, sizeof(fontname)-1); + else if (!strncmp(this_opt, "maxclk:", 7)) + maxclk = simple_strtoul(this_opt+7, NULL, 0); + else if (!strncmp(this_opt, "fh:", 3)) + fh = simple_strtoul(this_opt+3, NULL, 0); + else if (!strncmp(this_opt, "fv:", 3)) + fv = simple_strtoul(this_opt+3, NULL, 0); + else if (!strncmp(this_opt, "mem:", 4)) + mem = simple_strtoul(this_opt+4, NULL, 0); + else if (!strncmp(this_opt, "mode:", 5)) + strncpy(videomode, this_opt+5, sizeof(videomode)-1); +#ifdef CONFIG_FB_OF + else if (!strncmp(this_opt, "vmode:", 6)) { + unsigned int vmode = simple_strtoul(this_opt+6, NULL, 0); + if (vmode > 0 && vmode <= VMODE_MAX) + default_vmode = vmode; + } else if (!strncmp(this_opt, "cmode:", 6)) { + unsigned int cmode = simple_strtoul(this_opt+6, NULL, 0); + switch (cmode) { + case 0: + case 8: + default_cmode = CMODE_8; + break; + case 15: + case 16: + default_cmode = CMODE_16; + break; + case 24: + case 32: + default_cmode = CMODE_32; + break; + } + } +#endif + else if (!strncmp(this_opt, "fastfont:", 9)) + fastfont = simple_strtoul(this_opt+9, NULL, 0); + else if (!strcmp(this_opt, "nofastfont")) /* fastfont:N and nofastfont (nofastfont = fastfont:0) */ + fastfont = 0; + else if (!strcmp(this_opt, "disabled")) /* nodisabled does not exist */ + disabled = 1; + else if (!strcmp(this_opt, "enabled")) /* noenabled does not exist */ + disabled = 0; + else if (!strcmp(this_opt, "sgram")) /* nosgram == sdram */ + sgram = 1; + else if (!strcmp(this_opt, "sdram")) + sgram = 0; + else { + int value = 1; + + if (!strncmp(this_opt, "no", 2)) { + value = 0; + this_opt += 2; + } + if (! strcmp(this_opt, "inverse")) + inverse = value; + else if (!strcmp(this_opt, "accel")) + noaccel = !value; + else if (!strcmp(this_opt, "pan")) + nopan = !value; + else if (!strcmp(this_opt, "pciretry")) + no_pci_retry = !value; + else if (!strcmp(this_opt, "vga")) + novga = !value; + else if (!strcmp(this_opt, "bios")) + nobios = !value; + else if (!strcmp(this_opt, "init")) + noinit = !value; +#ifdef CONFIG_MTRR + else if (!strcmp(this_opt, "mtrr")) + mtrr = value; +#endif + else if (!strcmp(this_opt, "inv24")) + inv24 = value; + else if (!strcmp(this_opt, "cross4MB")) + cross4MB = value; + else if (!strcmp(this_opt, "hwcursor")) + hwcursor = value; + else if (!strcmp(this_opt, "blink")) + blink = value; + else if (!strcmp(this_opt, "grayscale")) + grayscale = value; + else if (!strcmp(this_opt, "dfp")) + dfp = value; + else { + strncpy(videomode, this_opt, sizeof(videomode)-1); + } + } + } + return 0; +} + +static int __init initialized = 0; + +#ifdef CONFIG_FB_MATROX_I2C +extern int i2c_matroxfb_init (void); +#endif +#ifdef CONFIG_FB_MATROX_I2C +extern int i2c_matroxfb_init (void); +#endif +#ifdef CONFIG_FB_MATROX_MAVEN +extern int matroxfb_maven_init (void); +extern int matroxfb_crtc2_init (void); +#endif +int __init matroxfb_init(void) +{ + int err = 0; + DBG("matroxfb_init") + + if (disabled) + return -ENXIO; + if (!initialized) { + initialized = 1; + err = matrox_init(); + } + /* user can't hotplug matrox with Linux-2.2 ... */ + if (err) return err; + /* Fortunately, Linux-2.2 initializes i2c before fbdev */ +#ifdef CONFIG_FB_MATROX_I2C + err = i2c_matroxfb_init (); + if (err) return 0; +#endif +#ifdef CONFIG_FB_MATROX_MAVEN + err = matroxfb_maven_init (); + if (err) return 0; + err = matroxfb_crtc2_init (); +#endif + return 0; +} + +#else + +/* *************************** init module code **************************** */ + +MODULE_AUTHOR("(c) 1998,1999 Petr Vandrovec "); +MODULE_DESCRIPTION("Accelerated FBDev driver for Matrox Millennium/Mystique/G100/G200/G400"); +MODULE_PARM(mem, "i"); +MODULE_PARM_DESC(mem, "Size of available memory in MB, KB or B (2,4,8,12,16MB, default=autodetect)"); +MODULE_PARM(disabled, "i"); +MODULE_PARM_DESC(disabled, "Disabled (0 or 1=disabled) (default=0)"); +MODULE_PARM(noaccel, "i"); +MODULE_PARM_DESC(noaccel, "Do not use accelerating engine (0 or 1=disabled) (default=0)"); +MODULE_PARM(nopan, "i"); +MODULE_PARM_DESC(nopan, "Disable pan on startup (0 or 1=disabled) (default=0)"); +MODULE_PARM(no_pci_retry, "i"); +MODULE_PARM_DESC(no_pci_retry, "PCI retries enabled (0 or 1=disabled) (default=0)"); +MODULE_PARM(novga, "i"); +MODULE_PARM_DESC(novga, "VGA I/O (0x3C0-0x3DF) disabled (0 or 1=disabled) (default=0)"); +MODULE_PARM(nobios, "i"); +MODULE_PARM_DESC(nobios, "Disables ROM BIOS (0 or 1=disabled) (default=do not change BIOS state)"); +MODULE_PARM(noinit, "i"); +MODULE_PARM_DESC(noinit, "Disables W/SG/SD-RAM and bus interface initialization (0 or 1=do not initialize) (default=0)"); +MODULE_PARM(mtrr, "i"); +MODULE_PARM_DESC(mtrr, "This speeds up video memory accesses (0=disabled or 1) (default=1)"); +MODULE_PARM(sgram, "i"); +MODULE_PARM_DESC(sgram, "Indicates that G200/G400 has SGRAM memory (0=SDRAM, 1=SGRAM) (default=0)"); +MODULE_PARM(inv24, "i"); +MODULE_PARM_DESC(inv24, "Inverts clock polarity for 24bpp and loop frequency > 100MHz (default=do not invert polarity)"); +MODULE_PARM(inverse, "i"); +MODULE_PARM_DESC(inverse, "Inverse (0 or 1) (default=0)"); +#ifdef CONFIG_FB_MATROX_MULTIHEAD +MODULE_PARM(dev, "i"); +MODULE_PARM_DESC(dev, "Multihead support, attach to device ID (0..N) (default=all working)"); +#else +MODULE_PARM(dev, "i"); +MODULE_PARM_DESC(dev, "Multihead support, attach to device ID (0..N) (default=first working)"); +#endif +MODULE_PARM(vesa, "i"); +MODULE_PARM_DESC(vesa, "Startup videomode (0x000-0x1FF) (default=0x101)"); +MODULE_PARM(xres, "i"); +MODULE_PARM_DESC(xres, "Horizontal resolution (px), overrides xres from vesa (default=vesa)"); +MODULE_PARM(yres, "i"); +MODULE_PARM_DESC(yres, "Vertical resolution (scans), overrides yres from vesa (default=vesa)"); +MODULE_PARM(upper, "i"); +MODULE_PARM_DESC(upper, "Upper blank space (scans), overrides upper from vesa (default=vesa)"); +MODULE_PARM(lower, "i"); +MODULE_PARM_DESC(lower, "Lower blank space (scans), overrides lower from vesa (default=vesa)"); +MODULE_PARM(vslen, "i"); +MODULE_PARM_DESC(vslen, "Vertical sync length (scans), overrides lower from vesa (default=vesa)"); +MODULE_PARM(left, "i"); +MODULE_PARM_DESC(left, "Left blank space (px), overrides left from vesa (default=vesa)"); +MODULE_PARM(right, "i"); +MODULE_PARM_DESC(right, "Right blank space (px), overrides right from vesa (default=vesa)"); +MODULE_PARM(hslen, "i"); +MODULE_PARM_DESC(hslen, "Horizontal sync length (px), overrides hslen from vesa (default=vesa)"); +MODULE_PARM(pixclock, "i"); +MODULE_PARM_DESC(pixclock, "Pixelclock (ns), overrides pixclock from vesa (default=vesa)"); +MODULE_PARM(sync, "i"); +MODULE_PARM_DESC(sync, "Sync polarity, overrides sync from vesa (default=vesa)"); +MODULE_PARM(depth, "i"); +MODULE_PARM_DESC(depth, "Color depth (0=text,8,15,16,24,32) (default=vesa)"); +MODULE_PARM(maxclk, "i"); +MODULE_PARM_DESC(maxclk, "Startup maximal clock, 0-999MHz, 1000-999999kHz, 1000000-INF Hz"); +MODULE_PARM(fh, "i"); +MODULE_PARM_DESC(fh, "Startup horizontal frequency, 0-999kHz, 1000-INF Hz"); +MODULE_PARM(fv, "i"); +MODULE_PARM_DESC(fv, "Startup vertical frequency, 0-INF Hz\n" +"You should specify \"fv:max_monitor_vsync,fh:max_monitor_hsync,maxclk:max_monitor_dotclock\"\n"); +MODULE_PARM(hwcursor, "i"); +MODULE_PARM_DESC(hwcursor, "Enables hardware cursor (0 or 1) (default=0)"); +MODULE_PARM(blink, "i"); +MODULE_PARM_DESC(blink, "Enables hardware cursor blinking (0 or 1) (default=1)"); +MODULE_PARM(fastfont, "i"); +MODULE_PARM_DESC(fastfont, "Specifies, how much memory should be used for font data (0, 1024-65536 are reasonable) (default=0)"); +MODULE_PARM(grayscale, "i"); +MODULE_PARM_DESC(grayscale, "Sets display into grayscale. Works perfectly with paletized videomode (4, 8bpp), some limitations apply to 16, 24 and 32bpp videomodes (default=nograyscale)"); +MODULE_PARM(cross4MB, "i"); +MODULE_PARM_DESC(cross4MB, "Specifies that 4MB boundary can be in middle of line. (default=autodetected)"); +MODULE_PARM(dfp, "i"); +MODULE_PARM_DESC(dfp, "Specifies whether to use digital flat panel interface of G200/G400 (0 or 1) (default=0)"); +#ifdef CONFIG_FB_OF +MODULE_PARM(vmode, "i"); +MODULE_PARM_DESC(vmode, "Specify the vmode mode number that should be used (640x480 default)"); +MODULE_PARM(cmode, "i"); +MODULE_PARM_DESC(cmode, "Specify the video depth that should be used (8bit default)"); +#endif + +int __init init_module(void){ + + DBG("init_module") + + if (disabled) + return -ENXIO; + + if (depth == 0) + depth = RSText; + else if (depth == 4) + depth = RS4bpp; + else if (depth == 8) + depth = RS8bpp; + else if (depth == 15) + depth = RS15bpp; + else if (depth == 16) + depth = RS16bpp; + else if (depth == 24) + depth = RS24bpp; + else if (depth == 32) + depth = RS32bpp; + else if (depth != -1) { + printk(KERN_ERR "matroxfb: depth %d is not supported, using default\n", depth); + depth = -1; + } + matrox_init(); + /* never return failure; user can hotplug matrox later... */ + return 0; +} +#endif /* MODULE */ + +module_exit(matrox_done); +EXPORT_SYMBOL(matroxfb_register_driver); +EXPORT_SYMBOL(matroxfb_unregister_driver); + +/* matroxfb_misc */ +EXPORT_SYMBOL(matroxfb_DAC_in); +EXPORT_SYMBOL(matroxfb_DAC_out); +EXPORT_SYMBOL(matroxfb_var2my); +EXPORT_SYMBOL(matroxfb_PLL_calcclock); +#ifndef CONFIG_FB_MATROX_MULTIHEAD +struct matrox_fb_info matroxfb_global_mxinfo; +EXPORT_SYMBOL(matroxfb_global_mxinfo); +#endif +EXPORT_SYMBOL(matrox_text_loadfont); /* for matroxfb_accel */ +EXPORT_SYMBOL(matroxfb_createcursorshape); /* accel, DAC1064, Ti3026 */ +EXPORT_SYMBOL(matroxfb_fastfont_tryset); /* accel */ +EXPORT_SYMBOL(matroxfb_fastfont_init); /* DAC1064, Ti3026 */ +EXPORT_SYMBOL(matroxfb_vgaHWinit); /* DAC1064, Ti3026 */ +EXPORT_SYMBOL(matroxfb_vgaHWrestore); /* DAC1064, Ti3026 */ +#ifdef MATROXFB_USE_SPINLOCK +spinlock_t matroxfb_spinlock = SPIN_LOCK_UNLOCKED; +EXPORT_SYMBOL(matroxfb_spinlock); +#endif + +/* matroxfb_Ti3026 */ +#ifdef CONFIG_FB_MATROX_MILLENIUM +EXPORT_SYMBOL(matrox_millennium); +#endif + +/* matroxfb_DAC1064 */ +#ifdef CONFIG_FB_MATROX_MYSTIQUE +EXPORT_SYMBOL(matrox_mystique); +#endif +#ifdef CONFIG_FB_MATROX_G100 +EXPORT_SYMBOL(matrox_G100); +#endif +#ifdef NEED_DAC1064 +EXPORT_SYMBOL(DAC1064_global_init); +EXPORT_SYMBOL(DAC1064_global_restore); +#endif + + +/* + * Overrides for Emacs so that we follow Linus's tabbing style. + * --------------------------------------------------------------------------- + * Local variables: + * c-basic-offset: 8 + * End: + */ diff -uNr linux-2.2.16.SuSE/drivers/video/matrox/matroxfb_base.h linux.compile/drivers/video/matrox/matroxfb_base.h --- linux-2.2.16.SuSE/drivers/video/matrox/matroxfb_base.h Thu Jan 1 01:00:00 1970 +++ linux.compile/drivers/video/matrox/matroxfb_base.h Wed Jul 19 02:15:07 2000 @@ -0,0 +1,855 @@ +/* + * + * Hardware accelerated Matrox Millennium I, II, Mystique, G100, G200 and G400 + * + * (c) 1998,1999 Petr Vandrovec + * + */ +#ifndef __MATROXFB_H__ +#define __MATROXFB_H__ + +/* general, but fairly heavy, debugging */ +#undef MATROXFB_DEBUG + +/* heavy debugging: */ +/* -- logs putc[s], so everytime a char is displayed, it's logged */ +#undef MATROXFB_DEBUG_HEAVY + +/* This one _could_ cause infinite loops */ +/* It _does_ cause lots and lots of messages during idle loops */ +#undef MATROXFB_DEBUG_LOOP + +/* Debug register calls, too? */ +#undef MATROXFB_DEBUG_REG + +/* Guard accelerator accesses with spin_lock_irqsave... */ +#undef MATROXFB_USE_SPINLOCKS + +#include +/* Don't include module.h here, otherwise every single file is a module of it's own */ +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include + +#include +#include +#ifdef CONFIG_MTRR +#include +#endif + +#include